| Revision as of 19:41, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 469586434 of page Abecarnil for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 19:41, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 476076871 of page Abetimus for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 438081138 |
|
| verifiedrevid = 455360316 |
|
|
| IUPAC_name = |
|
| IUPAC_name = propan-2-yl 4-(methoxymethyl)-6-(phenylmethoxy) -9''H''-pyridoindole-3-carboxylate |
|
|
| image = Abecarnil.svg |
|
| image = |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
| Line 13: |
Line 19: |
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = 3.4 hours (IV), 7 hours (oral) |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 111841-85-1 --> |
|
| CAS_number = <!-- blanked - oldvalue: 169147-32-4 --> |
|
| ATC_prefix = none |
|
| ATC_prefix = L04 |
|
| ATC_suffix = |
|
| ATC_suffix = AA22 |
| ⚫ |
| PubChem = 65914 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 59323 |
|
| ChemSpiderID = NA |
|
⚫ |
| PubChem = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| UNII = IZM1PNJ3JL |
|
|
|
| DrugBank = |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D02594 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 454095 |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
| C=24 | H=24 | N=2 | O=4 |
|
|
| molecular_weight = 404.458 g/mol |
|
| molecular_weight = |
|
| smiles = O=C(OC(C)C)c4ncc3c(c2c(ccc(OCc1ccccc1)c2)n3)c4COC |
|
|
| InChI = 1/C24H24N2O4/c1-15(2)30-24(27)23-19(14-28-3)22-18-11-17(29-13-16-7-5-4-6-8-16)9-10-20(18)26-21(22)12-25-23/h4-12,15,26H,13-14H2,1-3H3 |
|
|
| InChIKey = RLFKILXOLJVUNF-UHFFFAOYAF |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C24H24N2O4/c1-15(2)30-24(27)23-19(14-28-3)22-18-11-17(29-13-16-7-5-4-6-8-16)9-10-20(18)26-21(22)12-25-23/h4-12,15,26H,13-14H2,1-3H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = RLFKILXOLJVUNF-UHFFFAOYSA-N |
|
|
}} |
|
}} |
