Revision as of 20:04, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 460121729 of page Actinidiolide for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey', 'CASNo').← Previous edit |
Revision as of 20:05, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 474862755 of page Actinomycin for the Chem/Drugbox validation project (updated: 'DrugBank', 'KEGG').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 457803653 |
|
| Watchedfields = changed |
|
|
|
| IUPAC_name = 2-amino-''N,N<nowiki>'</nowiki>''- bis oxatetraazacyclohexadecin- 10-yl]- 4,6-dimethyl- 3-oxo- 3''H''-phenoxazine- 1,9-dicarboxamide |
⚫ |
| verifiedrevid = 399373348 |
|
|
|
| image = Actinomycin D.png |
|
| ImageFile = Actinidiolide chemical structure.png |
|
|
|
| drug_name = Actinomycin D |
⚫ |
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
|
|
|
| ImageSize = 121 |
|
|
|
<!--Clinical data--> |
|
| ImageName = Skeletal formula of actinidiolide ((7a''R'')-7a-meth) |
|
|
|
| tradename = |
|
| IUPACName = 4,4,7a-Trimethyl-4,5-dihydrobenzofuran-2(7a''H'')-one |
|
|
|
| MedlinePlus = a682224 |
|
| OtherNames = 4,4,7a-Trimethyl-5''H''-1-benzofuran-2-one |
|
|
|
| pregnancy_category = |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| legal_status = |
⚫ |
| CASNo = <!-- blanked - oldvalue: 17063-17-1 --> |
|
|
|
| routes_of_administration = |
⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
|
|
|
|
| PubChem2 = 15558330 |
|
|
|
<!--Pharmacokinetic data--> |
⚫ |
| PubChem2_Ref = {{Pubchemcite|correct| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| bioavailability = |
|
| StdInChI = 1S/C11H14O2/c1-10(2)5-4-6-11(3)8(10)7-9(12)13-11/h4,6-7H,5H2,1-3H3/t11-/m0/s1 |
|
|
|
| protein_bound = 5% |
|
|
| metabolism = |
|
|
| elimination_half-life = 36 hours |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 50-76-0 |
|
|
| ATC_prefix = L01 |
|
|
| ATC_suffix = DA01 |
|
|
| ATC_supplemental = |
|
⚫ |
| PubChem = 2019 |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = <!-- blanked - oldvalue: APRD00124 --> |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 10482167 |
|
|
| NIAID_ChemDB = 009885 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 1CC1JFE158 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
⚫ |
| KEGG = <!-- blanked - oldvalue: C06770 --> |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 27666 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1554 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=62 | H=86 | N=12 | O=16 |
|
|
| molecular_weight = 1255.42 g/mol |
|
|
| InChI = 1/C62H86N12O16/c1-27(2)42-59(84)73-23-17-19-36(73)57(82)69(13)25-38(75)71(15)48(29(5)6)61(86)88-33(11)44(55(80)65-42)67-53(78)35-22-21-31(9)51-46(35)64-47-40(41(63)50(77)32(10)52(47)90-51)54(79)68-45-34(12)89-62(87)49(30(7)8)72(16)39(76)26-70(14)58(83)37-20-18-24-74(37)60(85)43(28(3)4)66-56(45)81/h21-22,27-30,33-34,36-37,42-45,48-49H,17-20,23-26,63H2,1-16H3,(H,65,80)(H,66,81)(H,67,78)(H,68,79)/t33-,34-,36+,37+,42-,43-,44+,45+,48+,49+/m1/s1 |
|
|
| InChIKey = RJURFGZVJUQBHK-IIXSONLDBN |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C62H86N12O16/c1-27(2)42-59(84)73-23-17-19-36(73)57(82)69(13)25-38(75)71(15)48(29(5)6)61(86)88-33(11)44(55(80)65-42)67-53(78)35-22-21-31(9)51-46(35)64-47-40(41(63)50(77)32(10)52(47)90-51)54(79)68-45-34(12)89-62(87)49(30(7)8)72(16)39(76)26-70(14)58(83)37-20-18-24-74(37)60(85)43(28(3)4)66-56(45)81/h21-22,27-30,33-34,36-37,42-45,48-49H,17-20,23-26,63H2,1-16H3,(H,65,80)(H,66,81)(H,67,78)(H,68,79)/t33-,34-,36+,37+,42-,43-,44+,45+,48+,49+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VGQSMHFBCKKQHB-NSHDSACASA-N |
|
| StdInChIKey = RJURFGZVJUQBHK-IIXSONLDSA-N |
|
|
| synonyms = <small>2-Amino- 4,6-dimethyl- 3-oxo- 3H-phenoxazine- 1,9-dicarboxylic acid bis- </small> |
|
| PubChem}} |
|
|
| PubChem1 = 11062957 |
|
|
| PubChem1_Ref = {{Pubchemcite|correct| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C11H14O2/c1-10(2)5-4-6-11(3)8(10)7-9(12)13-11/h4,6-7H,5H2,1-3H3/t11-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = VGQSMHFBCKKQHB-NSHDSACASA-N |
|
|
| PubChem}} |
|
|
| PubChem1_Comment = <small>(7a''R'')-7a-meth</small> |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C11H14O2/c1-10(2)5-4-6-11(3)8(10)7-9(12)13-11/h4,6-7H,5H2,1-3H3/t11-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = VGQSMHFBCKKQHB-NSHDSACASA-N |
|
⚫ |
| PubChem = 11084442 |
|
|
| PubChem_Ref = {{Pubchemcite|correct| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C11H14O2/c1-10(2)5-4-6-11(3)8(10)7-9(12)13-11/h4,6-7H,5H2,1-3H3/t11-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = VGQSMHFBCKKQHB-NSHDSACASA-N |
|
|
| PubChem}} |
|
|
| PubChem_Comment = <small>(7a''S'')-7a-meth</small> |
|
|
| ChemSpiderID1 = 13078154 |
|
|
| ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}} |
|
⚫ |
| ChemSpiderID = 10250059 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID_Comment = <small>(7a''S'')-7a-meth</small> |
|
|
| SMILES = CC12OC(=O)C=C1C(C)(C)CC=C2 |
|
|
| SMILES1 = CC1(CC=CC2(C1=CC(=O)O2)C)C |
|
|
| SMILES2 = O=C1C=C2C(C)(C)CC=CC2(C)O1 |
|
|
| InChI = 1/C11H14O2/c1-10(2)5-4-6-11(3)8(10)7-9(12)13-11/h4,6-7H,5H2,1-3H3 |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| C = 11 |
|
|
| H = 14 |
|
|
| O = 2 |
|
|
| ExactMass = 178.099379692 g mol<sup>-1</sup> |
|
|
}} |
|
|
}} |
|
}} |