Revision as of 20:09, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 473311633 of page Adenosine_monophosphate for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 20:09, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 399377256 of page Adenosine_thiamine_triphosphate for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 443657695 |
|
| verifiedrevid = 399375402 |
|
| ImageFile = AMP structure.svg |
|
| ImageFile = Adenosine thiamine triphosphate.png |
|
| ImageSize = 200px |
|
| ImageSize = 250px |
|
|
| IUPACName = 3-((4-amino-2-methylpyrimidin-5-yl)methyl)-5-(2-(((((((((2''R'',3''S'',4''R'',5''R'')-5-(6-amino-9''H''-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methoxy)(hydroxy)phosphoryl)oxy)(hydroxy)phosphoryl)oxy)(hydroxy)phosphoryl)oxy)ethyl)-4-methylthiazol-3-ium |
|
| ImageName = Skeletal formula of AMP |
|
|
|
| IUPACName_hidden = yes |
|
| ImageFile1 = Adenosine-monophosphate-anion-3D-balls.png |
|
|
|
| OtherNames = P1,P3-(Adenosine-5'-thiamine) triphosphate |
|
| ImageSize1 = 200px |
|
|
| ImageName1 = Ball-and-stick model of AMP |
|
|
| IUPACName = 5'-Adenylic acid |
|
|
| OtherNames = |
|
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 5858 |
|
| ChemSpiderID = 13082023 |
|
|
| InChI = 1/C22H30N9O13P3S/c1-11-15(48-10-30(11)6-13-5-25-12(2)29-19(13)23)3-4-40-45(34,35)43-47(38,39)44-46(36,37)41-7-14-17(32)18(33)22(42-14)31-9-28-16-20(24)26-8-27-21(16)31/h5,8-10,14,17-18,22,32-33H,3-4,6-7H2,1-2H3,(H6-,23,24,25,26,27,29,34,35,36,37,38,39)/p+1/t14-,17-,18-,22-/m1/s1 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| SMILES1 = O=P(O)(OC3O(n1c2ncnc(N)c2nc1)(O)3O)OP(=O)(O)OP(=O)(O)OCCc4sc(c4C)Cc5c(nc(nc5)C)N |
|
| UNII = 415SHH325A |
|
|
|
| InChIKey = FGOYXNBJKMNPDH-YLNAWJOLBZ |
|
| InChI = 1/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
|
|
| InChIKey = UDMBCSSLTHHNCD-KQYNXXCUBP |
|
|
| SMILES1 = c1nc(c2c(n1)n(cn2)3(((O3)COP(=O)(O)O)O)O)N |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 752 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
|
| StdInChI = 1S/C22H30N9O13P3S/c1-11-15(48-10-30(11)6-13-5-25-12(2)29-19(13)23)3-4-40-45(34,35)43-47(38,39)44-46(36,37)41-7-14-17(32)18(33)22(42-14)31-9-28-16-20(24)26-8-27-21(16)31/h5,8-10,14,17-18,22,32-33H,3-4,6-7H2,1-2H3,(H6-,23,24,25,26,27,29,34,35,36,37,38,39)/p+1/t14-,17-,18-,22-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UDMBCSSLTHHNCD-KQYNXXCUSA-N |
|
| StdInChIKey = FGOYXNBJKMNPDH-SAJUPQAESA-O |
|
| CASNo = 61-19-8 |
|
| CASNo = <!-- blanked - oldvalue: 30632-11-2 --> |
|
|
| CASNo_Comment = (chloride) |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| PubChem = |
|
| PubChem = 15938962 |
|
|
| SMILES = NC1=NC=NC2=C1N=CN23(O)(O)(COP(OP(OP(OCCC4=C(C)(CC5=CN=C(C)N=C5N)=CS4)(O)=O)(O)=O)(O)=O)O3 |
|
| IUPHAR_ligand = 2455 |
|
|
|
| MeSHName=adenosine+thiamine+triphosphate |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00131 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 16027 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C00020 |
|
|
| SMILES = O=P(O)(O)OC3O(n2cnc1c(ncnc12)N)(O)3O |
|
|
| MeSHName = Adenosine+monophosphate |
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| C=22|H=31|N=9|O=13|P=3|S=1 |
|
| Formula = C<sub>10</sub>H<sub>14</sub>N<sub>5</sub>O<sub>7</sub>P |
|
|
| MolarMass = 347.22 g/mol |
|
|
| Appearance = |
|
| Appearance = |
|
| pKa = 0.9, 3.8, 6.1 |
|
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
⚫ |
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
⚫ |
| Solubility = |
|
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |