Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 20:40, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 466371219 of page Allopurinol for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 20:41, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464737220 of page Allose for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey', 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{drugbox {{Chembox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 443376027 | verifiedrevid = 464374888
| Reference = <ref>{{Merck11th}}</ref>
| IUPAC_name = 1H-pyrazolopyrimidin-4(2H)-one
| ImageFile = Allose.png
| image = Allopurinol V.1.svg
| width = 150 | ImageSize = 200px
| ImageName = Stereo structural formula of (6R)-allopyranose
| image2 = Allopurinol_3d_structure.png
| PIN = Allose

| SystematicName = (2''R'',3''R'',4''R'')-2,3,4,5,6-Pentahydroxyhexanal
<!--Clinical data-->
| Section1 = {{Chembox Identifiers
| tradename = Lopurin, Zyloprim
| CASNo = <!-- blanked - oldvalue: 2595-97-3 -->
| Drugs.com = {{drugs.com|monograph|allopurinol}}
| CASNo_Comment = (D)
| MedlinePlus = a682673
⚫ | CASNo_Ref = {{cascite|changed|??}}
| pregnancy_category = C(USA)
| legal_US = Rx-only | CASNo1 = 7635-11-2
| CASNo1_Comment = (L)
| routes_of_administration = tablet (100, 300 mg)
⚫ | CASNo1_Ref = {{cascite|??|??}}

⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
<!--Pharmacokinetic data-->
⚫ | ChemSpiderID = 92408
| bioavailability = 78±20%
| protein_bound = Negligible
| metabolism = hepatic (80% oxypurinol, 10% allopurinol ribosides)
| elimination_half-life = 2 hours (oxypurinol 18-30 hours)

<!--Identifiers-->
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
⚫ | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 315-30-0
| ATC_prefix = M04
| ATC_suffix = AA01
| ATC_supplemental =
| PubChem = 2094
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00437
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 2010
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 63CZ7GJN5I
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00224
| ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 40279 | ChEBI = 40822
| SMILES = OCC(O)(O)(O)(O)C=O
| ChEMBL_Ref = {{ebicite|correct|EBI}}
⚫ | StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| ChEMBL = 1467
| StdInChI = 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5-,6+/m0/s1

⚫ | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
<!--Chemical data-->
⚫ | StdInChIKey = GZCGUPFRVQAUEE-BGPJRJDNSA-N
| C=5 | H=4 | N=4 | O=1
}}
| molecular_weight = 136.112 g/mol
| Section2 = {{Chembox Properties
| smiles = c1c2c(n1)ncnc2O
| C = 6
| InChI = 1/C5H4N4O/c10-5-3-1-8-9-4(3)6-2-7-5/h1-2H,(H2,6,7,8,9,10)
| H = 12
⚫ | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| O = 6
| StdInChI = 1S/C5H4N4O/c10-5-3-1-8-9-4(3)6-2-7-5/h1-2H,(H2,6,7,8,9,10)
| ExactMass = 180.063388116 g mol<sup>-1</sup>
⚫ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| MeltingPtC = 128}}
⚫ | StdInChIKey = OFCNXPDARWKPPY-UHFFFAOYSA-N
}} }}

Revision as of 20:41, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 464737220 of page Allose with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Stereo structural formula of (6R)-allopyranose
Names
Preferred IUPAC name Allose
Systematic IUPAC name (2R,3R,4R)-2,3,4,5,6-Pentahydroxyhexanal
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChemSpider
InChI
  • InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5-,6+/m0/s1Key: GZCGUPFRVQAUEE-BGPJRJDNSA-N
SMILES
  • OCC(O)(O)(O)(O)C=O
Properties
Chemical formula C6H12O6
Molar mass 180.156 g·mol
Melting point 128 °C (262 °F; 401 K)
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒N verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
  1. The Merck Index: An Encyclopedia of Chemicals, Drugs, and Biologicals (11th ed.). Merck. 1989. ISBN 091191028X.