Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 07:02, 18 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 475696257 of page Isoprenaline for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 07:02, 18 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476303085 of page Isoprene for the Chem/Drugbox validation project (updated: 'ChEBI').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{chembox
| verifiedrevid = 416014858 | verifiedrevid = 472437843
| Name = Isoprene
| IUPAC_name = 4-benzene-1,2-diol
| ImageFileL1 = Isoprene.svg
| image = isoproterenol.png
| ImageSizeL1 = 100px

| ImageNameL1 = Skeletal formula
<!--Clinical data-->
| ImageFileR1 = Isoprene-3d.png
| tradename =
| ImageSizeR1 = 120px
| Drugs.com = {{drugs.com|international|isoprenaline}}
| ImageNameR1 = Space-filling model
| MedlinePlus = a601236
| IUPACName = 2-methyl-1,3-butadiene
| pregnancy_category = C
| legal_status = | OtherNames = terpene
| Section1 = {{Chembox Identifiers
| routes_of_administration = inhaled 80-120μg
| CASNo = 78-79-5

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =

<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number = 7683-59-2
| ATC_prefix = C01
| ATC_suffix = CA02
| ATC_supplemental = {{ATC|R03|AB02}}<br />{{ATC|R03|CB01}}
| PubChem = 3779
| IUPHAR_ligand = 536
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01064
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3647
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = L628TT009W
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08090 | KEGG = C16521
| ChEMBL_Ref = {{ebicite|correct|EBI}} | UNII_Ref = {{fdacite|correct|FDA}}
| ChEMBL = 434 | UNII = 0A62964IBU
| ChEBI = 35194

| PubChem = 6557
<!--Chemical data-->
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| C=11 | H=17 | N=1 | O=3
| ChemSpiderID = 6309
| molecular_weight = 211.258 g/mol
| smiles = Oc1ccc(cc1O)C(O)CNC(C)C | SMILES = CC(=C)C=C
| InChI = 1/C11H17NO3/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8/h3-5,7,11-15H,6H2,1-2H3 | InChI = 1/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3
| InChIKey = JWZZKOKVBUJMES-UHFFFAOYAN | InChIKey = RRHGJUQNOFWUDK-UHFFFAOYAS
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H17NO3/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8/h3-5,7,11-15H,6H2,1-2H3 | StdInChI = 1S/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JWZZKOKVBUJMES-UHFFFAOYSA-N | StdInChIKey = RRHGJUQNOFWUDK-UHFFFAOYSA-N
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>5</sub>H<sub>8</sub>
| MolarMass = 68.12 g/mol
| Density = 0.681 g/cm³
| MeltingPt = −143.95 °C
| BoilingPt = 34.067 °C
}}
}} }}

Revision as of 07:02, 18 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 476303085 of page Isoprene with values updated to verified values.
Isoprene
Skeletal formula
Skeletal formula
Space-filling model
Space-filling model
Names
IUPAC name 2-methyl-1,3-butadiene
Other names terpene
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChemSpider
KEGG
PubChem CID
UNII
InChI
  • InChI=1S/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3Key: RRHGJUQNOFWUDK-UHFFFAOYSA-N
  • InChI=1/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3Key: RRHGJUQNOFWUDK-UHFFFAOYAS
SMILES
  • CC(=C)C=C
Properties
Chemical formula C5H8
Molar mass 68.12 g/mol
Density 0.681 g/cm³
Melting point −143.95 °C
Boiling point 34.067 °C
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkverify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound