Revision as of 11:31, 6 March 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 478567242 of page Gusperimus for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 11:35, 6 March 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 480461736 of page Inulin for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{chembox |
|
| ImageFile = Gusperimus.svg |
|
| ImageFile = Inulin_strukturformel.png |
|
|
| ImageSize = 300px |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
|
| OtherNames = |
|
| ImageName = Skeletal formula of a gusperimus minor tautomer |
|
|
| IUPACName = 1-Amino-19-guanidino-11-hydroxy-4,9,12-triazanonadecane-10,13-dione{{Citation needed|date=February 2012}} |
|
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| DrugBank = DB00638 |
⚫ |
| CASNo = <!-- blanked - oldvalue: 104317-84-2 --> |
|
|
⚫ |
| UNII = JOS53KRJ01 |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
|
| PubChem = 55362 |
|
| PubChem = 24763 |
|
⚫ |
| ChEMBL = <!-- blanked - oldvalue: 1201646 --> |
|
| PubChem_Ref = {{Pubchemcite|correct|Pubchem}} |
|
|
| PubChem1 = 91272 |
|
| CASNo = 9005-80-5 |
|
⚫ |
| ChemSpiderID = NA |
|
| PubChem1_Ref = {{Pubchemcite|correct|Pubchem}} |
|
|
⚫ |
}} |
|
| PubChem1_Comment = <small>''S''</small> |
|
⚫ |
| ChemSpiderID = 49995 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID1 = 82420 |
|
|
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID1_Comment = <small>''S''</small> |
|
⚫ |
| UNII = UJ0ZJ76DO9 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| KEGG = D08032 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| MeSHName = gusperimus |
|
|
| ChEMBL = 406117 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL1 = 1172736 |
|
|
| ChEMBL1_Ref = {{ebicite|correct|EBI}} |
|
|
| ATCCode_prefix = L04 |
|
|
| ATCCode_suffix = AA19 |
|
|
| SMILES = NCCCNCCCCNC(=O)C(O)NC(=O)CCCCCCNC(N)=N |
|
|
| StdInChI = 1S/C17H37N7O3/c18-9-7-11-21-10-5-6-12-22-15(26)16(27)24-14(25)8-3-1-2-4-13-23-17(19)20/h16,21,27H,1-13,18H2,(H,22,26)(H,24,25)(H4,19,20,23) |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = IDINUJSAMVOPCM-UHFFFAOYSA-N |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
}} |
|
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = {{Chem|C|17|N|7|H|37|O|3}} |
|
| Formula = C<sub>6n</sub>H<sub>10n+2</sub>O<sub>5n+1</sub> |
|
| MolarMass = 387.5208 g mol<sup>−1</sup> |
|
| MolarMass= Polymer; depends on n |
|
|
| Density= |
|
| ExactMass = 387.295788085 g mol<sup>−1</sup> |
|
|
|
| MeltingPt= |
|
| LogP = −0.933 |
|
|
|
| BoilingPt= |
|
| pKa = 11.588 |
|
|
⚫ |
}} |
|
| pKb = 2.409 |
|
⚫ |
}} |
|
|
| Section3 = {{Chembox Pharmacology |
|
|
| Bioavail = 100% |
|
|
| AdminRoutes = {{Unbulleted list|Intravenous|Subcutaneous}} |
|
|
| Legal_status = Rx |
|
|
}} |
|
|
| Section4 = {{Chembox Related |
|
|
| OtherCpds = {{Unbulleted list|]|]}} |
|
|
}} |
|
|
}} |
|
}} |