This is an old revision of this page, as edited by Beetstra (talk | contribs) at 10:36, 21 November 2011 (Saving copy of the {{drugbox}} taken from revid 461542868 of page Tamsulosin for the Chem/Drugbox validation project (updated: 'DrugBank').). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.
Revision as of 10:36, 21 November 2011 by Beetstra (talk | contribs) (Saving copy of the {{drugbox}} taken from revid 461542868 of page Tamsulosin for the Chem/Drugbox validation project (updated: 'DrugBank').)(diff) ← Previous revision | Latest revision (diff) | Newer revision → (diff) | This page contains a copy of the infobox ({{drugbox}}) taken from revid 461542868 of page Tamsulosin with values updated to verified values. |
{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 417212755 | IUPAC_name = (R)-5-(2-{amino}propyl)-2-methoxybenzene-1-sulfonamide | image = Tamsulosin Structural Formulae.png | width = 250
| tradename = Flomax | Drugs.com = Monograph | MedlinePlus = a698012 | licence_US = Tamsulosin | pregnancy_AU = B2 | pregnancy_US = B | legal_AU = S4 | legal_UK = POM | legal_US = Rx-only | routes_of_administration = oral
| bioavailability = 100% (oral) | metabolism = hepatic | elimination_half-life = 9–13 hours | excretion = 76% renal
| CASNo_Ref = | CAS_number_Ref = | CAS_number = 106133-20-4 | ATC_prefix = G04 | ATC_suffix = CA02 | PubChem = 129211 | IUPHAR_ligand = 488 | DrugBank_Ref = | DrugBank = DB00706 | ChemSpiderID_Ref = | ChemSpiderID = 114457 | UNII_Ref = | UNII = G3P28OML5I | KEGG_Ref = | KEGG = D08560 | ChEBI_Ref = | ChEBI = 9398 | ChEMBL_Ref = | ChEMBL = 836
| C=20 | H=28 | N=2 | O=5 | S=1 | molecular_weight = 408.51 | smiles = CCOc1ccccc1OCCN(C)Cc1ccc(OC)c(c1)S(=O)(=O)N | StdInChI_Ref = | StdInChI = 1S/C20H28N2O5S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24)/t15-/m1/s1 | StdInChIKey_Ref = | StdInChIKey = DRHKJLXJIQTDTD-OAHLLOKOSA-N }}