This is an old revision of this page, as edited by Beetstra (talk | contribs) at 11:52, 5 December 2011 (Saving copy of the {{drugbox}} taken from revid 456536506 of page Perindopril for the Chem/Drugbox validation project (updated: 'DrugBank', 'UNII', 'CAS_number').). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.
Revision as of 11:52, 5 December 2011 by Beetstra (talk | contribs) (Saving copy of the {{drugbox}} taken from revid 456536506 of page Perindopril for the Chem/Drugbox validation project (updated: 'DrugBank', 'UNII', 'CAS_number').)(diff) ← Previous revision | Latest revision (diff) | Newer revision → (diff) | This page contains a copy of the infobox ({{drugbox}}) taken from revid 456536506 of page Perindopril with values updated to verified values. |
{{Drugbox | Verifiedfields = changed | verifiedrevid = 418739936 | IUPAC_name = (2S,3aS,7aS)-1-amino}propanoyl]-octahydro-1H-indole-2-carboxylic acid | image = Perindopril.svg | width = 180
| tradename = Aceon | Drugs.com = Monograph | MedlinePlus = a602017 | pregnancy_category = D | legal_status = | routes_of_administration = oral
| bioavailability = 24% | protein_bound = 20% | metabolism = Renal | elimination_half-life = 1 hour - 17 hours for perindoprilat (active metabolite)
| CASNo_Ref =
| CAS_number_Ref =
| CAS_number =
| ATC_prefix = C09
| ATC_suffix = AA04
| ATC_supplemental =
C09BA04 (WHO) (with diuretics)
C09BB04 (WHO) (with amlodipine)
| PubChem = 107807
| DrugBank_Ref =
| DrugBank = DB00790
| ChemSpiderID_Ref =
| ChemSpiderID = 96956
| UNII_Ref =
| UNII = Y5GMK36KGY
| KEGG_Ref =
| KEGG = D03753
| ChEBI_Ref =
| ChEBI = 8024
| ChEMBL_Ref =
| ChEMBL = 1581
| C=19 | H=32 | N=2 | O=5 | molecular_weight = 368.468 g/mol | smiles = O=C(OCC)(N(C(=O)N1(C(=O)O)C2CCCC12)C)CCC | InChI = 1/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/t12-,13-,14-,15-,16-/m0/s1 | InChIKey = IPVQLZZIHOAWMC-QXKUPLGCBD | StdInChI_Ref = | StdInChI = 1S/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/t12-,13-,14-,15-,16-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = IPVQLZZIHOAWMC-QXKUPLGCSA-N }}