Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation

This is an old revision of this page, as edited by Beetstra (talk | contribs) at 12:33, 6 December 2011 (Saving copy of the {{drugbox}} taken from revid 458299463 of page Ramipril for the Chem/Drugbox validation project (updated: 'DrugBank').). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.

Revision as of 12:33, 6 December 2011 by Beetstra (talk | contribs) (Saving copy of the {{drugbox}} taken from revid 458299463 of page Ramipril for the Chem/Drugbox validation project (updated: 'DrugBank').)(diff) ← Previous revision | Latest revision (diff) | Newer revision → (diff)
This page contains a copy of the infobox ({{drugbox}}) taken from revid 458299463 of page Ramipril with values updated to verified values.

{{Drugbox | Verifiedfields = changed | verifiedrevid = 458297779 | IUPAC_name = (2S,3aS,6aS)-1-amino}propanoyl]-octahydrocyclopentapyrrole-2-carboxylic acid | image = Ramipril.svg

| tradename = Altace | Drugs.com = Monograph | MedlinePlus = a692027 | pregnancy_category = D | legal_UK = POM | legal_US = Rx-only | routes_of_administration = Oral

| bioavailability = 28% | protein_bound = 73% (ramipril)
56% (ramiprilat) | metabolism = Hepatic, to ramiprilat | elimination_half-life = 2 to 4 hours | excretion = Renal (60%) and fecal (40%)

| CASNo_Ref = | CAS_number_Ref = | CAS_number = 87333-19-5 | ATC_prefix = C09 | ATC_suffix = AA05 | PubChem = 5362129 | DrugBank_Ref = | DrugBank = DB00178 | ChemSpiderID_Ref = | ChemSpiderID = 4514937 | UNII_Ref = | UNII = L35JN3I7SJ | KEGG_Ref = | KEGG = D00421 | ChEBI_Ref = | ChEBI = 8774 | ChEMBL_Ref = | ChEMBL = 1168

| C=23 | H=32 | N=2 | O=5 | molecular_weight = 416.511 g/mol | smiles = O=C(OCC)(N(C(=O)N1(C(=O)O)C2CCC12)C)CCc3ccccc3 | InChI = 1/C23H32N2O5/c1-3-30-23(29)18(13-12-16-8-5-4-6-9-16)24-15(2)21(26)25-19-11-7-10-17(19)14-20(25)22(27)28/h4-6,8-9,15,17-20,24H,3,7,10-14H2,1-2H3,(H,27,28)/t15-,17-,18-,19-,20-/m0/s1 | InChIKey = HDACQVRGBOVJII-JBDAPHQKBG | StdInChI_Ref = | StdInChI = 1S/C23H32N2O5/c1-3-30-23(29)18(13-12-16-8-5-4-6-9-16)24-15(2)21(26)25-19-11-7-10-17(19)14-20(25)22(27)28/h4-6,8-9,15,17-20,24H,3,7,10-14H2,1-2H3,(H,27,28)/t15-,17-,18-,19-,20-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = HDACQVRGBOVJII-JBDAPHQKSA-N }}