Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation

This is an old revision of this page, as edited by Beetstra (talk | contribs) at 12:24, 10 January 2012 (Saving copy of the {{drugbox}} taken from revid 469413133 of page Terizidone for the Chem/Drugbox validation project (updated: 'CAS_number').). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.

Revision as of 12:24, 10 January 2012 by Beetstra (talk | contribs) (Saving copy of the {{drugbox}} taken from revid 469413133 of page Terizidone for the Chem/Drugbox validation project (updated: 'CAS_number').)(diff) ← Previous revision | Latest revision (diff) | Newer revision → (diff)
This page contains a copy of the infobox ({{drugbox}}) taken from revid 469413133 of page Terizidone with values updated to verified values.

{{Drugbox | verifiedrevid = 447906096 | IUPAC_name = 4,4'-{1,4-phenylenebis}diisoxazolidin-3-one | image = terizidone.png

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref = | CAS_number = | ATC_prefix = J04 | ATC_suffix = AK03 | PubChem = 65720 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 59144 | UNII_Ref = | UNII = 1199LEX5N8 | KEGG_Ref = | KEGG = D07247

| C=14 | H=14 | N=4 | O=4 | molecular_weight = 302.286 g/mol | smiles = O=C3NOCC3/N=C/c2ccc(/C=N/C1C(=O)NOC1)cc2 | InChI = 1/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+ | InChIKey = ODKYYBOHSVLGNU-IAGONARPBB | StdInChI_Ref = | StdInChI = 1S/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+ | StdInChIKey_Ref = | StdInChIKey = ODKYYBOHSVLGNU-IAGONARPSA-N | synonyms = 4-phenyl}methylidene)amino]-1,2-oxazolidin-3-one }}