| Revision as of 05:28, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 468360060 of page Alpha-Carotene for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 11:11, 1 February 2024 edit Maxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,042 edits resolved maint error |
| Line 1: |
Line 1: |
|
|
{{Short description|Previtamin}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{cs1 config|name-list-style=vanc}} |
|
|
{{lowercasetitle}} |
|
|
{{Use mdy dates|date=February 2024}} |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 454645651 |
|
| verifiedrevid = 477318860 |
|
| ImageFile = Alpha-carotene.svg |
|
| ImageFile = Alpha-carotene.svg |
|
| ImageSize = 300px |
|
| ImageSize = 300px |
|
| ImageAlt1 = Skeletal formula |
|
| ImageAlt = Skeletal formula |
|
| ImageFile1 = Alpha-Carotene-3D-spacefill.png |
|
| ImageFile1 = Alpha-Carotene-3D-spacefill.png |
|
| ImageSize1 = 300px |
|
| ImageSize1 = 300px |
|
| ImageAlt1 = Space-filling model |
|
| ImageAlt1 = Space-filling model |
|
|Name=α-Carotene |
|
| Name = α-Carotene |
|
|IUPACName= |
|
| IUPACName = (6′''R'')-β,ε-Carotene |
|
|
| SystematicName = 1,3,3-Trimethyl-2-<nowiki/>{(1''E'',3''E'',5''E'',7''E'',9''E'',11''E'',13''E'',15''E'',17''E'')-3,7,12,16-tetramethyl-18-octadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl}cyclohex-1-ene |
|
|OtherNames= |
|
| OtherNames = |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 3571861 |
|
| ChemSpiderID = 3571861 |
|
| InChI = 1/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-23,25-28,37H,15-16,24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+ |
|
| InChI = 1/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-23,25-28,37H,15-16,24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+ |
| Line 20: |
Line 25: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ANVAOWXLWRTKGA-JLTXGRSLSA-N |
|
| StdInChIKey = ANVAOWXLWRTKGA-JLTXGRSLSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 7488-99-5 --> |
|
| CASNo = 7488-99-5 |
|
| PubChem=6419725 |
|
| PubChem = 6419725 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 45XWE1Z69V |
|
| UNII = 45XWE1Z69V |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 28425 |
|
| ChEBI = 28425 |
|
| SMILES = C\C2=C\CCC(C)(C)C2/C=CC(\C)=C\C=C\C(\C)=C\C=C\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(/C)CCCC1(C)C |
|
| SMILES = C\C2=C\CCC(C)(C)C2/C=CC(\C)=C\C=C\C(\C)=C\C=C\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(/C)CCCC1(C)C |
|
⚫ |
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
⚫ |
| C=40 |H=56 |
|
⚫ |
| MolarMass = 536.873 |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
|
| Solubility = |
|
⚫ |
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
| ⚫ |
|Section2= {{Chembox Properties |
|
|
|
'''α-Carotene''' (''alpha''-carotene) is a form of ] with a β-] ring at one end and an α-] ring at the opposite end. It is the second most common form of ]. |
| ⚫ |
| C=40 |H=56 |
|
|
|
|
| ⚫ |
| MolarMass=536.873 |
|
|
|
==Human physiology== |
|
| Appearance= |
|
|
|
In American and Chinese adults, the mean concentration of serum α-carotene was 4.71 μg/dL. Including 4.22 μg/dL among men and 5.31 μg/dL among women.<ref name=Li2010>{{cite journal|vauthors=Li C, Ford ES, Zhao G, Balluz LS, Giles WH, Liu S |title=Serum α-carotene concentrations and risk of death among US Adults: the Third National Health and Nutrition Examination Survey Follow-up Study |journal=Arch. Intern. Med. |volume=171 |issue=6 |pages=507–15 |date=March 2011 |doi=10.1001/archinternmed.2010.440 |pmid=21098341 |url=http://archinte.ama-assn.org/cgi/content/full/archinternmed.2010.440v1 |archive-url=https://web.archive.org/web/20101129085914/http://archinte.ama-assn.org/cgi/content/full/archinternmed.2010.440v1|archive-date=November 29, 2010 |doi-access=free}} |
|
| Density= |
|
|
|
* {{cite news |vauthors=Nordqvist C|date=November 22, 2010 |title=Those With High Alpha-Carotene Blood Levels Live Much Longer |work=Medical News Today |url=http://www.medicalnewstoday.com/articles/208965.php}}</ref><ref> {{Webarchive|url=https://web.archive.org/web/20120513164242/http://www.tuftshealthletter.com/ShowArticle.aspx?RowID=928 |date=May 13, 2012 }}, Tufts Health and Nutrition Letter, March 2011</ref> |
|
| MeltingPt= |
|
|
|
|
|
| BoilingPt= |
|
|
|
==Dietary sources== |
|
| Solubility= |
|
|
|
The following vegetables are rich in alpha-carotene:<ref name=Li2010/> |
| ⚫ |
}} |
|
|
|
* Yellow-orange vegetables: ]s (the main source for U.S. adults), ]es, ], ] |
| ⚫ |
|Section3= {{Chembox Hazards |
|
|
|
* Dark-green vegetables: ], ]s, ]s, ], ] greens, ], leaf ], ] |
|
| MainHazards= |
|
|
|
|
|
| FlashPt= |
|
|
|
==Research== |
|
| Autoignition= |
|
|
|
A 2018 meta-analysis found that both dietary and ] α-carotene are associated with a lower risk of all-cause ]. The highest circulating α-carotene category, compared to the lowest, correlated with a 32% reduction in the risk of all-cause mortality, while increased dietary α-carotene intake was linked to a 21% decrease in the risk of all-cause mortality.<ref name="pmid30239557">{{cite journal| vauthors=Jayedi A, Rashidy-Pour A, Parohan M, Zargar MS, Shab-Bidar S| title=Dietary Antioxidants, Circulating Antioxidant Concentrations, Total Antioxidant Capacity, and Risk of All-Cause Mortality: A Systematic Review and Dose-Response Meta-Analysis of Prospective Observational Studies. | journal=Adv Nutr | year= 2018 | volume= 9 | issue= 6 | pages= 701–716 | pmid=30239557 | doi=10.1093/advances/nmy040 | pmc=6247336 }} </ref> |
| ⚫ |
}} |
|
|
|
|
| ⚫ |
}} |
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Carotenoids}} |
|
|
{{Vitamin}} |
|
|
{{Terpenoids}} |
|
|
|
|
|
{{DEFAULTSORT:Carotene, Alpha-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
] |