| Revision as of 05:29, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 399498580 of page Alpha-Difluoromethyl-DOPA for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 17:19, 17 September 2023 edit KoIobok (talk | contribs)Extended confirmed users1,350 edits Changed Category:Amino acids to Category:Alpha-Amino acids |
| Line 1: |
Line 1: |
|
|
{{lowercasetitle}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 399497541 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|Name=α-Difluoromethyl-DOPA |
|
|
⚫ |
| verifiedrevid = 477318986 |
| ⚫ |
|ImageFile=Alpha-difluoromethyl-DOPA.png |
|
|
⚫ |
| Name = α-Difluoromethyl-DOPA |
|
|ImageSize=200px |
|
|
⚫ |
| ImageFile = Alpha-difluoromethyl-DOPA.png |
| ⚫ |
|Name=α-Difluoromethyl-DOPA |
|
|
|
| ImageAlt = Skeletal formula |
| ⚫ |
|IUPACName=(2''S'')-2-Amino-2--3,3-difluoropropanoic acid |
|
|
|
| ImageFile1 = Alpha-Difluoromethyl-DOPA molecule ball.png |
|
|OtherNames= |
|
|
|
| ImageAlt1 = Ball-and-stick model of α-difluoromethyl-DOPA |
|
⚫ |
| SystematicName = (2''S'')-2-Amino-2--3,3-difluoropropanoic acid |
|
|
| OtherNames = α-(Difluoromethyl)-3-hydroxy-L-tyrosine |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 114812 |
|
| ChemSpiderID = 114812 |
|
| InChI = 1/C10H11F2NO4/c11-8(12)10(13,9(16)17)4-5-1-2-6(14)7(15)3-5/h1-3,8,14-15H,4,13H2,(H,16,17)/t10-/m1/s1 |
|
| InChI = 1/C10H11F2NO4/c11-8(12)10(13,9(16)17)4-5-1-2-6(14)7(15)3-5/h1-3,8,14-15H,4,13H2,(H,16,17)/t10-/m1/s1 |
|
| InChIKey = XZVHHLNLLVICFA-SNVBAGLBBM |
|
| InChIKey = XZVHHLNLLVICFA-SNVBAGLBBM |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 4FX102BRL6 |
|
| SMILES1 = FC(F)(C(=O)O)(N)Cc1cc(O)c(O)cc1 |
|
| SMILES1 = FC(F)(C(=O)O)(N)Cc1cc(O)c(O)cc1 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 18: |
Line 23: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XZVHHLNLLVICFA-SNVBAGLBSA-N |
|
| StdInChIKey = XZVHHLNLLVICFA-SNVBAGLBSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 69955-03-9 --> |
|
|
|
| CASNo = 160401-53-6 |
|
| PubChem=129677 |
|
| PubChem = 129677 |
|
| SMILES=C1=CC(=C(C=C1C(C(F)F)(C(=O)O)N)O)O |
|
| SMILES = C1=CC(=C(C=C1C(C(F)F)(C(=O)O)N)O)O |
|
| MeSHName=alpha-difluoromethyl-DOPA |
|
| MeSHName = alpha-difluoromethyl-DOPA |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>10</sub>H<sub>11</sub>F<sub>2</sub>NO<sub>4</sub> |
|
| Formula = C<sub>10</sub>H<sub>11</sub>F<sub>2</sub>NO<sub>4</sub> |
|
| MolarMass=247.20 g/mol |
|
| MolarMass = 247.20 g/mol |
|
| Appearance= |
|
| Appearance = |
|
| Density= |
|
| Density = 1.528 g/mL |
|
| MeltingPt= |
|
| MeltingPt = |
|
|
| BoilingPtC = 479 |
|
| BoilingPt= |
|
|
| Solubility= |
|
| Solubility = |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt= |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''α-Difluoromethyl-3,4-dihydroxyphenylalanine''' ('''DFMD''', '''DFM-DOPA''') is a ].<ref name="pmid6781106">{{cite journal |vauthors=Zbinden G, Brändle E | title = Inhibition of 5-hydroxytryptophan nephrotoxicity by alpha-difluoromethyl-dopa, an inhibitor or L-amino acid decarboxylase | journal = ] | volume = 5 | issue = 2 | pages = 125–9 |date=February 1980 | pmid = 6781106 | doi = 10.1016/0378-4274(80)90161-7}}</ref> |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
|
|
|
{{Monoamine metabolism modulators}} |
|
|
{{Phenethylamines}} |
|
|
|
|
⚫ |
{{DEFAULTSORT:Difluoromethyl-DOPA, alpha-}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |