| Revision as of 11:14, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 448836587 of page Epsilon-Viniferin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo'). |
Latest revision as of 22:02, 14 September 2023 edit SilverLocust (talk | contribs)Administrators25,011 edits displaytitle |
| Line 1: |
Line 1: |
|
|
{{lowercase title}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 448834734 |
|
|
|
| Watchedfields = changed |
|
| Name = ε-Viniferin |
|
|
|
| verifiedrevid = 461094439 |
|
| Reference = <!-- <ref></ref> --> |
|
|
|
| Name = ε-Viniferin |
|
| ImageFile = Epsilon-viniferin.svg |
|
|
|
| Reference = <!-- <ref>{{cite web |url=http://www./ |title=Home |website=}}</ref> --> |
|
| ImageSize = 200px |
|
|
|
| ImageFile = Epsilon-viniferin.svg |
|
| IUPACName = 5--2,3-dihydro-1-benzofuran-3-yl]benzene-1,3-diol |
|
|
|
| ImageSize = 200px |
|
| OtherNames = Viniferin; ''epsilon''-Viniferin; (-)-''epsilon''-Viniferin |
|
|
|
| ImageCaption = (−)-''trans''-ε-Viniferin |
|
|Section1= {{Chembox Identifiers |
|
|
|
| PIN = 5-<nowiki/>{(2''R'',3''R'')-6-Hydroxy-2-(4-hydroxyphenyl)-4--2,3-dihydro-1-benzofuran-3-yl}benzene-1,3-diol |
|
| CASNo = <!-- blanked - oldvalue: 62218-08-0 --> |
|
|
|
| OtherNames = Viniferin<br />''epsilon''-Viniferin<br />(−)-''epsilon''-Viniferin<br />(−)-(''E'')-epsilon-viniferin<br />trans-ε-viniferin<br />(−)-Trans-epsilon-viniferin<ref>{{Cite journal | last1 = Yáñez | first1 = M. | last2 = Fraiz | first2 = N. | last3 = Cano | first3 = E. | last4 = Orallo | first4 = F. | title = (−)-Trans-ε-viniferin, a polyphenol present in wines, is an inhibitor of noradrenaline and 5-hydroxytryptamine uptake and of monoamine oxidase activity | doi = 10.1016/j.ejphar.2006.06.005 | journal = European Journal of Pharmacology | volume = 542 | issue = 1–3 | pages = 54–60 | year = 2006 | pmid = 16828740}}</ref><br /><nowiki>Iso--viniferin</nowiki><ref>{{Cite journal |
|
| ChEMBL = 1224875 |
|
|
|
| last1 = Cornacchione | first1 = S. |
|
|
| last2 = Sadick | first2 = N. S. |
|
|
| last3 = Neveu | first3 = M. |
|
|
| last4 = Talbourdet | first4 = S. |
|
|
| last5 = Lazou | first5 = K. |
|
|
| last6 = Viron | first6 = C. |
|
|
| last7 = Renimel | first7 = I. |
|
|
| last8 = De Quéral | first8 = D. |
|
|
| last9 = Kurfurst | first9 = R. |
|
|
| last10 = Schnebert | first10 = S. |
|
|
| last11 = Heusèle | first11 = C. |
|
|
| last12 = André | first12 = P. |
|
|
| last13 = Perrier | first13 = E. |
|
|
| title = In vivo skin antioxidant effect of a new combination based on a specific Vitis vinifera shoot extract and a biotechnological extract |
|
|
| journal = Journal of Drugs in Dermatology |
|
|
| volume = 6 |
|
|
| issue = 6 Suppl |
|
|
| pages = s8–13 |
|
|
| year = 2007 |
|
|
| pmid = 17691204 |
|
|
}}</ref><br />''cis''-ε-viniferin<br />Cis-epsilon-viniferin<ref name=Kim>{{Cite journal | last1 = Kim | first1 = H. J. | last2 = Chang | first2 = E. J. | last3 = Cho | first3 = S. H. | last4 = Chung | first4 = S. K. | last5 = Park | first5 = H. D. | last6 = Choi | first6 = S. W. | doi = 10.1271/bbb.66.1990 | title = Antioxidative Activity of Resveratrol and Its Derivatives Isolated from Seeds of Paeonia lactiflora | journal = Bioscience, Biotechnology, and Biochemistry | volume = 66 | issue = 9 | pages = 1990–3 | year = 2002 | pmid = 12400706| s2cid = 24367582 | doi-access = free }}</ref> |
|
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = 62218-08-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 0K8Z2K6Y7O |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1224875 |
|
| PubChem = 5281728 |
|
| PubChem = 5281728 |
|
| SMILES = C1=CC(=CC=C1C=CC2=CC(=CC3=C2C(C(O3)C4=CC=C(C=C4)O)C5=CC(=CC(=C5)O)O)O)O |
|
| SMILES = C1=CC(=CC=C1C=CC2=CC(=CC3=C2C(C(O3)C4=CC=C(C=C4)O)C5=CC(=CC(=C5)O)O)O)O |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4445043 |
|
| ChemSpiderID = 4445043 |
|
| InChI = 1/C28H22O6/c29-20-7-2-16(3-8-20)1-4-18-11-24(33)15-25-26(18)27(19-12-22(31)14-23(32)13-19)28(34-25)17-5-9-21(30)10-6-17/h1-15,27-33H/b4-1+/t27-,28+/m1/s1 |
|
| InChI = 1/C28H22O6/c29-20-7-2-16(3-8-20)1-4-18-11-24(33)15-25-26(18)27(19-12-22(31)14-23(32)13-19)28(34-25)17-5-9-21(30)10-6-17/h1-15,27-33H/b4-1+/t27-,28+/m1/s1 |
|
| InChIKey = FQWLMRXWKZGLFI-YVYUXZJTBS |
|
| InChIKey = FQWLMRXWKZGLFI-YVYUXZJTBS |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C28H22O6/c29-20-7-2-16(3-8-20)1-4-18-11-24(33)15-25-26(18)27(19-12-22(31)14-23(32)13-19)28(34-25)17-5-9-21(30)10-6-17/h1-15,27-33H/b4-1+/t27-,28+/m1/s1 |
|
| StdInChI = 1S/C28H22O6/c29-20-7-2-16(3-8-20)1-4-18-11-24(33)15-25-26(18)27(19-12-22(31)14-23(32)13-19)28(34-25)17-5-9-21(30)10-6-17/h1-15,27-33H/b4-1+/t27-,28+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = FQWLMRXWKZGLFI-YVYUXZJTSA-N |
|
| StdInChIKey = FQWLMRXWKZGLFI-YVYUXZJTSA-N |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=28|H=22|O=6 |
|
| C=28 | H=22 | O=6 |
|
|
| Appearance = |
|
| ExactMass = 454.141638 u |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''ε-Viniferin''' is a naturally occurring phenol, belonging to the ]s family. It is a ] ]. |
|
|
|
|
|
It is found in '']''<ref>{{Cite journal | last1 = Privat | first1 = C. | last2 = Telo | first2 = J. O. P. | last3 = Bernardes-Genisson | first3 = V. | last4 = Vieira | first4 = A. | last5 = Souchard | first5 = J. P. | last6 = Nepveu | first6 = F. O. | doi = 10.1021/jf010676t | title = Antioxidant Properties oftrans-ε-Viniferin As Compared to Stilbene Derivatives in Aqueous and Nonaqueous Media | journal = Journal of Agricultural and Food Chemistry | volume = 50 | issue = 5 | pages = 1213–1217 | year = 2002 | pmid = 11853506}}</ref> grapevines,<ref>{{Cite journal | last1 = Langcake | first1 = P. | last2 = Pryce | first2 = R. J. | doi = 10.1007/BF02124034 | title = A new class of phytoalexins from grapevines | journal = Experientia | volume = 33 | issue = 2 | pages = 151–152 | year = 1977 | pmid = 844529| s2cid = 34370048 }}</ref> in ]s,<ref>{{Cite journal |
|
|
| last1 = Vitrac | first1 = X. |
|
|
| last2 = Bornet | first2 = A. L. |
|
|
| last3 = Vanderlinde | first3 = R. |
|
|
| last4 = Valls | first4 = J. |
|
|
| last5 = Richard | first5 = T. |
|
|
| last6 = Delaunay | first6 = J. C. |
|
|
| last7 = Mérillon | first7 = J. M. |
|
|
| last8 = Teissédre | first8 = P. L. |
|
|
| doi = 10.1021/jf050122g |
|
|
| title = Determination of Stilbenes (δ-viniferin, trans-astringin, trans-piceid, cis- and trans-resveratrol, ε-viniferin) in Brazilian Wines |
|
|
| journal = Journal of Agricultural and Food Chemistry |
|
|
| volume = 53 |
|
|
| issue = 14 |
|
|
| pages = 5664–5669 |
|
|
| year = 2005 |
|
|
| pmid = 15998130 |
|
|
}}</ref> in the Oriental medicinal plant '']'' and in the stem bark of '']''.<ref>{{Cite journal | last1 = Wibowo | first1 = A. | last2 = Ahmat | first2 = N. | last3 = Hamzah | first3 = A. S. | last4 = Sufian | first4 = A. S. | last5 = Ismail | first5 = N. H. | last6 = Ahmad | first6 = R. | last7 = Jaafar | first7 = F. M. | last8 = Takayama | first8 = H. | doi = 10.1016/j.fitote.2011.02.006 | title = Malaysianol A, a new trimer resveratrol oligomer from the stem bark of Dryobalanops aromatica | journal = Fitoterapia | volume = 82 | issue = 4 | pages = 676–681 | year = 2011 | pmid = 21338657}}</ref> |
|
|
<br />Cis-epsilon-viniferin can be found in '']''.<ref name=Kim/> |
|
|
|
|
|
It shows a human ] enzymes inhibition activity.<ref>{{Cite journal | last1 = Piver | first1 = B. | last2 = Berthou | first2 = F. O. | last3 = Dreano | first3 = Y. | last4 = Lucas | first4 = D. L. | title = Differential inhibition of human cytochrome P450 enzymes by ε-viniferin, the dimer of resveratrol: Comparison with resveratrol and polyphenols from alcoholized beverages | doi = 10.1016/S0024-3205(03)00420-X | journal = Life Sciences | volume = 73 | issue = 9 | pages = 1199–1213 | year = 2003 | pmid = 12818727}}</ref> |
|
|
|
|
|
== Glycosides == |
|
|
] is a ''C''-] of ε-viniferin. |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
*{{Commonscatinline|Epsilon-Viniferin}} |
|
|
* |
|
|
|
|
|
{{Oligostilbenoid}} |
|
|
|
|
|
{{DEFAULTSORT:Viniferin, epsilon-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{Aromatic-stub}} |