Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 1,2,3-Trimethylbenzene: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 16:04, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443243242 of page 1,2,3-Trimethylbenzene for the Chem/Drugbox validation project (updated: '').  Latest revision as of 21:10, 17 November 2024 edit Arjayay (talk | contribs)Autopatrolled, Extended confirmed users, Page movers, Pending changes reviewers, Rollbackers624,904 editsm Duplicate word reworded 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{Chembox
| Watchedfields = changed
| verifiedrevid = 443241783 | verifiedrevid = 477202533
| ImageFileL1 = Hemellitol.svg | ImageFileL1 = Hemellitol.svg
| ImageSizeL1 = 100px
| ImageFileR1 = 1,2,3-Trimethylbenzene-3D-balls.png | ImageFileR1 = 1,2,3-Trimethylbenzene-3D-balls.png
⚫ | PIN = 1,2,3-Trimethylbenzene
| ImageSizeR1 = 120px
⚫ | IUPACName = 1,2,3-Trimethylbenzene
| OtherNames = Hemellitol; Hemimellitol, Hemimelithol; Hemimellitine; Hemimellitene | OtherNames = Hemellitol; Hemimellitol, Hemimelithol; Hemimellitine; Hemimellitene
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 526-73-8
| PubChem = 10686 | CASNo = 526-73-8
| ChEBI_Ref = {{ebicite|correct|EBI}} | Beilstein = 1903410
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 34037 | ChEBI = 34037
| ChEMBL = 1797279
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 10236
| EINECS = 208-394-8
| Gmelin = 326517
| PubChem = 10686
⚫ | RTECS = DC3300000
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ZK4R7UPH6R
| UNNumber = 1993
⚫ | SMILES = c1(cccc(c1C)C)C
⚫ | InChI = 1S/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3 | StdInChI = 1S/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FYGHSUNMUKGBRK-UHFFFAOYSA-N | StdInChIKey = FYGHSUNMUKGBRK-UHFFFAOYSA-N
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 10236
⚫ | RTECS = DC3300000
⚫ | SMILES = c1(cccc(c1C)C)C
⚫ | InChI = InChI=1S/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| C=9|H=12 | C=9 | H=12
| Appearance = Colorless liquid<ref name=GESTIS>{{GESTIS|ZVG=31060}}</ref>
| Appearance =
| Density = 0.894 g/mL | Density = 0.89 g/mL<ref name=GESTIS/>
| MeltingPtC = −25 | MeltingPtC = −25
| MeltingPt_ref = <ref name=GESTIS/>
| BoilingPtCL = 175
| BoilingPtCH = 176 | BoilingPtC = 176
| BoilingPt_ref = <ref name=GESTIS/>
| Solubility =
| Solubility = 0.006% (20°C)<ref name=PGCH/>
| VaporPressure = 1 mmHg (16.7°C)<ref name=PGCH/>
}} }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards = Flammable<ref name=pocket></ref>
| MainHazards =
| FlashPtF = 51
| FlashPt = {{convert|119|F|C}}
| FlashPt_ref = <ref name=GESTIS/>
| Autoignition =
| AutoignitionPtF = 470
| RPhrases = {{R10}} {{R37}}
| AutoignitionPt_ref = <ref name=GESTIS/>
| SPhrases = {{S16}}
| GHSPictograms = {{GHS02}}{{GHS07}}{{GHS08}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|226|315|319|335}}
| PPhrases = {{P-phrases|210|233|240|241|242|243|261|264|271|280|302+352|303+361+353|304+340|305+351+338|312|321|332+313|337+313|362|370+378|403+233|403+235|405|501}}
| PEL = none<ref name=PGCH>{{PGCH|0637}}</ref>
| ExploLimits = 0.8%-6.6%<ref name=PGCH/>
| IDLH = N.D.<ref name=PGCH/>
| REL = TWA 25 ppm (125 mg/m{{sup|3}})<ref name=PGCH/>
}} }}
}} }}

'''1,2,3-Trimethylbenzene''' is an ] with the chemical formula C{{sub|6}}H{{sub|3}}(CH{{sub|3}}){{sub|3}}. Classified as an ], it is a flammable colorless liquid. It is nearly insoluble in water but soluble in organic solvents.

The compound occurs naturally in ] and ]. It is one of the three ]s of ]. It is used in jet fuel, mixed with other ], to prevent the formation of solid particles which might damage the engine.

German chemist {{Ill|Oscar Georg Friedrich Jacobsen|lt=Oscar Jacobsen|de|Oscar Jacobsen}} first prepared the hydrocarbon in 1882 and designated it '''hemellitol''' as a reference to the trivial name of ].<ref>{{Cite journal |last=Jacobsen |first=Oscar |date=1882 |title=Ueber Isodurol, Isodurylsäuren und das dritte Trimethylbenzol |url=https://books.google.com/books?id=Mxb-NAhE8K4C&pg=PA1857 |journal=Berichte der deutschen chemischen Gesellschaft |language=en |volume=15 |issue=2 |pages=1853–1858 |doi=10.1002/cber.18820150292 |issn=0365-9496}}</ref> Four years later he also discovered it in the coal tar.<ref>{{Cite journal |last=Jacobsen |first=Oscar |date=1886 |title=Beitrag zur Kenntniss der zwischen 170 und 200° siedenden Kohlenwasserstoffe des Steinkohlentheeröls |url=https://books.google.com/books?id=YzBJAAAAYAAJ&pg=PA2511 |journal=Berichte der deutschen chemischen Gesellschaft |language=en |volume=19 |issue=2 |pages=2511–2515 |doi=10.1002/cber.188601902195 |issn=0365-9496}}</ref>

== Production ==
Industrially, it is isolated from the C{{sub|9}} ] fraction during ]. It is also generated by ] of ] and ]s.<ref name="Ullmanns">Karl Griesbaum, Arno Behr, Dieter Biedenkapp, Heinz-Werner Voges, Dorothea Garbe, Christian Paetz, Gerd Collin, Dieter Mayer, Hartmut Höke "Hydrocarbons" in Ullmann's Encyclopedia of Industrial Chemistry 2002 Wiley-VCH, Weinheim. {{doi|10.1002/14356007.a13_227}}</ref>

== References ==
{{reflist}}

{{DEFAULTSORT:Trimethylbenzene, 1, 2, 3-}}
]
]


{{hydrocarbon-stub}}
{{Hydrocarbons}}