| Revision as of 15:47, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 452835581 of page 1,2,6-Trigalloyl_glucose for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 04:04, 17 December 2024 edit Mdewman6 (talk | contribs)Extended confirmed users, Page movers, New page reviewers, Pending changes reviewers, Rollbackers21,715 edits post move additions |
| Line 1: |
Line 1: |
|
|
{{Other uses|Trigalloyl glucose (disambiguation){{!}}Trigalloylglucose}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 443914203 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 477199669 |
|
| ImageFile = 1,2,6-Trigalloyl glucose.svg |
|
| ImageFile = 1,2,6-Trigalloyl glucose.svg |
|
⚫ |
| ImageName = Chemical structure of 1,2,6-trigalloyl glucose |
|
| ImageSize = 200px |
|
|
|
| IUPACName = β-<small>D</small>-Glucopyranose 1,2,6-tris(3,4,5-trihydroxybenzoate) |
| ⚫ |
| ImageName = Chemical structure of 1,2,6-trigalloyl-glucose |
|
|
| IUPACName = oxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
|
| SystematicName = (2''S'',3''R'',4''S'',5''S'',6''R'')-4,5-Dihydroxy-6-<nowiki/>{methyl}oxane-2,3-diyl bis(3,4,5-trihydroxybenzoate) |
|
| OtherNames = 1,2,6-trikis-O-galloyl-beta-D-glucose<br>1-O,2-O,6-O-Trigalloyl-beta-D-glucose<br>1,2,6-tri-O-gallose-beta-D-glucopyranose<br>1,2,6-tris-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranose |
|
| OtherNames = 1,2,6-tris-''O''-galloyl-β-{{small|D}}-glucose<br>1-''O'',2-''O'',6-''O''-Trigalloyl-β-{{small|D}}-glucose<br>1,2,6-Tri-''O''-gallose-β-{{small|D}}-glucopyranose<br>1,2,6-Tris-''O''-(3,4,5-trihydroxybenzoyl)-β-{{small|D}}-glucopyranose |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}= |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 20015942 |
|
| ChemSpiderID = 20015942 |
|
| InChIKey = |
|
| InChIKey = |
| Line 16: |
Line 18: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}= |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}= |
|
| StdInChIKey = XVILXNSBQKKWKL-UZLUZJFJSA-N |
|
| StdInChIKey = XVILXNSBQKKWKL-UZLUZJFJSA-N |
|
| CASNo = <!-- blanked - oldvalue: 79886-49-0 --> |
|
| CASNo = 79886-49-0 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|changed|CAS}} |
|
| CASOther = |
|
| CASNoOther = |
|
| PubChem = 440308 |
|
| PubChem = 440308 |
|
| SMILES = O1(COC(C2=CC(O)=C(O)C(O)=C2)=O)O(OC(C3=CC(O)=C(O)C(O)=C3)=O)(OC(C4=CC(O)=C(O)C(O)=C4)=O)1O |
|
| SMILES = O1(COC(C2=CC(O)=C(O)C(O)=C2)=O)O(OC(C3=CC(O)=C(O)C(O)=C3)=O)(OC(C4=CC(O)=C(O)C(O)=C4)=O)1O |
| Line 24: |
Line 26: |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=27|H=24|O=18 |
|
| C=27 | H=24 | O=18 |
|
| ExactMass = 636.096264 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 34: |
Line 35: |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''1,2,6-Trigalloylglucose''', or more specifically '''1,2,6-tri-''O''-galloyl-β-<small>D</small>-glucose''', is a ] found in cell cultures of '']''.<ref>Gallotannin production in cell cultures of Cornus officinalis Sieb. et Zucc. Yazaki K. and Okuda T., Plant cell reports, 1989, vol. 8, no6, pp. 346-349, {{INIST|7353523}}, {{doi|10.1007/BF00716670}}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Gallotannin}} |
|
|
|
|
|
{{DEFAULTSORT:Trigalloyl glucose, 1,2,6-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{aromatic-stub}} |