| Revision as of 02:06, 12 April 2011 editGrutness (talk | contribs)Autopatrolled, Administrators316,282 editsmNo edit summary← Previous edit |
Latest revision as of 20:47, 9 September 2024 edit undoMarbletan (talk | contribs)Extended confirmed users5,350 editsNo edit summary |
| (8 intermediate revisions by 8 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 400738098 |
|
| verifiedrevid = 423616865 |
|
| ImageFile = 1,3,8-Trihydroxyanthraquinone.svg |
|
| ImageFile = 1,3,8-Trihydroxyanthraquinone.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
| Line 8: |
Line 8: |
|
| ImageSize1 = 200px |
|
| ImageSize1 = 200px |
|
| ImageName1 = Ball-and-stick model |
|
| ImageName1 = Ball-and-stick model |
|
| IUPACName = 1,3,8-trihydroxyanthracene-9,10-dione |
|
| PIN = 1,3,8-Trihydroxyanthracene-9,10-dione |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|PubChem}} |
|
| CASNo = 52431-74-0 |
|
| CASNo = 52431-74-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = |
|
|
|
| UNII = CZ3VFD7G4S |
|
⚫ |
| PubChem = 12435249 |
|
|
| ChemSpiderID = 32683235 |
|
|
| StdInChI=1S/C14H8O5/c15-6-4-8-12(10(17)5-6)14(19)11-7(13(8)18)2-1-3-9(11)16/h1-5,15-17H |
|
|
| StdInChIKey = VVEKCQAFOLKNKB-UHFFFAOYSA-N |
|
| SMILES = O=C1C2=C(C=C(O)C=C2O)C(C3=CC=CC(O)=C31)=O}} |
|
| SMILES = O=C1C2=C(C=C(O)C=C2O)C(C3=CC=CC(O)=C31)=O}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=14 | H=8 | O=5 |
|
| Formula = C<sub>14</sub>H<sub>8</sub>O<sub>5</sub> |
|
|
| MolarMass = 256.210 g/mol |
|
|
| ExactMass = 256.037173 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 23: |
Line 27: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''1,3,8-Trihydroxyanthraquinone''' is an organic compound. It is one of many ] isomers, formally derived from ] by replacement of three ] atoms by ] (OH) groups. |
|
'''1,3,8-Trihydroxyanthraquinone''' is an organic compound. It is one of many ] isomers, formally derived from ] by replacement of three ] atoms by ] (OH) groups. |
|
|
|
|
|
The compound occurs in some microorganisms<ref name=santos/> an in ] extracts of the wood of the ]n plant '']'' (''mangerioba grande'' or ''maria mole'' in ]), used in the local ] for ] problems and ]. The extract also contained, among other products ] (1,8-dihydroxy-3-methylanthraquinone), ] (1,8-dihydroxy-3-methyl-6-methoxyanthraquinone), ] (3-carbinol-1,8-dihydroxyanthraquinone), ] (3-methoxy-1,6,8-trihydroxyanthraquinone), ] (6-methyl-1,3,8-trihydroxyanthraquinone), and ].<ref name=santos> |
|
The compound occurs in some microorganisms<ref name=santos/> and in ] extracts of the wood of the ]n plant '']'' (''mangerioba grande'' or ''maria mole'' in ]), used in the local ] for ] problems and ]. The extract also contained, among other products ] (1,8-dihydroxy-3-methylanthraquinone), ] (1,8-dihydroxy-3-methyl-6-methoxyanthraquinone), ] (3-carbinol-1,8-dihydroxyanthraquinone), ] (3-methoxy-1,6,8-trihydroxyanthraquinone), ] (6-methyl-1,3,8-trihydroxyanthraquinone), and ].<ref name=santos> |
|
SANTOS, Rogério Nunes dos; SILVA, Maria Goretti de Vasconcelos, and BRAZ FILHO, Raimundo (2008). ''Constituintes químicos do caule de Senna reticulata Willd. (Leguminoseae)'' ("Chemical constituents isolated from the wood of Senna reticulata Willd") Química Nova , volume 31 issue 8, pages 1979--1981 (in Portuguese). {{doi|10.1590/S0100-40422008000800011}} "It is the first report of 1,3,8-trihydroxyanthraquinone and 3-methoxy-1,6,8-trihydroxyanthraquinone in higher plants." |
|
SANTOS, Rogério Nunes dos; SILVA, Maria Goretti de Vasconcelos, and BRAZ FILHO, Raimundo (2008). ''Constituintes químicos do caule de Senna reticulata Willd. (Leguminoseae)'' ("Chemical constituents isolated from the wood of Senna reticulata Willd") Química Nova , volume 31 issue 8, pages 1979--1981 (in Portuguese). {{doi|10.1590/S0100-40422008000800011}} "It is the first report of 1,3,8-trihydroxyanthraquinone and 3-methoxy-1,6,8-trihydroxyanthraquinone in higher plants." |
|
</ref> |
|
</ref> |
|
|
|
|
|
The substance is soluble in ] and ] but not in ], and melts at 283°C.<ref name=santos/> |
|
The substance is soluble in ] and ] but not in ], and melts at 283 °C.<ref name=santos/> |
|
|
|
|
|
==See also== |
|
==See also== |
| Line 44: |
Line 48: |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Trihydroxyanthraquinone, 1,3,8-}} |
|
{{DEFAULTSORT:Trihydroxyanthraquinone, 1, 3, 8-}} |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
{{Natural-phenol-stub}} |
|