| Revision as of 05:36, 5 March 2011 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Aromatic amines using HotCat← Previous edit |
Latest revision as of 21:24, 28 November 2024 edit undoCitation bot (talk | contribs)Bots5,419,145 edits Altered pages. Formatted dashes. | Use this bot. Report bugs. | Suggested by Headbomb | #UCB_toolbar |
| (18 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 405991727 |
|
| verifiedrevid = 417209556 |
|
| ImageFile = 14Diamino23dihydroanthraquinone.svg |
|
| ImageFile = 14Diamino23dihydroanthraquinone.svg |
|
| ImageSize = 200px |
|
| ImageSize = |
|
| ImageAlt = |
|
| ImageAlt = |
|
| IUPACName = 1,4-Diaminoanthracene-9,10-dione |
|
| PIN = 1,4-Diamino-2,3-dihydroanthracene-9,10-dione |
|
| OtherNames = Solvent violet 47 |
|
| OtherNames = Solvent violet 47 |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 81-63-0 |
|
|
| PubChem = 5354979 |
|
| CASNo = 81-63-0 |
|
|
| EINECS = 201-367-1 |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| PubChem = 5354979 |
|
|
| UNII = U46FO9XL97 |
|
|
| ChEMBL = 3392069 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4511053 |
|
| ChemSpiderID = 4511053 |
|
| SMILES = O=C/2c1ccccc1C(=O)C=3/C\2=C(/N)CCC=3N |
|
| SMILES = O=C2c1ccccc1C(=O)C=3C2=C(N)CCC=3N |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI=1S/C14H12N2O2/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-4H,5-6,15-16H2 |
|
| StdInChI=1S/C14H12N2O2/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-4H,5-6,15-16H2 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| Line 18: |
Line 23: |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| C=14|H=12|N=2|O=2 |
|
| C=14|H=12|N=2|O=2 |
|
| Appearance = Dark greenish to brownish powder |
|
| Appearance = Dark greenish to brownish powder |
|
| Density = 1.4 g/cm<sup>3</sup> |
|
| Density = 1.4 g/cm<sup>3</sup> |
|
| MeltingPtCL = 248 |
|
| MeltingPtC = 248 to 252 |
|
| MeltingPtCH = 252 |
|
| BoilingPtC = 375.1 |
|
⚫ |
| Solubility = Soluble in hot ]}} |
|
| BoilingPtC = 375.1 |
|
| ⚫ |
| Solubility = Soluble in hot ]}} |
|
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards = Mutagenic; emits NO<sub>x</sub> vapors when heated to decomposition. |
|
| MainHazards = Mutagenic; emits NO<sub>x</sub> vapors when heated to decomposition. |
|
| FlashPt = 180.7 °C |
|
| FlashPtC = 180.7 |
|
|
| AutoignitionPtC = |
|
| Autoignition = }} |
|
|
|
| GHSPictograms = {{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|302|317}} |
|
|
| PPhrases = {{P-phrases|261|264|270|272|280|301+312|302+352|321|330|333+313|363|501}} |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''1,4-Diamino-2,3-dihydroanthraquinone''' is an ] used with ] in ] to introduce a violet color. It is also used in ]s and marine ]s. |
|
'''1,4-Diamino-2,3-dihydroanthraquinone''' is an ] used with ] in ] to introduce a violet color. It is also used in ]s and marine ]s. |
|
|
|
|
|
== synthesis == |
|
== Synthesis == |
|
] is reacted with ] to produce 1,4-diamino-2,3-dihydroanthraquinone.<ref>Heyer, Thomas; Hans-Joachim Niclas, Stephan Dietzel (2010)</ref> |
|
] is reacted with ] to produce 1,4-diamino-2,3-dihydroanthraquinone.<ref>{{cite journal |last1=Heyer |first1=Thomas |last2=Niclas |first2=Hans-Joachim |last3=Dietzel |first3=Stephan |title=NMR-Untersuchungen zur Tautomerie bei Dihydroanthracendionen |trans-title=NMR studies on tautomerism in dihydroanthracenediones |url=https://onlinelibrary.wiley.com/doi/10.1002/zfch.19890290408 |journal=Zeitschrift für Chemie |date=1989 |volume=29 |issue=4 |pages=139–140 |doi=10.1002/zfch.19890290408 |access-date=11 May 2024}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
<!-- unused reference?? : "NMR-Untersuchungen zur Tautomerie bei Dihydroanthracendionen". Zeitschrift für Chemie 29 (4): 139–140. doi:10.1002/zfch.19890290408. ISSN 00442402. --> |
|
<!-- unused reference?? : "NMR-Untersuchungen zur Tautomerie bei Dihydroanthracendionen". Zeitschrift für Chemie 29 (4): 139–140. {{doi|10.1002/zfch.19890290408}}. ISSN 00442402. --> |
|
|
|
|
|
{{DEFAULTSORT:Diamino-2,3-dihydroanthraquinone, 1,4-}} |
|
{{DEFAULTSORT:Diamino-2,3-dihydroanthraquinone, 1,4-}} |
|
] |
|
|
] |
|
] |
|
] |
|
] |