| Revision as of 16:32, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 417343804 of page 1,8-Diazafluoren-9-one for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 05:23, 9 December 2024 edit 115.23.150.109 (talk) →External links |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Section7 = {{Chembox Hazards |
| ⚫ |
| verifiedrevid = 399186614 |
|
|
|
| AutoignitionPt = |
| ⚫ |
| Name = 1,8-Diazafluoren-9-one |
|
|
|
| ExploLimits = |
| ⚫ |
| ImageFile = Diazaflourenone.png |
|
|
| ImageSize = 150px |
|
| FlashPt = |
|
|
| LD50 = |
| ⚫ |
| ImageName = 1,8-Diazafluoren-9-one |
|
|
|
| LC50 = |
|
| IUPACName = 9H-pyridocyclopentapyridin-9-one |
|
|
|
| MainHazards = |
| ⚫ |
| OtherNames = DFO<br />9H-1,8-Diazafluoren-9-one<br />9H-Cyclopentadipyridin-9-one |
|
|
|
| NFPA-H = 2 |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| NFPA-F = 1 |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| NFPA-I = 0 |
|
|
| NFPA-S = |
|
|
| GHSPictograms = {{GHS07}} |
|
|
| HPhrases = |
|
|
| PPhrases = |
|
|
}} |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 477206756 |
|
⚫ |
| Name = 1,8-Diazafluoren-9-one |
|
⚫ |
| ImageFile = Diazaflourenone.png |
|
|
| ImageSize = 150px |
|
⚫ |
| ImageName = 1,8-Diazafluoren-9-one |
|
⚫ |
| PIN = 9''H''-Cyclopentadipyridin-9-one |
|
|
| OtherNames = DFO<br />9''H''-1,8-Diazafluoren-9-one<br />9''H''-Pyridocyclopentapyridin-9-one |
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 633891 |
|
| ChemSpiderID = 633891 |
|
| InChI = 1/C11H6N2O/c14-11-9-7(3-1-5-12-9)8-4-2-6-13-10(8)11/h1-6H |
|
| InChI = 1/C11H6N2O/c14-11-9-7(3-1-5-12-9)8-4-2-6-13-10(8)11/h1-6H |
| Line 18: |
Line 34: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = FOSUVSBKUIWVKI-UHFFFAOYSA-N |
|
| StdInChIKey = FOSUVSBKUIWVKI-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 54078-29-4 --> |
|
| CASNo = 54078-29-4 |
| ⚫ |
| SMILES = O=C1C3=C(C=CC=N3)C2=C1N=CC=C2 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = V3B9KD3X5K |
|
|
| PubChem = 725961 |
|
⚫ |
| SMILES = O=C1C3=C(C=CC=N3)C2=C1N=CC=C2 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
|C=11| H=6 | N=2 |O=1 |
|
| Formula = C<sub>11</sub>H<sub>6</sub>N<sub>2</sub>O<sub></sub> |
|
|
| MolarMass = 182.18 g/mol |
|
| Appearance = Yellow powder |
|
| Density = |
|
| Density = |
|
| MeltingPt = 229-233 °C |
|
| MeltingPtC = 229-233 |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''1,8-Diazafluoren-9-one''' ('''DFO''') is an ] ] first synthesized in 1950. It is used to find ]s on porous surfaces.<ref>{{Cite journal |last1=Lewkowicz |first1=Aneta |last2=Baranowska |first2=Karolina |last3=Bojarski |first3=Piotr |last4=Józefowicz |first4=Marek |date=2019 |title=Solvent dependent spectroscopic properties of fingerprint reagent - 1,8-Diazafluoren-9-one |url=https://linkinghub.elsevier.com/retrieve/pii/S0167732219313479 |journal=Journal of Molecular Liquids |language=en |volume=285 |pages=754–765 |doi=10.1016/j.molliq.2019.04.110|s2cid=149852434 }}</ref><ref name=":0" /> It makes fingerprints glow when they are lit by blue-green light.<ref name=":0" /> |
|
|
|
|
|
DFO reacts with ]s present in the fingerprint to form highly ] derivatives. Excitation with light at ~470 nm results in emission at ~570 nm.<ref name=":0">{{cite journal|last1=Pounds|first1=C. Anthony|last2=Grigg|first2=Ronald|last3=Mongkolaussavaratana|first3=Theeravat|title=The Use of 1,8-Diazafluoren-9-one (DFO) for the Fluorescent Detection of Latent Fingerprints on Paper. A Preliminary Evaluation|journal=Journal of Forensic Sciences|date=1 January 1990|volume=35|issue=1|pages=169–175|doi=10.1520/JFS12813J}}</ref> |
|
|
|
|
|
==References== |
|
|
<references/> |
|
|
|
|
|
==External links== |
|
|
* |
|
|
* |
|
|
|
|
|
{{DEFAULTSORT:Diazafluoren-9-one, 1, 8-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{aromatic-stub}} |
|
|
{{forensics-stub}} |