| Revision as of 16:42, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 457644536 of page 1-Naphthaleneacetamide for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 19:01, 8 November 2022 edit JWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Naphthalenes; added Category:1-Naphthyl compounds using HotCat |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 457643317 |
|
| verifiedrevid = 477208171 |
|
| ImageFile = Naphthaleneacetamide.png |
|
| ImageFile = Naphthaleneacetamide.png |
|
| ImageSize = 180px |
|
| ImageSize = 180px |
|
| IUPACName = 2-Naphthalen-1-ylacetamide |
|
| PIN = 2-(Naphthalen-1-yl)acetamide |
|
| OtherNames = 1-Naphthylacetamide |
|
| OtherNames = 1-Naphthylacetamide |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 6600 |
|
| ChemSpiderID = 6600 |
|
|
| ChEBI = 81810 |
|
| InChI = 1/C12H11NO/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H2,13,14) |
|
| InChI = 1/C12H11NO/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H2,13,14) |
|
| InChIKey = XFNJVKMNNVCYEK-UHFFFAOYAN |
|
| InChIKey = XFNJVKMNNVCYEK-UHFFFAOYAN |
| Line 17: |
Line 18: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XFNJVKMNNVCYEK-UHFFFAOYSA-N |
|
| StdInChIKey = XFNJVKMNNVCYEK-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 86-86-2 --> |
|
| CASNo = 86-86-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = 6861 |
|
|
|
| UNII = 11KAX3RJ28 |
| ⚫ |
| SMILES = C1=CC=C2C(=C1)C=CC=C2CC(=O)N |
|
|
⚫ |
| PubChem = 6861 |
|
⚫ |
| SMILES = C1=CC=C2C(=C1)C=CC=C2CC(=O)N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>12</sub>H<sub>11</sub>NO |
|
| Formula = C<sub>12</sub>H<sub>11</sub>NO |
|
| MolarMass = 185.222 g/mol |
|
| MolarMass = 185.222 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
| MagSus = -117.8·10<sup>−6</sup> cm<sup>3</sup>/mol |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''1-Naphthaleneacetamide''' ('''NAAm''') is a synthetic ] that acts as a ]. |
|
|
|
|
|
It can be found in commercial products such as ]. |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ]s |
|
|
|
|
|
{{DEFAULTSORT:Naphthaleneacetamide, 1-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |