| Revision as of 16:49, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 458692391 of page 16-Hydroxydehydroepiandrosterone for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 00:58, 26 April 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move semisystematic name |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 457644200 |
|
| verifiedrevid = 477209093 |
|
|ImageFile=16-hydroxydehydroepiandrosterone.png |
|
| ImageFile=16-hydroxydehydroepiandrosterone.png |
|
|ImageSize=200px |
|
| ImageSize=250 |
|
|ImageFile2=16-Hidroxidehidroepiandrosterona3D.png |
|
| ImageFile2=16-Hidroxidehidroepiandrosterona3D.png |
|
|ImageSize2=200px |
|
| ImageSize2=250 |
|
⚫ |
| IUPACName=3β,16α-Dihydroxyandrost-5-en-17-one |
|
|IUPACName=(3''S'',8''R'',9''S'',10''R'',13''S'',14''S'',16''R'')-3,16-Dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopentaphenanthren-17-one |
|
| SystematicName=(2''R'',3a''S'',3b''R'',7''S'',9a''R'',9b''S'',11a''S'')-3,7-Dihydroxy-9a,11a-dimethyl-2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1''H''-cyclopentaphenanthren-1-one |
| ⚫ |
|OtherNames=3β,16α-Dihydroxyandrost-5-en-17-one |
|
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| InChI = 1/C19H28O3/c1-18-7-5-12(20)9-11(18)3-4-13-14(18)6-8-19(2)15(13)10-16(21)17(19)22/h3,12-16,20-21H,4-10H2,1-2H3/t12-,13+,14-,15-,16+,18-,19-/m0/s1 |
|
| InChI = 1/C19H28O3/c1-18-7-5-12(20)9-11(18)3-4-13-14(18)6-8-19(2)15(13)10-16(21)17(19)22/h3,12-16,20-21H,4-10H2,1-2H3/t12-,13+,14-,15-,16+,18-,19-/m0/s1 |
|
| InChIKey = QQIVKFZWLZJXJT-DNKQKWOHBQ |
|
| InChIKey = QQIVKFZWLZJXJT-DNKQKWOHBQ |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 16: |
Line 15: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = QQIVKFZWLZJXJT-DNKQKWOHSA-N |
|
| StdInChIKey = QQIVKFZWLZJXJT-DNKQKWOHSA-N |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 1232-73-1 --> |
|
| CASNo=1232-73-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem=102030 |
|
|
|
| UNII = WU2DU6GA72 |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| PubChem=102030 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 27771 |
|
| ChEBI = 27771 |
|
| ChemSpiderID=92168 |
|
| ChemSpiderID=92168 |
|
| SMILES = O=C32(CC14(C(=C/C12C3O)\C(O)CC4)C)C |
|
| SMILES = O=C32(CC14(C(=C/C12C3O)\C(O)CC4)C)C |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>19</sub>H<sub>28</sub>O<sub>3</sub> |
|
| Formula=C<sub>19</sub>H<sub>28</sub>O<sub>3</sub> |
|
| MolarMass=304.42 g/mol |
|
| MolarMass=304.42 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''16α-Hydroxydehydroepiandrosterone''' ('''16α-hydroxy-DHEA''' or '''16α-OH-DHEA''') is an ] ] of ] (DHEA). Both 16α-OH-DHEA and its 3β-] ], ], are ]s in the ] of ] from ] (DHEA).<ref>{{cite journal |vauthors=Raju U, Bradlow HL, Levitz M |title=Estriol-3-sulfate in human breast cyst fluid. Concentrations, possible origin, and physiologic implications |journal=Ann. N. Y. Acad. Sci. |volume=586 |pages=83–7 |year=1990 |pmid=2141460 |doi= 10.1111/j.1749-6632.1990.tb17793.x }}</ref> 16α-OH-DHEA has ]ic activity.<ref name="pmid23123738">{{cite journal | vauthors = Miller KK, Al-Rayyan N, Ivanova MM, Mattingly KA, Ripp SL, Klinge CM, Prough RA | title = DHEA metabolites activate estrogen receptors alpha and beta | journal = Steroids | volume = 78 | issue = 1 | pages = 15–25 | year = 2013 | pmid = 23123738 | pmc = 3529809 | doi = 10.1016/j.steroids.2012.10.002 }}</ref> |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{Reflist|2}} |
|
|
|
|
|
|
|
|
{{Steroid hormones}} |
|
|
{{Estrogen receptor modulators}} |
|
|
|
|
|
{{DEFAULTSORT:Hydroxydehydroepiandrosterone, 16α-}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{steroid-stub}} |