| Revision as of 11:39, 8 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits update identifiers to match the depicted molecule← Previous edit |
Latest revision as of 01:07, 26 April 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| (22 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{expert|date=July 2011}} |
|
|
{{lead missing|date=July 2011}} |
|
|
|
|
|
{{DISPLAYTITLE:7-Isopropyl-1,4a-dimethyl-dodecahydro-1''H''-phenanthrene}} |
|
|
|
|
|
{{Chembox |
|
{{Chembox |
|
|
| verifiedrevid = 443664911 |
|
| Name = 7-Isopropyl-1,4a-dimethyl-dodecahydro-1''H''-phenanthrene |
|
| ⚫ |
| IUPACName = 18-Norabietane{{Citation needed|date = July 2011}} |
|
|
| ImageFile = 18-norabietane.svg |
|
| ImageFile = 18-norabietane.svg |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile_Ref = {{chemboximage|correct|CAS}} |
|
| ImageSize = 244 |
|
| ImageSize = 244 |
|
⚫ |
| IUPACName = 18-Norabietane |
|
| ImageName = Stereo skeletal formula of 7-isopropyl-1,4a-dimethyl-dodecahydro-1H-phenanthrene ((1S,4aS,4bS,7S,8aS,10aS)-1,4a-dimethyl,-7-(propan-2-yl)) |
|
|
⚫ |
| SystematicName = (1''S'',4a''S'',4b''S'',7''S'',8a''S'')-1,4a-Dimethyl-7-(propan-2-yl)tetradecahydrophenanthrene |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 2221-95-6 |
|
| CASNo = 2221-95-6 |
| ⚫ |
| CASNo_Comment = <small>(1''S'',4a''S'',4b''S'',7''S'',8a''S'',10a''S'')-1,4a-dimethyl,-7-(propan-2-yl)</small> |
|
|
|
| CASNo_Ref = {{cascite|correct}} |
|
| PubChem1 = 573076 |
|
|
| Pubchem1_Ref = {{Pubchemcite|correct|pubchem}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| PubChem = 20054912 |
|
| UNII = 24ST878V9I |
|
⚫ |
| PubChem = 6451376 |
|
| PubChem_Ref = {{Pubchemcite|correct|pubchem}} |
|
|
⚫ |
| ChemSpiderID = 4953842 |
|
| PubChem_Comment = <small>(1''S'',4a''S'',7''S'',8a''S'')-1,4a-dimethyl,-7-(propan-2-yl)</small> |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| PubChem2 = 6451376 |
|
|
⚫ |
| SMILES = C3C(2CC1(CC(C(C)C)C1)2(C)C3)C |
|
| PubChem2_Ref = {{Pubchemcite|correct|pubchem}} |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| PubChem2_Comment = <small>(1''S'',4a''S'',4b''S'',7''S'',8a''S'',10a''S'')-1,4a-dimethyl,-7-(propan-2-yl)</small> |
|
|
⚫ |
| StdInChI = InChI=1S/C19H34/c1-13(2)15-7-10-18-16(12-15)8-9-17-14(3)6-5-11-19(17,18)4/h13-18H,5-12H2,1-4H3/t14-,15-,16-,17-,18-,19-/m0/s1 |
|
| ChemSpiderID1 = 498248 |
|
|
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = HTNCYKZTYXSRHL-DYKIIFRCSA-N |
| ⚫ |
| ChemSpiderID = 16735810 |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID_Comment = <small>(1''S'',4a''S'',7''S'',8a''S'')-1,4a-dimethyl,-7-(propan-2-yl)</small> |
|
|
| ChemSpiderID2 = 4953842 |
|
| ⚫ |
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID2_Comment = <small>(1''S'',4a''S'',4b''S'',7''S'',8a''S'',10a''S'')-1,4a-dimethyl,-7-(propan-2-yl)</small> |
|
| ⚫ |
| SMILES = CC(C)2C3CCC1(C)CCC1(C)C3CC2 |
|
| ⚫ |
| StdInChI = 1S/C19H34/c1-13(2)15-7-10-18-16(12-15)8-9-17-14(3)6-5-11-19(17,18)4/h13-18H,5-12H2,1-4H3/t14-,15-,16-,17?,18?,19-/m0/s1 |
|
| ⚫ |
| StdInChIKey = HTNCYKZTYXSRHL-WUEXXBSGSA-N |
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C = 19 |
|
| C=19 | H=34 |
|
| H = 34 |
|
| Density = 0.883 g/ml |
|
| ExactMass = 262.266051088 g mol<sup>-1</sup> |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Related |
|
|Section3={{Chembox Related |
|
| OtherCpds = ]<br /> |
|
| OtherCompounds = ], ], ] |
|
] |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''18-Norabietane''' is a ] perhydrogenated ] ]. It occurs in the mineral ].<ref>{{Cite journal | title = Higher terpene compounds. XII. Fichtelite and the stereochemistry of hydrogenated phenanthrene derivatives |author1=] |author2=Balas, Fr. |author3=Schinz, H. | journal = Helvetica Chimica Acta | year = 1923 | volume = 6 | pages = 692–697 | doi = 10.1002/hlca.19230060174 }}</ref> |
|
'''7-Isopropyl-1,4a-dimethyl-dodecahydro-1''H''-phenanthrene''' is an organic compound, classed as a perhydrogenated ]. One particular diastereomer is found to occur in the mineral ]: (1''S'',4a''S'',4b''S'',7''S'',8a''S'',10a''S'')-1,4a-dimethyl,-7-(propan-2-yl) |
|
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
|
|
|
{{DEFAULTSORT:Norabietane, 18-}} |
|
{{Hydrocarbon-stub}} |
|
{{Hydrocarbon-stub}} |
|
|
|
|
|
|
] |
|
{{DEFAULTSORT:Isopropyl-1,4a-dimethyl-dodecahydro-1H-phenanthrene, 7-}} |
|
|
|
] |
|
|
|
|
] |
|
] |