| Revision as of 13:08, 25 October 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL', 'StdInChI', 'StdInChIKey').← Previous edit |
Latest revision as of 14:26, 8 September 2022 edit undoMigfab008 (talk | contribs)Extended confirmed users19,936 editsNo edit summary |
| (26 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
|
{{Use dmy dates|date=September 2022}} |
|
{{Chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 413095416 |
|
| verifiedrevid = 477209762 |
|
| ImageFile = DMPA.png |
|
| ImageFile = DMPA.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageAlt = |
|
| ImageAlt = |
|
| IUPACName = 2,2-Dimethoxy-2-phenylacetophenone |
|
| PIN = 2,2-Dimethoxy-1,2-diphenylethan-1-one |
|
⚫ |
| OtherNames = 2,2-Dimethoxy-2-phenylacetophenone<br />α,α-Dimethoxy-α-phenylacetophenone<br />Benzil α,α-dimethyl acetal |
|
| PIN = |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| OtherNames = α,α-Dimethoxy-α-phenylacetophenone, Benzil α,α-dimethyl acetal |
|
|
⚫ |
| Abbreviations = DMPA |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| Abbreviations = DMPA |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 81777 |
|
| ChemSpiderID = 81777 |
|
| InChI = 1/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3 |
|
| InChI = 1/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3 |
|
| InChIKey = KWVGIHKZDCUPEU-UHFFFAOYAK |
|
| InChIKey = KWVGIHKZDCUPEU-UHFFFAOYAK |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 364734 --> |
|
| ChEMBL = 364734 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = <!-- blanked - oldvalue: 1S/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3 --> |
|
| StdInChI = 1S/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = <!-- blanked - oldvalue: KWVGIHKZDCUPEU-UHFFFAOYSA-N --> |
|
| StdInChIKey = KWVGIHKZDCUPEU-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 24650-42-8 |
|
| CASNo = 24650-42-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = 90571 |
|
|
|
| UNII = 1DK0094V28 |
| ⚫ |
| SMILES = O=C(c1ccccc1)C(OC)(OC)c2ccccc2 |
|
|
⚫ |
| PubChem = 90571 |
|
⚫ |
| SMILES = O=C(c1ccccc1)C(OC)(OC)c2ccccc2 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C = 16 | O = 3 | H = 16 |
|
| C=16 | O=3 | H=16 |
|
| MolarMass = |
|
| MolarMass = |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
⚫ |
'''2,2-Dimethoxy-2-phenylacetophenone''' is a ], which is used to initialize radical ] e.g. in the preparation of ].<ref>{{Cite journal | title = Percutaneous fiber-optic sensor for chronic glucose monitoring in vivo |vauthors=Liao KC, Hogen-Esch T, Richmond FJ, Marcu L, Clifton W, Loeb GE | journal = Biosens Bioelectron | year = 2008 | volume = 23 | issue = 10 | pages = 1458–65 | doi=10.1016/j.bios.2008.01.012|pmid=18304798}}</ref> Under the influence of light the molecule will form radicals which initiate the radical polymerization. It can also be used as an initiator in the process of making an ]. |
|
|
|
| ⚫ |
'''2,2-Dimethoxy-2-phenylacetophenone''' is a photoinitiator, which is used to initialise radical polymerisation e.g. in the preparation of ].<ref>{{Cite journal | title = Percutaneous fiber-optic sensor for chronic glucose monitoring in vivo | author = Liao KC, Hogen-Esch T, Richmond FJ, Marcu L, Clifton W, Loeb GE | journal = Biosens Bioelectron | year = 2008 | volume = 23 | issue = 10 | pages = 1458–65}}</ref> |
|
|
|
|
|
|
== References == |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Dimethoxy-2-phenylacetophenone, 2,2-}} |
|
{{DEFAULTSORT:Dimethoxy-2-phenylacetophenone, 2, 2-}} |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
{{ketone-stub}} |
|
{{ketone-stub}} |