| Revision as of 17:02, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 432637667 of page 2,4,6-Trinitroaniline for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 22:28, 18 September 2024 edit Finlay McWalter (talk | contribs)Administrators76,099 edits MOS:SURPRISE, WP:SEEALSO |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 399200056 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Trinitroaniline structure.svg |
|
|
⚫ |
| verifiedrevid = 477210931 |
| ⚫ |
|ImageSize=150px |
|
|
⚫ |
| ImageFile=Trinitroaniline structure.svg |
|
|IUPACName=2,4,6-trinitroaniline |
|
|
⚫ |
| ImageSize=150px |
| ⚫ |
|OtherNames=Picramide |
|
|
|
| ImageFile1 = 2,4,6-Trinitroaniline-3D-balls.png |
|
|
| ImageSize1 = 150 |
|
|
| ImageAlt1 = Picramide molecule |
|
|
| PIN = 2,4,6-Trinitroaniline |
|
⚫ |
| OtherNames = Picramide |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 9852 |
|
| ChemSpiderID = 9852 |
|
| InChI = 1/C6H4N4O6/c7-6-4(9(13)14)1-3(8(11)12)2-5(6)10(15)16/h1-2H,7H2 |
|
| InChI = 1/C6H4N4O6/c7-6-4(9(13)14)1-3(8(11)12)2-5(6)10(15)16/h1-2H,7H2 |
|
| InChIKey = IAHOUQOWMXVMEH-UHFFFAOYAP |
|
| InChIKey = IAHOUQOWMXVMEH-UHFFFAOYAP |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C6H4N4O6/c7-6-4(9(13)14)1-3(8(11)12)2-5(6)10(15)16/h1-2H,7H2 |
|
| StdInChI = 1S/C6H4N4O6/c7-6-4(9(13)14)1-3(8(11)12)2-5(6)10(15)16/h1-2H,7H2 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = IAHOUQOWMXVMEH-UHFFFAOYSA-N |
|
| StdInChIKey = IAHOUQOWMXVMEH-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 489-98-5 --> |
|
|
|
| CASNo=489-98-5 |
| ⚫ |
| PubChem=10271 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = c1c(cc(c(c1(=O))N)(=O))(=O) |
|
|
|
| UNII = ZL7CZQ6FZC |
|
⚫ |
| PubChem=10271 |
|
⚫ |
| SMILES = c1c(cc(c(c1(=O))N)(=O))(=O) |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>6</sub>H<sub>4</sub>N<sub>4</sub>O<sub>6</sub> |
|
| Formula=C<sub>6</sub>H<sub>4</sub>N<sub>4</sub>O<sub>6</sub> |
|
| MolarMass=228.12 g/mol |
|
| MolarMass=228.12 g/mol |
|
| Appearance=yellow/orange/red powder |
|
| Appearance=yellow/orange/red powder |
|
| Density=1.8 g/cm<sup>3</sup> |
|
| Density=1.8 g/cm<sup>3</sup> |
|
| MeltingPt=188 °C |
|
| MeltingPtC=188 |
|
| BoilingPt=explodes before boiling |
|
| BoilingPt=explodes before boiling |
|
| Solubility=insoluble |
|
| Solubility=insoluble |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards=instantaneous explosion |
|
| MainHazards=instantaneous explosion |
|
| FlashPt=unknown |
|
| FlashPt=unknown |
|
| Autoignition=unknown |
|
| AutoignitionPt=unknown |
|
}} |
|
}} |
|
| Section6 = {{Chembox Explosive |
|
|Section6={{Chembox Explosive |
|
| ShockSens = unknown |
|
| ShockSens = unknown |
|
| FrictionSens = unknown |
|
| FrictionSens = unknown |
|
| ExplosiveV = 7,300 m/s |
|
| DetonationV = 7,300 m/s |
|
| REFactor = }} |
|
| REFactor = }} |
|
}} |
|
}} |
|
|
|
|
|
'''2,4,6-Trinitroaniline''', C<sub>6</sub>H<sub>4</sub>N<sub>4</sub>O<sub>6</sub>, abbreviated as TNA and also known as '''picramide''', a nitrated ]. Materials in this group range from slight to strong ]. If mixed with ], including ]s, ]s and ]s, they may begin a vigorous reaction that culminates in a detonation. The aromatic nitro compounds may explode in the presence of a base such as ] or ] even in the presence of water or organic solvents. The explosive tendencies of aromatic nitro compounds are increased by the presence of multiple nitro groups.<ref>{{Cite web|url=http://cameochemicals.noaa.gov/chemical/21189|title=2,4,6-TRINITROANILINE | CAMEO Chemicals | NOAA}}</ref> The appearance of trinitroaniline varies from yellow to orange to red depending on its purity and concentration. |
|
|
|
|
|
==Applications== |
|
|
Trinitroaniline is only used in modern times in the small warheads of some explosive devices such as ]. In ] it was used by ] as '''Type 97 ''bakuyaku''''' (Model 1931 explosive) in some versions of gun ]s instead of less stable burster ''schimose'' (]).<ref>{{cite web | url=http://navweaps.com/Weapons/Gun_Data_p2.htm | title=Definitions and Information about Naval Guns - NavWeaps }}</ref> It was also used in the Yokosuka MXY-7 ], a ] antishipping human-guided rocket aircraft. |
|
|
|
|
|
==Health and safety== |
|
|
Trinitroaniline is dangerously explosive and also ].<ref>{{Cite web |title=2,4,6-Trinitroaniline - Hazardous Agents {{!}} Haz-Map |url=https://haz-map.com/Agents/1926 |access-date=2024-05-31 |website=haz-map.com}}</ref> Symptoms of exposure to this compound may include skin and eye irritation, headache, drowsiness, weakness, ], and respiratory distress.{{medcn|date=April 2014}} |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
*{{cite journal|doi=10.1021/j100668a017 |title=Crystal structure of 2,4,6-trinitroaniline |year=1972 |last1=Holden |first1=James R. |last2=Dickinson |first2=Charles |last3=Bock |first3=Charles M. |journal=The Journal of Physical Chemistry |volume=76 |issue=24 |pages=3597–3602 }} |
|
|
|
|
|
{{DEFAULTSORT:Trinitroaniline, 2,4,6-}} |
|
|
] |
|
|
] |
|
|
] |