| Revision as of 14:51, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 465214233 of page 2,4,6-Tris(trinitromethyl)-1,3,5-triazine for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 18:15, 28 November 2022 edit Citation bot (talk | contribs)Bots5,424,176 edits Alter: pages. Add: s2cid. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | #UCB_webform 3032/3439 |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 441661599 |
|
| verifiedrevid = 477191519 |
|
| Name = 2,4,6-Tris(trinitromethyl)-1,3,5-triazine |
|
| Name = 2,4,6-Tris(trinitromethyl)-1,3,5-triazine |
|
| ImageFile = TTNMTZ.svg |
|
| ImageFile = TTNMTZ.svg |
|
| ImageSize = 150px |
|
| ImageSize = 180 |
|
| ImageName = 2,4,6-Tris(trinitromethyl)-1,3,5-triazine |
|
| ImageAlt = 2,4,6-Tris(trinitromethyl)-1,3,5-triazine |
|
| IUPACName = 2,4,6-Tris(trinitromethyl)-1,3,5-triazine |
|
| ImageFile1 = 2,4,6-Tris(trinitromethyl)-1,3,5-triazine-3D-balls.png |
|
|
| ImageSize1 = 180 |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ImageAlt1 = Ball-and-stick model of the 2,4,6-tris(trinitromethyl)-1,3,5-triazine molecule |
|
| CASOther = |
|
|
|
| PIN = Tris(trinitromethyl)-1,3,5-triazine |
| ⚫ |
| InChIKey = MTNISTQLDNOGTM-UHFFFAOYAO |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = 161870-33-3 |
|
⚫ |
| InChIKey = MTNISTQLDNOGTM-UHFFFAOYAO |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = MTNISTQLDNOGTM-UHFFFAOYSA-N |
|
| StdInChIKey = MTNISTQLDNOGTM-UHFFFAOYSA-N |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 9664224 |
|
| ChemSpiderID = 9664224 |
|
|
| PubChem = 11489412 |
|
| InChI = 1/C6N12O18/c19-10(20)4(11(21)22,12(23)24)1-7-2(5(13(25)26,14(27)28)15(29)30)9-3(8-1)6(16(31)32,17(33)34)18(35)36 |
|
| InChI = 1/C6N12O18/c19-10(20)4(11(21)22,12(23)24)1-7-2(5(13(25)26,14(27)28)15(29)30)9-3(8-1)6(16(31)32,17(33)34)18(35)36 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 20: |
Line 26: |
|
| SMILES = O=()C(c1nc(nc(n1)C(()=O)(()=O)()=O)C(()=O)(()=O)()=O)(()=O)()=O |
|
| SMILES = O=()C(c1nc(nc(n1)C(()=O)(()=O)()=O)C(()=O)(()=O)()=O)(()=O)()=O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=6|N=12|O=18 |
|
| Formula = C<sub>6</sub>N<sub>12</sub>O<sub>18</sub> |
|
|
| MolarMass = 528.13 g/mol |
|
| Density = 1.91 g/cm<sup>3</sup> |
|
| Density = 1.91 g/cm³ |
|
| MeltingPtC = 91 to 92 |
|
|
| MeltingPt_notes = |
|
| MeltingPt = 91–92 °C |
|
|
| BoilingPt = |
|
| BoilingPt = |
|
}} |
|
}} |
|
| Section8 = {{Chembox Related |
|
|Section8={{Chembox Related |
|
| OtherCpds = ]<br>]<br>]<br>] |
|
| OtherCompounds = ]<br>]<br>]<br>] |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''2,4,6-Tris(trinitromethyl)-1,3,5-triazine''' is a chemical compound that is a derivative of ] first prepared in 1995.<ref>{{cite journal | vauthors = Shastin AV, Godovikova TI, Golova SP, Kuz'min VS, Khmel'nitskii LI, Korsunskii BL | doi = 10.1070/MC1995v005n01ABEH000440| title = Synthesis of 2,4,6-Tris(trinitromethyl)-1,3,5-triazine| journal = Mendeleev Communications| volume = 5| pages = 17–18| year = 1995 }}</ref> It is synthesized by destructive nitration of 2,4,6-tricarboxyl-1,3,5-triazine. It is noteworthy for having more ] groups than it does carbon atoms, thus potentially being useful as an oxygen source, or added to oxygen-poor explosives to increase their power. |
|
|
|
|
|
Derivatives have been prepared by nucleophilic displacement of the nitro groups with ] and ].<ref>{{cite journal | vauthors = Shastin AV, Godovikova TI, Korsunskii BL | doi = 10.1023/A:1023970928207| year = 2003 | journal = Chemistry of Heterocyclic Compounds| volume = 39| issue = 3| pages = 354–356 | title = Nucleophilic Substitution Reactions of 2,4,6-Tris(trinitromethyl)-1,3,5-triazine. 3. Reaction of 2,4,6-Tris(trinitromethyl)-1,3,5-triazine with Azides and Hydrazine| s2cid = 106383383}}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Tris(Trinitromethyl)-1,3,5-Triazine, 2,4,6-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{Explosive-stub}} |