| Revision as of 17:07, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444048045 of page 2,5-Dimethoxy-4-nitroamphetamine for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 02:53, 9 January 2024 edit Michael7604 (talk | contribs)Extended confirmed users8,895 edits change category from Nitrobenzenes to Nitrobenzene derivatives |
| Line 1: |
Line 1: |
|
|
{{one source|date=April 2015}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 413105487 |
|
|
|
| Watchedfields = changed |
|
| ImageFile = 2,5-Dimethoxy-4-nitroamphetamine.svg |
|
|
⚫ |
| verifiedrevid = 477211749 |
| ⚫ |
| ImageSize = 200px |
|
|
|
| ImageFile = DON2DACS.svg |
| ⚫ |
| IUPACName = 1-(2,5-Dimethoxy-4-nitrophenyl)propan-2-amine |
|
|
⚫ |
| ImageSize = 150px |
|
⚫ |
| PIN = 1-(2,5-Dimethoxy-4-nitrophenyl)propan-2-amine |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 95083 |
|
| ChemSpiderID = 95083 |
| Line 18: |
Line 20: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = JQJRESSXOVAECC-UHFFFAOYSA-N |
|
| StdInChIKey = JQJRESSXOVAECC-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 67460-68-8 --> |
|
|
| PubChem = |
|
| CASNo = 67460-68-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 3FIV60666J |
|
|
| PubChem = 105432 |
|
| SMILES = COc1cc(c(cc1CC(C)N)OC)N(=O)=O |
|
| SMILES = COc1cc(c(cc1CC(C)N)OC)N(=O)=O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=11 | H=16 | N=2 | O=4 |
|
| Formula = C<sub>11</sub>H<sub>16</sub>N<sub>2</sub>O<sub>4</sub> |
|
|
| MolarMass = 240.26 g/mol |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
|
| MeltingPtC = 206 to 207 |
|
| MeltingPt = 206-207 °C ]<br>231-232 °C (''R'')-] |
|
| MeltingPt_notes = (])<br>231-232 °C ((''R'')-])<ref name= pihkal/> |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''2,5-Dimethoxy-4-nitroamphetamine''' ('''DON''') is a ] and ]. It is an ] of ] and ]. It is also closely related to ]. |
|
|
|
|
|
==Chemistry== |
|
|
DON is in a class of compounds commonly known as alpha-] ]s, or ]s and the full chemical name is 1-(2,5-dimethoxy-4-nitrophenyl)propan-2-amine. It has a ]. |
|
|
|
|
|
==Effects== |
|
|
In his book '']'', ] lists a dosage of DON as being 3-4.5 ] orally with amphetamine-like stimulation lasting 8–15 hours.<ref name= pihkal ></ref> |
|
|
|
|
|
==Dangers== |
|
|
The toxicity of DON is not known. |
|
|
|
|
|
==Legality== |
|
|
DON is unscheduled in the ], but because of its close similarity in structure and effects to ] and ], possession and sale of DON may be subject to prosecution under the ].{{citation needed|date=February 2013}} DON is listed as a Class A drug in the ] after the table of contents of ''PiHKAL'' and '']'' were added to the schedules. |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Hallucinogens}} |
|
|
{{Phenethylamines}} |
|
|
{{Serotonergics}} |
|
|
|
|
|
{{DEFAULTSORT:Dimethoxy-4-nitroamphetamine, 2,5-}} |
|
|
] |
|
|
] |
|
|
] |