| Revision as of 17:12, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 413109213 of page 2-Aminoacridine for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 13:05, 19 August 2022 edit Fswitzer4 (talk | contribs)Extended confirmed users10,572 editsm Added UNII |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 413107851 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=2-aminoacridine.png |
|
|
⚫ |
| verifiedrevid = 477212435 |
| ⚫ |
|ImageSize= |
|
|
⚫ |
| ImageFile=2-aminoacridine.png |
|
|IUPACName=acridin-2-amine |
|
|
⚫ |
| ImageSize= |
| ⚫ |
|OtherNames= |
|
|
|
| PIN=Acridin-2-amine |
|
⚫ |
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 10906 |
|
| ChemSpiderID = 10906 |
|
| InChI = 1/C13H10N2/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)15-13/h1-8H,14H2 |
|
| InChI = 1/C13H10N2/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)15-13/h1-8H,14H2 |
| Line 18: |
Line 19: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UTXPWBKKZFLMPZ-UHFFFAOYSA-N |
|
| StdInChIKey = UTXPWBKKZFLMPZ-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 581-28-2 --> |
|
|
|
| CASNo=581-28-2 |
| ⚫ |
| PubChem=11384 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=C1=CC=C2C(=C1)C=C3C=C(C=CC3=N2)N |
|
|
|
| UNII = FZ24NE6LYA |
|
⚫ |
| PubChem=11384 |
|
⚫ |
| SMILES=C1=CC=C2C(=C1)C=C3C=C(C=CC3=N2)N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| Formula = |
|
| Formula=C<sub>13</sub>H<sub>10</sub>N<sub>2</sub> |
|
|
|
| C=13 | H=10 | N=2 |
|
| MolarMass=194.23 g/mol |
|
| MolarMass=194.23 g/mol |
|
| Appearance= |
|
|
| Density= |
|
| Appearance= |
|
| MeltingPt= |
|
| Density= |
|
| BoilingPt= |
|
| MeltingPt= |
|
| Solubility= |
|
| BoilingPt= |
|
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''2-Aminoacridine''' is an ]. |
|
|
|
|
|
==See also== |
|
|
|
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
{{DEFAULTSORT:Aminoacridine, 2-}} |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{heterocyclic-stub}} |