| Revision as of 15:36, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443314178 of page 2-Aminomuconic_semialdehyde for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 22:01, 22 February 2024 edit Maxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers30,619 edits Added bibcode. | Use this tool. Report bugs. | #UCB_Gadget |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 443313218 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 477197875 |
|
| ImageFile = 2-aminomuconic semialdehyde.png |
|
| ImageFile = 2-aminomuconic semialdehyde.png |
|
| ImageName = Skeletal formula |
|
| ImageName = Skeletal formula |
|
| ImageFile1 = 2-Aminomuconic-semialdehyde-3D-balls.png |
|
| ImageFile1 = 2-Aminomuconic-semialdehyde-3D-balls.png |
|
| ImageName1 = Ball-and-stick model |
|
| ImageName1 = Ball-and-stick model |
|
|IUPACName=2-Amino-6-oxohexa-2,4-dienoic acid |
|
| PIN = (2''Z'',4''E'')-2-Amino-6-oxohexa-2,4-dienoic acid |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4444230 |
|
| ChemSpiderID = 4444230 |
|
| InChI = 1/C6H7NO3/c7-5(6(9)10)3-1-2-4-8/h1-4H,7H2,(H,9,10)/b2-1-,5-3+ |
|
| InChI = 1/C6H7NO3/c7-5(6(9)10)3-1-2-4-8/h1-4H,7H2,(H,9,10)/b2-1-,5-3+ |
| Line 18: |
Line 19: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = QCGTZPZKJPTAEP-REDYYMJGSA-N |
|
| StdInChIKey = QCGTZPZKJPTAEP-REDYYMJGSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 150994-59-5 --> |
|
|
|
| CASNo=150994-59-5 |
|
| PubChem=30 |
|
| PubChem=30 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 15745 |
|
| ChEBI = 15745 |
|
| SMILES=C(=CC=O)C=C(C(=O)O)N |
|
| SMILES=C(=CC=O)C=C(C(=O)O)N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| Formula = |
|
| Formula=C<sub>6</sub>H<sub>7</sub>NO<sub>3</sub> |
|
|
|
| C=6 | H=7 | N=1 | O=3 |
|
| MolarMass=141.12 g/mol |
|
| MolarMass=141.12 g/mol |
|
| Appearance= |
|
|
| Density= |
|
| Appearance= |
|
| MeltingPt= |
|
| Density= |
|
| BoilingPt= |
|
| MeltingPt= |
|
| Solubility= |
|
| BoilingPt= |
|
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''2-Aminomuconic semialdehyde''' is a metabolite of ].<ref>{{cite journal |last1=He |first1=Z. |last2=Spain |first2=J. |date=1999-08-01 |title=Preparation of 2-aminomuconate from 2-aminophenol by coupled enzymatic dioxygenation and dehydrogenation reactions |journal=Journal of Industrial Microbiology & Biotechnology |volume=23 |issue=2 |pages=138–142 |doi=10.1038/sj.jim.2900705 |issn=1476-5535 |pmid=10510494|s2cid=1091252 |doi-access=free }}</ref><ref>{{cite journal |last1=Zeng |first1=Ting |last2=Liang |first2=Yanshan |last3=Chen |first3=Jinyao |last4=Cao |first4=Guodong |last5=Yang |first5=Zhu |last6=Zhao |first6=Xingchen |last7=Tian |first7=Jinglin |last8=Xin |first8=Xiong |last9=Lei |first9=Bo |last10=Cai |first10=Zongwei |date=2021-09-01 |title=Urinary metabolic characterization with nephrotoxicity for residents under cadmium exposure |journal=Environment International |language=en |volume=154 |pages=106646 |doi=10.1016/j.envint.2021.106646 |pmid=34049269 |issn=0160-4120|doi-access=free |bibcode=2021EnInt.15406646Z }}</ref> |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{DEFAULTSORT:Aminomuconic semialdehyde, 2-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
<references />{{Amino acid metabolism intermediates}} |
|
|
|
|
|
{{alkene-stub}} |