Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and 2-Nitrofluorene: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 17:29, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456500878 of page 2-Nitrofluorene for the Chem/Drugbox validation project (updated: 'KEGG', 'CASNo').  Latest revision as of 14:06, 26 September 2024 edit JWBE (talk | contribs)Extended confirmed users10,111 edits removed Category:Nitro compounds; added Category:Nitroarenes using HotCat 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{Chembox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 456499944 | verifiedrevid = 477214968
| ImageFile = 2-nitrofluorene.svg | ImageFile = 2-nitrofluorene.svg
| ImageFile_Ref = {{chemboximage|correct|??}} | ImageFile_Ref = {{chemboximage|correct|??}}
| ImageSize = 244 | ImageSize = 244
| ImageName = Kekulé, skeletal formula of 2-nitrofluorene | ImageName = Kekulé, skeletal formula of 2-nitrofluorene
⚫ | PIN = 2-Nitro-9''H''-fluorene<ref>{{Cite web|url = https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11831&loc=ec_rcs|title = 2-nitrofluorene - PubChem Public Chemical Database|work = The PubChem Project|location = USA|publisher = National Center for Biotechnology Information|at = Descriptors Computed from Structure}}</ref>
| IUPACName = 2-Nitrofluorene{{Citation needed|date = June 2011}}
⚫ |Section1={{Chembox Identifiers
⚫ | SystematicName = 2-Nitro-9''H''-fluorene<ref>{{Cite web|url = http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11831&loc=ec_rcs|title = 2-nitrofluorene - PubChem Public Chemical Database|work = The PubChem Project|location = USA|publisher = National Center for Biotechnology Information|at = Descriptors Computed from Structure}}</ref>
⚫ | CASNo_Ref = {{cascite|changed|??}}
⚫ | Section1 = {{Chembox Identifiers
| CASNo = 607-57-8
⚫ | CASNo_Ref = {{cascite|changed|??}}
| PubChem = 11831
| CASNo = <!-- blanked - oldvalue: 607-57-8 -->
| PubChem = 11831 | ChemSpiderID = 11338
| PubChem_Ref = {{Pubchemcite|correct|pubchem}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| EINECS = 210-138-5
| ChemSpiderID = 11338
⚫ | UNNumber = 3077
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| EINECS = 210-138-5 | KEGG = C10923
| KEGG_Ref = {{keggcite|changed|kegg}}
⚫ | UNNumber = 3077
⚫ | MeSHName = 2-Nitrofluorene
| KEGG = <!-- blanked - oldvalue: C10923 -->
| KEGG_Ref = {{keggcite|changed|kegg}} | ChEBI_Ref = {{ebicite|correct|EBI}}
⚫ | MeSHName = 2-Nitrofluorene
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 1224 | ChEBI = 1224
| ChEMBL = 351487 | ChEMBL = 351487
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| RTECS = LL8225000 | RTECS = LL8225000
| Beilstein = 1877983 | Beilstein = 1877983
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 191LL4U4GZ | UNII = 191LL4U4GZ
| SMILES = o:n(:o)-c1ccc2c(Cc3ccccc23)c1 | SMILES = (=O)c1ccc2c(Cc3ccccc-23)c1
| SMILES1 = N()C1=CC2=C(C=C1)C1=CC=CC=C1C2 | SMILES1 = (=O)C1=CC2=C(C=C1)C1=CC=CC=C1C2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H9NO2/c15-14(16)11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2 | StdInChI = 1S/C13H9NO2/c15-14(16)11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XFOHWECQTFIEIX-UHFFFAOYSA-N | StdInChIKey = XFOHWECQTFIEIX-UHFFFAOYSA-N
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| C=13|H=8|N=1|O=2 | C=13 | H=9 | N=1 | O=2
| MeltingPtC = 156 to 158
| ExactMass = 210.055503505 g mol<sup>-1</sup>
| MeltingPtCL = 156 | LogP = 3.982
| MeltingPtCH = 158
| LogP = 3.982
}} }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| GHSPictograms = {{GHS health hazard}} | GHSPictograms = {{GHS health hazard}}
| GHSSignalWord = Warning | GHSSignalWord = Warning
| HPhrases = {{H-phrases|351}} | HPhrases = {{H-phrases|351}}
| PPhrases = {{P-phrases|281}} | PPhrases = {{P-phrases|281}}
| EUClass = {{Hazchem Xn}} {{Hazchem N}}
| RPhrases = {{R40}}, {{R51/53}}
| SPhrases = {{S36/37}}, {{S61}}
}} }}
}} }}

'''2-Nitrofluorene''' is a by-product of combustion and is a ]d ] (]). 2-Nitrofluorene is listed as an ],<ref></ref> indicating it is possibly carcinogenic to humans.<ref>{{cite news|url=http://cpdb.thomas-slone.org/chempages/2-NITROFLUORENE.html|title=2-nitrofluorene: Carcinogenic Potency Database|publisher=Berkley|accessdate=7 June 2020}}</ref>

== References ==
{{Reflist}}

{{DEFAULTSORT:Nitrofluorene, 2-}}
]
]
]


{{Aromatic-stub}}