| Revision as of 17:32, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 472757590 of page 2-Phosphoglyceric_acid for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 17:34, 8 June 2022 edit M97uzivatel (talk | contribs)Extended confirmed users6,558 editsNo edit summary |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
|Verifiedfields = changed |
|
| verifiedrevid = 401673489 |
|
|
|
|verifiedrevid = 477215471 |
|
|ImageFile=2-Phosphoglycerate.png |
|
|ImageFile=2-Phosphoglycerate.png |
|
|ImageSize=180px |
|
|ImageSize=180px |
|
|IUPACName=3-hydroxy-2-phosphonooxypropanoic acid |
|
|IUPACName=3-hydroxy-2-phosphonooxypropanoic acid |
|
|OtherNames=2PG |
|
|OtherNames=2PG |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 58 |
|
|ChemSpiderID = 58 |
|
|
|ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| InChI = 1/C3H7O7P/c4-1-2(3(5)6)10-11(7,8)9/h2,4H,1H2,(H,5,6)(H2,7,8,9) |
|
|
|
|ChEBI = 24344 |
|
| InChIKey = GXIURPTVHJPJLF-UHFFFAOYAQ |
|
|
|
|InChI = 1/C3H7O7P/c4-1-2(3(5)6)10-11(7,8)9/h2,4H,1H2,(H,5,6)(H2,7,8,9) |
|
| SMILES1 = O=P(O)(O)OC(C(=O)O)CO |
|
|
|
|InChIKey = GXIURPTVHJPJLF-UHFFFAOYAQ |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
|SMILES1 = O=P(O)(O)OC(C(=O)O)CO |
|
| StdInChI = 1S/C3H7O7P/c4-1-2(3(5)6)10-11(7,8)9/h2,4H,1H2,(H,5,6)(H2,7,8,9) |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|StdInChI = 1S/C3H7O7P/c4-1-2(3(5)6)10-11(7,8)9/h2,4H,1H2,(H,5,6)(H2,7,8,9) |
|
| StdInChIKey = GXIURPTVHJPJLF-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
|StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|StdInChIKey = GXIURPTVHJPJLF-UHFFFAOYSA-N |
|
| CASNo = <!-- blanked - oldvalue: 2553-59-5 --> |
|
|
|
|CASNo_Ref = {{cascite|changed|??}} |
|
| PubChem=59 |
|
|
|
|CASNo=2553-59-5 |
|
| SMILES=C(C(C(=O)O)OP(=O)(O)O)O |
|
|
|
|PubChem=59 |
|
}} |
|
|
|
|SMILES=C(C(C(=O)O)OP(=O)(O)O)O |
|
|Section2= {{Chembox Properties |
|
|
| Formula=C<sub>3</sub>H<sub>7</sub>O<sub>7</sub>P |
|
|
| MolarMass=186.06 g/mol |
|
|
| Appearance= |
|
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
|
|Section3= {{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
|
}} |
|
}} |
|
|
|Section2={{Chembox Properties |
|
|
|Formula=C<sub>3</sub>H<sub>7</sub>O<sub>7</sub>P |
|
|
|MolarMass=186.06 g/mol}} |
|
|
}} |
|
|
|
|
|
'''2-Phosphoglyceric acid''' ('''2PG'''), or '''2-phosphoglycerate''', is a ] which serves as the substrate in the ninth step of ]. It is catalyzed by ] into ] (PEP), the penultimate step in the conversion of ] to ]. |
|
|
|
|
|
==In glycolysis== |
|
|
{| style="background: white; text-align:center;" |
|
|
|- |
|
|
| style="background:lightgreen" | ] |
|
|
| colspan="2" style="background:pink; width:75px" | ] |
|
|
| style="background:lightgreen" | ] |
|
|
| colspan="2" style="background:pink; width:75px" | ] |
|
|
| style="background:lightgreen" | ] |
|
|
|- |
|
|
| rowspan="5" | ] |
|
|
| colspan="2" style="width:75px" | |
|
|
| rowspan="5" | ] |
|
|
| colspan="2" style="width:75px" | |
|
|
| rowspan="5" | ] |
|
|
|- |
|
|
| |
|
|
| |
|
|
| |
|
|
| H<sub>2</sub>O |
|
|
|- |
|
|
| colspan="2" style="width:75px" | ] |
|
|
| colspan="2" style="width:75px" | ] |
|
|
|- |
|
|
| |
|
|
| |
|
|
| |
|
|
| H<sub>2</sub>O |
|
|
|- |
|
|
| colspan="2" style="width:75px" | |
|
|
| colspan="2" style="width:75px" | |
|
|
|- |
|
|
| |
|
|
| colspan="2" style="background:pink; width:75px" | ] |
|
|
| |
|
|
| colspan="2" style="background:pink; width:75px" | ] |
|
|
| align="right" | |
|
|
|} |
|
|
{{KEGG compound|C00197}} {{KEGG enzyme|5.4.2.1}} {{KEGG compound|C00631}} {{KEGG enzyme|4.2.1.11}} {{KEGG compound|C00074}} |
|
|
|
|
|
{{GlycolysisGluconeogenesis_WP534|highlight=2-Phosphoglyceric_acid}} |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{refimprove|date=September 2007}} |
|
|
{{reflist}} |
|
|
|
|
|
{{Glycolysis}} |
|
|
|
|
|
{{metabolism-stub}} |
|
|
{{organic-compound-stub}} |
|
|
|
|
|
{{DEFAULTSORT:Phosphoglyceric acid, 2-}} |
|
|
] |
|
|
] |