| Revision as of 17:40, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 424761739 of page 3,3',5-Triiodothyronamine for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 02:28, 24 November 2022 edit Balnibarbarian (talk | contribs)453 editsNo edit summaryTags: Visual edit: Switched Newcomer task Newcomer task: references |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 413116431 |
|
| verifiedrevid = 477216997 |
|
|ImageFile=3,3',5-triiodothyronamine.png |
|
| ImageFile=3,3',5-triiodothyronamine.png |
|
|ImageSize=200px |
|
| ImageSize=240px |
| ⚫ |
|IUPACName=4--2-iodophenol |
|
|
|
| ImageAlt = Skeletal formula of 3,3',5-triiodothyronamine |
| ⚫ |
|OtherNames=Triam |
|
|
|
| ImageFile1 = 3,3',5-Triiodothyronamine 3D ball.png |
|
|
| ImageSize1 = 220 |
|
|
| ImageAlt1 = Ball-and-stick model of the 3,3',5-triiodothyronamine molecule |
|
⚫ |
| PIN=4--2-iodophenol |
|
⚫ |
| OtherNames=Triam |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 144879 |
|
| ChemSpiderID = 144879 |
|
| InChI = 1/C14H12I3NO2/c15-10-7-9(1-2-13(10)19)20-14-11(16)5-8(3-4-18)6-12(14)17/h1-2,5-7,19H,3-4,18H2 |
|
| InChI = 1/C14H12I3NO2/c15-10-7-9(1-2-13(10)19)20-14-11(16)5-8(3-4-18)6-12(14)17/h1-2,5-7,19H,3-4,18H2 |
| Line 18: |
Line 22: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KIXGKGGCXPSNDX-UHFFFAOYSA-N |
|
| StdInChIKey = KIXGKGGCXPSNDX-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 4731-88-8 --> |
|
|
|
| CASNo=4731-88-8 |
| ⚫ |
| PubChem=165262 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=C1=CC(=C(C=C1OC2=C(C=C(C=C2I)CCN)I)I)O |
|
|
|
| UNII = JFU2LL83MX |
|
⚫ |
| PubChem=165262 |
|
⚫ |
| SMILES=C1=CC(=C(C=C1OC2=C(C=C(C=C2I)CCN)I)I)O |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>14</sub>H<sub>12</sub>I<sub>3</sub>NO<sub>2</sub> |
|
| Formula=C<sub>14</sub>H<sub>12</sub>I<sub>3</sub>NO<sub>2</sub> |
|
| MolarMass=606.96 g/mol |
|
| MolarMass=606.96 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''3,3',5-Triiodothyronamine''' is a ].<ref>{{Cite web |last=PubChem |title=3,3',5-Triiodothyronamine |url=https://pubchem.ncbi.nlm.nih.gov/compound/165262 |access-date=2022-11-24 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Thyroid hormone intermediates}} |
|
|
|
|
|
{{DEFAULTSORT:Triiodothyronamine, 3,3',5-}} |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{amine-stub}} |