| Revision as of 10:51, 28 November 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey.← Previous edit |
Latest revision as of 23:51, 24 June 2024 edit undoAllforrous (talk | contribs)Extended confirmed users27,520 edits removed Category:Thyroid OVERCAT. |
| (32 intermediate revisions by 28 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| verifiedrevid = 399302850 |
|
| ImageFile = Diiodothyronine.png |
|
| ImageFile = Diiodothyronine.png |
|
| ImageSize = 150px |
|
| ImageSize = 150px |
|
|
| ImageAlt = Skeletal formula of the 3,3'-diiodothyronine molecule |
| ⚫ |
| IUPACName = 2-Amino-3-propanoic acid |
|
|
|
| ImageFile1 = 3,3'-Diiodothyronine zwitterion 3D ball.png |
|
|
| ImageSize1 = 230 |
|
|
| ImageAlt1 = Ball-and-stick model of the 3,3'-diiodothyronine molecule as a zwitterion |
|
|
| IUPACName = 3,3′-Diiodo-{{small|DL}}-thyronine |
|
⚫ |
| SystematicName = 2-Amino-3-propanoic acid |
|
| OtherNames = ''O''-(4-Hydroxy-3-iodophenyl)-3-iodotyrosine |
|
| OtherNames = ''O''-(4-Hydroxy-3-iodophenyl)-3-iodotyrosine |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| ChemSpiderID = 59002 |
|
| IUPHAR_ligand = 6648 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 59002 |
|
| InChI = 1/C15H13I2NO4/c16-10-7-9(2-3-13(10)19)22-14-4-1-8(5-11(14)17)6-12(18)15(20)21/h1-5,7,12,19H,6,18H2,(H,20,21) |
|
| InChI = 1/C15H13I2NO4/c16-10-7-9(2-3-13(10)19)22-14-4-1-8(5-11(14)17)6-12(18)15(20)21/h1-5,7,12,19H,6,18H2,(H,20,21) |
|
| InChIKey = CPCJBZABTUOGNM-UHFFFAOYAW |
|
| InChIKey = CPCJBZABTUOGNM-UHFFFAOYAW |
|
| SMILES1 = O=C(O)C(N)Cc2ccc(Oc1cc(I)c(O)cc1)c(I)c2 |
|
| SMILES1 = O=C(O)C(N)Cc2ccc(Oc1cc(I)c(O)cc1)c(I)c2 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C15H13I2NO4/c16-10-7-9(2-3-13(10)19)22-14-4-1-8(5-11(14)17)6-12(18)15(20)21/h1-5,7,12,19H,6,18H2,(H,20,21) |
|
| StdInChI = 1S/C15H13I2NO4/c16-10-7-9(2-3-13(10)19)22-14-4-1-8(5-11(14)17)6-12(18)15(20)21/h1-5,7,12,19H,6,18H2,(H,20,21) |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CPCJBZABTUOGNM-UHFFFAOYSA-N |
|
| StdInChIKey = CPCJBZABTUOGNM-UHFFFAOYSA-N |
|
| CASNo = 70-40-6 |
|
| CASNo = 70-40-6 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| PubChem = 65559 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = NC(C(O)=O)CC1=CC(I)=C(OC2=CC=C(O)C(I)=C2)C=C1 |
|
|
|
| UNII = GNC4MZ8B3Q |
| ⚫ |
| MeSHName = 3,3'-diiodothyronine |
|
|
⚫ |
| PubChem = 65559 |
|
|
| ChEBI = 35430 |
|
⚫ |
| SMILES = NC(C(O)=O)CC1=CC(I)=C(OC2=CC=C(O)C(I)=C2)C=C1 |
|
⚫ |
| MeSHName = 3,3'-diiodothyronine |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = C<sub>15</sub>H<sub>13</sub>I<sub>2</sub>NO<sub>4</sub> |
|
| Formula = C<sub>15</sub>H<sub>13</sub>I<sub>2</sub>NO<sub>4</sub> |
|
| MolarMass = 525.077 |
|
| MolarMass = 525.077 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| Solubility = |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| AutoignitionPt = |
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''3,3'-Diiodothyronine''' is a metabolite of ]. |
|
'''3,3'-Diiodothyronine''', also known as '''3,3'-T<sub>2</sub>''', is a metabolite of ]. |
|
|
|
|
|
⚫ |
It is formed from the breakdown of ]. Levels can be affected in certain disease states.<ref name="pmid9745405">{{cite journal |author =Pinna G |author2 =Hiedra L |author3 =Meinhold H |title=3,3'-Diiodothyronine concentrations in the sera of patients with nonthyroidal illnesses and brain tumors and of healthy subjects during acute stress |journal=J. Clin. Endocrinol. Metab. |volume=83 |issue=9 |pages=3071–7 |date=September 1998 |doi =10.1210/jcem.83.9.5080 |pmid=9745405 |display-authors=etal|doi-access=free }}</ref> |
|
It is formed from the breakdown of tri-iodothyronine (T3). |
|
|
|
|
| ⚫ |
Levels can be affected in certain disease states.<ref name="pmid9745405">{{cite journal |author=Pinna G, Hiedra L, Meinhold H, ''et al'' |title=3,3'-Diiodothyronine concentrations in the sera of patients with nonthyroidal illnesses and brain tumors and of healthy subjects during acute stress |journal=J. Clin. Endocrinol. Metab. |volume=83 |issue=9 |pages=3071–7 |year=1998 |month=September |pmid=9745405 |doi= 10.1210/jc.83.9.3071|url=}}</ref> |
|
|
|
|
|
|
==Reactions== |
|
==Reactions== |
|
]{{clear}} |
|
], and from ]]]{{clear left}} |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
⚫ |
{{Thyroid hormone intermediates}} |
|
|
|
|
|
{{DEFAULTSORT:Diiodothyronine, 3,3'-}} |
|
{{DEFAULTSORT:Diiodothyronine, 3,3'-}} |
| Line 48: |
Line 61: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
{{organic-compound-stub}} |
|
| ⚫ |
{{Thyroid hormone intermediates}} |
|
|
|
|
|
] |
|