| Revision as of 17:42, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456501852 of page 3,4,5-Tri-O-galloylquinic_acid for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 23:54, 28 January 2023 edit OAbot (talk | contribs)Bots440,440 editsm Open access bot: doi added to citation with #oabot. |
| Line 1: |
Line 1: |
|
|
{{DISPLAYTITLE:3,4,5-Tri-''O''-galloylquinic acid}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 456500695 |
|
| verifiedrevid = 477217272 |
|
| Name = 3,4,5-Tri-''O''-galloylquinic acid |
|
| Name = 3,4,5-Tri-''O''-galloylquinic acid |
|
| ImageFile = 3,4,5-Tri-O-galloylquinic acid.png |
|
| ImageFile = 3,4,5-Tri-O-galloylquinic acid.png |
|
| ImageSize = 200px |
|
| ImageSize = |
|
| ImageName = Chemical structure of 3,4,5-tri-O-galloylquinic acid |
|
| ImageName = Chemical structure of 3,4,5-tri-O-galloylquinic acid |
|
| ImageAlt = Chemical structure of 3,4,5-tri-O-galloylquinic acid |
|
| ImageAlt = Chemical structure of 3,4,5-tri-O-galloylquinic acid |
|
| IUPACName = (1''S'',3''R'',4''S'',5''R'')-1-Hydroxy-3,4,5-tris((3,4,5-trihydroxybenzoyl)oxy)cyclohexanecarboxylic acid |
|
| PIN = (1''S'',3''R'',4''S'',5''R'')-1-Hydroxy-3,4,5-triscyclohexane-1-carboxylic acid |
|
| OtherNames = TGQA<br>(3''R'',5''R'')-1-Hydroxy-3,4,5-tris(3,4,5-trihydroxyphenylcarbonyloxy)cyclohexanecarboxylic acid |
|
| OtherNames = TGQA<br>(3''R'',5''R'')-1-Hydroxy-3,4,5-tris(3,4,5-trihydroxyphenylcarbonyloxy)cyclohexanecarboxylic acid |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 23171208 |
|
| ChemSpiderID = 23171208 |
| Line 21: |
Line 22: |
|
| StdInChIKey = PEOHIPMSHPWYAQ-LGFATHPOSA-N |
|
| StdInChIKey = PEOHIPMSHPWYAQ-LGFATHPOSA-N |
|
| InChIKey1 = PEOHIPMSHPWYAQ-LGFATHPOSA-N |
|
| InChIKey1 = PEOHIPMSHPWYAQ-LGFATHPOSA-N |
|
| CASNo = <!-- blanked - oldvalue: 99745-62-7 --> |
|
| CASNo = 99745-62-7 |
|
| CASNo_Ref = {{cascite|changed|??}}= |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASOther = |
|
| CASNoOther = |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 310527 |
|
| ChEMBL = 310527 |
|
| PubChem = 127406 |
|
| PubChem = 127406 |
|
| SMILES = O1(C(O)=O)C(OC(C2=CC(O)=C(O)C(O)=C2)=O)(OC(C3=CC(O)=C(O)C(O)=C3)=O)(OC(C4=CC(O)=C(O)C(O)=C4)=O)C1 |
|
| SMILES = O1(C(O)=O)C(OC(C2=CC(O)=C(O)C(O)=C2)=O)(OC(C3=CC(O)=C(O)C(O)=C3)=O)(OC(C4=CC(O)=C(O)C(O)=C4)=O)C1 |
|
| InChI = |
|
|
| MeSHName = |
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=28|H=24|O=18 |
|
| C=28 | H=24 | O=18 |
|
| ExactMass = 648.096264 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = 1.98g/cm<sup>3</sup> |
|
| Density = 1.98g/cm<sup>3</sup> |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = 1114.4 °C @ 760mmHg |
|
| BoilingPtC = 1114.4 |
|
|
| BoilingPt_notes = at 760mmHg |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| FlashPt = 364.6 |
|
| FlashPtC = 364.6 |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''3,4,5-Tri-''O''-galloylquinic acid''' is a ] found in '']'',<ref name="ncfcrf">{{Cite web |url=http://home.ncifcrf.gov/mtdp/Catalog/compounds/692283.html |title=3,4,5-tri-O-galloylquinic acid on home.ncifcrf.gov |access-date=2010-07-05 |archive-url=https://web.archive.org/web/20110716175234/http://home.ncifcrf.gov/mtdp/Catalog/compounds/692283.html |archive-date=2011-07-16 |url-status=dead }}</ref> in '']''<ref>{{Cite journal | last1 = Bouchet | first1 = N. | last2 = Levesque | first2 = J. L. | last3 = Bodo | first3 = B. | last4 = Pousset | first4 = J. L. | title = 3,4,5-Tri-O-Galloylquinic Acid Ethyl Ester from Guiera senegalensis | doi = 10.1076/phbi.36.1.63.4624 | journal = Pharmaceutical Biology | volume = 36 | pages = 63–65 | year = 1998 | doi-access = free }}</ref> or in the resurrection plant ('']'').<ref>{{Cite journal | last1 = Westall | first1 = K. L. | last2 = Moore | first2 = J. P. | last3 = Ravenscroft | first3 = N. | last4 = Farrant | first4 = J. M. | last5 = Lindsey | first5 = G. G. | last6 = Brandt | first6 = W. F. | doi = 10.1042/BJ20040499 | title = The predominant polyphenol in the leaves of the resurrection plant Myrothamnus flabellifolius, 3,4,5 tri-O-galloylquinic acid, protects membranes against desiccation and free radical-induced oxidation | journal = Biochemical Journal | volume = 385 | issue = Pt 1 | pages = 301–308 | year = 2005 | pmid = 15355309| pmc =1134698 }}</ref> |
|
|
|
|
|
It is classified as a ] with anti-HIV activity<ref name="ncfcrf"/> and a ].<ref>{{PubChem|127406}}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Gallotannin}} |
|
|
|
|
|
{{DEFAULTSORT:Tri-O-Galloylquinic Acid, 3,4,5-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{aromatic-stub}} |