| Revision as of 17:46, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 457652132 of page 3-Aminoacridine for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 16:22, 18 April 2021 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits capitalize name |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 457650830 |
|
| verifiedrevid = 477218001 |
|
|ImageFile=3-aminoacridine.png |
|
| ImageFile=3-aminoacridine.png |
|
|ImageSize= |
|
| ImageSize= |
|
|IUPACName=acridin-3-amine |
|
| PIN=Acridin-3-amine |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 10907 |
|
| ChemSpiderID = 10907 |
|
| InChI = 1/C13H10N2/c14-11-6-5-10-7-9-3-1-2-4-12(9)15-13(10)8-11/h1-8H,14H2 |
|
| InChI = 1/C13H10N2/c14-11-6-5-10-7-9-3-1-2-4-12(9)15-13(10)8-11/h1-8H,14H2 |
| Line 20: |
Line 19: |
|
| StdInChIKey = GHCKERHPOQWERJ-UHFFFAOYSA-N |
|
| StdInChIKey = GHCKERHPOQWERJ-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 581-29-3 --> |
|
| CASNo=581-29-3 |
|
| PubChem=11385 |
|
| PubChem=11385 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 5T83GY5877 |
|
| UNII = 5T83GY5877 |
|
| SMILES=C1=CC=C2C(=C1)C=C3C=CC(=CC3=N2)N |
|
| SMILES=C1=CC=C2C(=C1)C=C3C=CC(=CC3=N2)N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>13</sub>H<sub>10</sub>N<sub>2</sub> |
|
| Formula=C<sub>13</sub>H<sub>10</sub>N<sub>2</sub> |
|
| MolarMass=194.23 g/mol |
|
| MolarMass=194.23 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''3-Aminoacridine''' is an ]. |
|
|
|
|
|
== See also== |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
{{DEFAULTSORT:Aminoacridine, 3-}} |
|
|
{{heterocyclic-stub}} |
|
|
] |
|
|
] |