| Revision as of 17:50, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 472181488 of page 3-Hydroxyanthranilic_acid for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 02:17, 9 September 2024 edit 98.191.202.231 (talk) Cat. |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 443653662 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=3-Hydroxyanthranilic acid.png |
|
|
⚫ |
| verifiedrevid = 477218575 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile = 3-Hydroxyanthranilic acid.png |
| ⚫ |
|IUPACName=2-Amino-3-hydroxybenzoic acid |
|
|
⚫ |
| ImageSize = 160px |
| ⚫ |
|OtherNames= |
|
|
|
| ImageAlt = Skeletal formula of 3-hydroxyanthranilic acid |
| ⚫ |
|Section1={{Chembox Identifiers |
|
|
|
| ImageFile1 = 3-Hydroxyanthranilic-acid-zwitterion-3D-balls.png |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| ImageSize1 = 160px |
|
|
| ImageAlt1 = Ball-and-stick model of the 3-hydroxyanthranilic acid molecule as a zwitterion |
|
⚫ |
| PIN= 2-Amino-3-hydroxybenzoic acid |
|
⚫ |
| OtherNames= |
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 84 |
|
| ChemSpiderID = 84 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
| Line 20: |
Line 25: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WJXSWCUQABXPFS-UHFFFAOYSA-N |
|
| StdInChIKey = WJXSWCUQABXPFS-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 548-93-6 --> |
|
| CASNo = 548-93-6 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem=86 |
|
|
|
| UNII = 1UQB1BT4OT |
| ⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
⚫ |
| PubChem = 86 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 15793 |
|
| ChEBI = 15793 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB03644 |
|
| DrugBank = DB03644 |
|
| SMILES=C1=CC(=C(C(=C1)O)N)C(=O)O |
|
| SMILES = C1=CC(=C(C(=C1)O)N)C(=O)O |
|
| MeSHName=3-Hydroxyanthranilic+Acid |
|
| MeSHName = 3-Hydroxyanthranilic+Acid |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| C=7|H=7|N=1|O=3 |
|
| Formula=C<sub>7</sub>H<sub>7</sub>NO<sub>3</sub> |
|
|
⚫ |
| Appearance = powder |
|
| MolarMass=153.14 g/mol |
|
|
|
| Density = ≈ 1 g/cm<sup>3</sup> |
| ⚫ |
| Appearance= |
|
|
|
| MeltingPtC = 240-265 |
|
| Density= |
|
|
|
| MeltingPt_ref =<ref>{{cite journal|last1 = Moline|first1= Sheldon W.|last2 = Walker|first2 = H.C.|last3 = Schweigert|first3 = B.S.|year = 1958|title = 3-Hydroxyanthranilic Acid Metabolism: VII. Mechanism of Formation of Quinolinic Acid|url = http://www.jbc.org/content/234/4/880|journal = Journal of Biological Chemistry|volume = 234|issue = 4|pages = 880–883|doi= 10.1016/S0021-9258(18)70194-4|pmid= 13654282|access-date = 2015-09-24|doi-access= free}}</ref><br/> decomposes<br/> {{convert|227|C|F K}}<ref name=plc>{{cite book|first1 = Wilfred L.F.|last1 = Armarego|first2 = Christina L.L.|last2 = Chai|year = 2009|title = Purification of Laboratory Chemicals|url = https://books.google.com/books?id=PTXyS7Yj6zUC&pg=PA297|publisher = Elsevier Inc.|edition = 6th|page = 297|isbn = 978-1-85617-567-8}}</ref><br/> from dilute ], decomposes |
|
| MeltingPt= |
|
|
|
| LambdaMax = 298 nm<ref name=plc/> |
|
| BoilingPt= |
|
|
|
| pKa = at 20 °C:<ref name=plc/><br/> 1 = 2.7, 2 = 5.19, 3 = 10.12 |
|
| Solubility= |
|
|
|
| Solubility = low<ref name=scbt/> |
|
|
| SolubleOther = soluble in ether, ], alcohols<ref name=scbt/> |
|
|
| Solubility1 = 1 N:<ref name=scbt>{{cite web|url = https://www.scbt.com/scbt/product/3-hydroxyanthranilic-acid-548-93-6|title = 3-Hydroxyanthranilic acid|publisher = Santa Cruz Biotechnology, Inc.|access-date = 2015-09-24}}</ref><br/> 1 g/100 ml |
|
|
| Solvent1 = hydrochloric acid |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
| Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''3-Hydroxyanthranilic acid''' is an ] in the ]. It is new ] isolated from ] extract of ]. It is effective in preventing ] of ] and powder, while antioxidant 6,7,4'-trihydroxyisoflavone is not.<ref>{{cite journal|doi=10.1021/jf950454t|title=New Antioxidant Isolated from Tempeh|journal=Journal of Agricultural and Food Chemistry|volume=44|issue=3|pages=696|year=1996|last1=Esaki|first1=Hideo|last2=Onozaki|first2=Hiromichi|last3=Kawakishi|first3=Shunro|last4=Osawa|first4=Toshihiko}}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist|35em}} |
|
|
|
|
|
==External links== |
|
|
* concentration graph in lyophilized tempeh powder extract {{in lang|id}} |
|
|
|
|
|
{{Amino acid metabolism intermediates}} |
|
|
|
|
|
{{DEFAULTSORT:Hydroxyanthranilic acid, 3-}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{aromatic-stub}} |