| Revision as of 17:52, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 452198925 of page 3-Hydroxykynurenine for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 02:17, 9 September 2024 edit 98.191.202.231 (talk) Cat. |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443348502 |
|
| verifiedrevid = 477218877 |
|
|ImageFile=3-hydroxykynurenine.png |
|
| ImageFile=3-hydroxykynurenine.png |
|
|ImageSize=200px |
|
| ImageSize=200px |
| ⚫ |
|IUPACName=2-Amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid |
|
|
|
| ImageAlt = Skeletal formula of 3-hydroxykynurenine |
| ⚫ |
|OtherNames= |
|
|
|
| ImageFile1 = 3-Hydroxy-L-kynurenine-zwitterion-3D-balls.png |
|
|
| ImageAlt1 = Ball-and-stick model of the 3-hydroxykynurenine molecule as a zwitterion |
|
⚫ |
| IUPACName=2-Amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid |
|
⚫ |
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C02794 |
|
| KEGG = C02794 |
|
| InChI = 1/C10H12N2O4/c11-6(10(15)16)4-8(14)5-2-1-3-7(13)9(5)12/h1-3,6,13H,4,11-12H2,(H,15,16) |
|
| InChI = 1/C10H12N2O4/c11-6(10(15)16)4-8(14)5-2-1-3-7(13)9(5)12/h1-3,6,13H,4,11-12H2,(H,15,16) |
| Line 17: |
Line 20: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VCKPUUFAIGNJHC-UHFFFAOYSA-N |
|
| StdInChIKey = VCKPUUFAIGNJHC-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 484-78-6 --> |
|
|
|
| CASNo=484-78-6 |
| ⚫ |
| PubChem=89 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 27723548JL |
|
⚫ |
| PubChem=89 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 1547 |
|
| ChEBI = 1547 |
|
| SMILES = O=C(O)C(N)CC(=O)c1cccc(O)c1N |
|
| SMILES = O=C(O)C(N)CC(=O)c1cccc(O)c1N |
|
| MeSHName=3-hydroxykynurenine |
|
| MeSHName=3-hydroxykynurenine |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 87 |
|
| ChemSpiderID = 87 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>10</sub>H<sub>12</sub>N<sub>2</sub>O<sub>4</sub> |
|
| Formula=C<sub>10</sub>H<sub>12</sub>N<sub>2</sub>O<sub>4</sub> |
|
| MolarMass=224.21 g/mol |
|
| MolarMass=224.21 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''3-Hydroxykynurenine''' is a metabolite of ], which filters UV light in the human ].<ref>{{cite journal|last1=Malina|first1=HZ|last2=Martin |first2=XD|title=Deamination of 3-hydroxykynurenine in bovine lenses: a possible mechanism of cataract formation in general.|journal=Graefes Arch Clin Exp Ophthalmol|year=1995|volume=233|issue=1|pages=38–44|pmid=7721122|doi=10.1007/bf00177784|s2cid=25414197}}</ref> It is one of two pigments identified as responsible for the ]'s (''Misumena vatia)'' yellow coloration. |
|
|
], which connects ] to tryptophan. The pathway is named for the first intermediate, ], which is a precursor to ] and 3-hydroxykynurenine.<ref name=Schwarcz>{{cite journal|last=Schwarcz|first=Robert |author2=John P. Bruno |author3=Paul J. Muchowski |author4=Hui-Qiu Wu|title=Kynurenines in the Mammalian Brain: When Physiology Meets Pathology|journal=Nature Reviews Neuroscience|date=July 2012|volume=13|pages=465–477|doi=10.1038/nrn3257|issue=7|pmid=22678511 |pmc=3681811}}</ref>]] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
{{Amino acid metabolism intermediates}} |
|
|
|
|
|
{{DEFAULTSORT:Hydroxykynurenine, 3-}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |