| Revision as of 17:53, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 463761588 of page 3-Iodothyronamine for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 19:32, 10 March 2024 edit Maxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,042 edits Added the cs1 style template to denote Vancouver ("vanc") citation style, because references contain "vauthors" attribute to specify the list of authors. Added doi-access. | Use this tool. Report bugs. | #UCB_Gadget |
| Line 1: |
Line 1: |
|
|
{{cs1 config|name-list-style=vanc}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 399311871 |
|
| verifiedrevid = 477219003 |
|
| ImageFile = 3-Iodothyronamine.svg |
|
| ImageFile = 3-Iodothyronamine.svg |
|
| ImageSize = 200px |
|
| ImageSize = 230px |
|
|
| ImageAlt = Skeletal formula of the 3-iodothyronamine |
| ⚫ |
| IUPACName = 4--phenol |
|
|
|
| ImageFile1 = 3-Iodothyronamine 3D ball.png |
|
|
| ImageSize1 = 230px |
|
|
| ImageAlt1 = Ball-and-stick model of the 3-iodothyronamine molecule |
|
⚫ |
| PIN = 4-phenol |
|
| OtherNames = T<sub>1</sub>AM |
|
| OtherNames = T<sub>1</sub>AM |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 8126125 |
|
| ChemSpiderID = 8126125 |
|
⚫ |
| PubChem = 9950514 |
|
| InChI = 1/C14H14INO2/c15-13-9-10(7-8-16)1-6-14(13)18-12-4-2-11(17)3-5-12/h1-6,9,17H,7-8,16H2 |
|
| InChI = 1/C14H14INO2/c15-13-9-10(7-8-16)1-6-14(13)18-12-4-2-11(17)3-5-12/h1-6,9,17H,7-8,16H2 |
|
| InChIKey = XIINYOJWNGOUPF-UHFFFAOYAJ |
|
| InChIKey = XIINYOJWNGOUPF-UHFFFAOYAJ |
| Line 16: |
Line 22: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XIINYOJWNGOUPF-UHFFFAOYSA-N |
|
| StdInChIKey = XIINYOJWNGOUPF-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 712349-95-6 --> |
|
| CASNo = 712349-95-6 |
| ⚫ |
| PubChem = |
|
|
| SMILES = OC1=CC=C(OC2=C(I)C=C(CCN)C=C2)C=C1 |
|
| SMILES = OC1=CC=C(OC2=C(I)C=C(CCN)C=C2)C=C1 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>14</sub>H<sub>14</sub>INO<sub>2</sub> |
|
| Formula = C<sub>14</sub>H<sub>14</sub>INO<sub>2</sub> |
|
| MolarMass = 355.17 g/mol |
|
| MolarMass = 355.17 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''3-Iodothyronamine''' ('''T<sub>1</sub>AM''') is an ] ]. T<sub>1</sub>AM is a high-affinity ] for the ] ] (TAR1, TA1), a recently discovered ].<ref>{{cite journal |vauthors =Scanlan T, Suchland K, Hart M, Chiellini G, Huang Y, Kruzich P, Frascarelli S, Crossley D, Bunzow J, Ronca-Testoni S, Lin E, Hatton D, Zucchi R, Grandy D |title=3-Iodothyronamine is an endogenous and rapid-acting derivative of thyroid hormone |journal=Nat. Med. |volume=10 |issue=6 |pages=638–42 |year=2004 |pmid=15146179 |doi=10.1038/nm1051|s2cid=2389946 }}</ref><ref>{{cite journal |vauthors =Hart M, Suchland K, Miyakawa M, Bunzow J, Grandy D, Scanlan T |title=Trace amine-associated receptor agonists: synthesis and evaluation of thyronamines and related analogues |journal=J. Med. Chem. |volume=49 |issue=3 |pages=1101–12 |year=2006 |pmid=16451074 |doi=10.1021/jm0505718}}</ref> T<sub>1</sub>AM is the most potent endogenous TAAR1 agonist yet discovered.<ref name="Wu">{{Cite journal |
|
|
| vauthors = Wu SY, Green WL, Huang WS, Hays MT, Chopra IJ |
|
|
| doi = 10.1089/thy.2005.15.943 |
|
|
| title = Alternate Pathways of Thyroid Hormone Metabolism |
|
|
| journal = Thyroid |
|
|
| volume = 15 |
|
|
| issue = 8 |
|
|
| pages = 943–958 |
|
|
| year = 2005 |
|
|
| pmid = 16131336 |
|
|
}}</ref> Activation of TAAR1 by T<sub>1</sub>AM results in the production of large amounts of cAMP. This effect is coupled with decreased ] and ].<ref>{{cite web |url=http://www.eurekalert.org/pub_releases/2004-05/ohs-ncm051404.php |title=New compound may act to keep thyroid activity in check |access-date=2008-05-30}}</ref> Wu ''et al.'' have pointed out that this relationship is not typical of the endocrine system, indicating that TAAR1 activity may not be coupled to G-proteins in some tissues, or that T<sub>1</sub>AM may interact with other receptor subtypes.<ref name="Wu"/> |
|
|
|
|
|
T<sub>1</sub>AM may be part of a signaling pathway to modulate ] function, as the compound can induce negative ] effects and decrease ].<ref>{{cite journal |vauthors =Chiellini G, Frascarelli S, Ghelardoni S, Carnicelli V, Tobias SC, Debarber A, Brogioni S, Ronca-Testoni S, Cerbai E, Grandy DK, Scanlan TS, Zucchi R |title=Cardiac effects of 3-iodothyronamine: a new aminergic system modulating cardiac function |journal= The FASEB Journal|volume= 21|issue= 7|pages= 1597–608|year=2007 |pmid=17284482 |doi=10.1096/fj.06-7474com|doi-access=free |s2cid=14015560 }}</ref> |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
==External links== |
|
|
* {{MeshName|3-iodothyronamine}} |
|
|
{{Thyroid hormone intermediates}} |
|
|
{{TAAR ligands}} |
|
|
{{Phenethylamines}} |
|
|
|
|
|
{{DEFAULTSORT:Iodothyronamine, 3-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |