| Revision as of 18:00, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456535176 of page 3-Nitrobenzyl_alcohol for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 19:38, 31 January 2024 edit Michael7604 (talk | contribs)Extended confirmed users8,895 edits recategorized from Nitrobenzenes to Nitrobenzene derivatives |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 421473251 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 477219935 |
|
| ImageFile = 3-nitrobenzyl alcohol.svg |
|
| ImageFile = 3-nitrobenzyl alcohol.svg |
|
| ImageSize = |
|
| ImageSize = |
|
| IUPACName = (3-nitrophenyl)methanol |
|
| PIN = (3-Nitrophenyl)methanol |
|
| OtherNames = m-Nitrobenzyl alcohol <br>Benzyl alcohol, m-nitro<br>3-Nitrobenzyl alcohol<br>Benzenemethanol, 3-nitro-<br>3-Nitrobenzenemethanol |
|
| OtherNames = ''m''-Nitrobenzyl alcohol<br />Benzyl alcohol, ''m''-nitro<br />3-Nitrobenzyl alcohol<br />Benzenemethanol, 3-nitro-<br />3-Nitrobenzenemethanol |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 62479 |
|
| ChemSpiderID = 62479 |
|
| InChI = 1/C7H7NO3/c9-5-6-2-1-3-7(4-6)8(10)11/h1-4,9H,5H2 |
|
| InChI = 1/C7H7NO3/c9-5-6-2-1-3-7(4-6)8(10)11/h1-4,9H,5H2 |
| Line 16: |
Line 17: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CWNPOQFCIIFQDM-UHFFFAOYSA-N |
|
| StdInChIKey = CWNPOQFCIIFQDM-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 619-25-0 --> |
|
| CASNo =619-25-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| PubChem=69267 |
|
|
|
| UNII = F829X990IV |
| ⚫ |
| SMILES=C1=CC(=CC(=C1)(=O))CO |
|
|
|
| PubChem =69267 |
|
⚫ |
| SMILES =C1=CC(=CC(=C1)(=O))CO |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>7</sub>H<sub>7</sub>NO<sub>3</sub> |
|
| Formula =C<sub>7</sub>H<sub>7</sub>NO<sub>3</sub> |
|
| MolarMass=153.135 |
|
| MolarMass =153.135 |
|
| Appearance= |
|
| Appearance = |
|
| Density=1.29 g/mL |
|
| Density =1.29 g/mL |
|
|
| MeltingPtC = 30 to 32 |
|
| MeltingPt=30–32 °C |
|
|
|
| MeltingPt_notes = |
|
| BoilingPt=175–180 °C |
|
|
|
| BoilingPtC = 175 to 180 |
|
| Solubility= |
|
|
|
| BoilingPt_notes = (3 mmHg) |
| ⚫ |
}} |
|
|
|
| Solubility = |
| ⚫ |
| Section3 = {{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
The compound '''3-nitrobenzyl alcohol''' is an ] with the formula C<sub>7</sub>H<sub>7</sub>NO<sub>3</sub>. |
|
|
|
|
|
==Desorption mass spectrometry matrix== |
|
|
In ] this compound is often abbreviated as "3-NBA" or "m-NBA." It has been used as a liquid matrix for ]<ref>{{citation | author = Meili, J. | year = 1984 | title = A new versatile matrix for fast atom bombardment analysis | journal = Org. Mass Spectrom. | volume = 19 | issue = 11 | pages = 581 | doi = 10.1002/oms.1210191111 | last2 = Seibl | first2 = J. }}</ref> and ].<ref name=Zhao1991>{{citation | author = Zhao, Shankai | year = 1991 | title = Novel method for matrix-assisted laser mass spectrometry of proteins | journal = Anal. Chem. | volume = 63 | issue = 5 | pages = 450 | doi =10.1021/ac00005a012 | last2 = Somayajula | first2 = Kasi V. | last3 = Sharkey | first3 = Andrew G. | last4 = Hercules | first4 = David M. | last5 = Hillenkamp | first5 = Franz. | last6 = Karas | first6 = Michael. | last7 = Ingendoh | first7 = Arndt.}}</ref><ref name=Chan1992>{{citation | author = Chan, T. W. Dominic | year = 1992 | title = Matrix-assisted laser desorption/ionization using a liquid matrix: Formation of high-mass cluster ions from proteins | journal = Org. Mass Spectrom. | volume = 27 | issue = 1 | pages = 53–56 | doi = 10.1002/oms.1210270114 }}</ref> |
|
|
In ] 3-NBA is doped into low surface tension spray solvents to increase analyte charging.<ref name=Iavarone2003>{{citation | author = Anthony T. Iavarone and Evan R. Williams | year = 2003 | title = Mechanism of Charging and Supercharging Molecules in Electrospray Ionization | journal = J. Am. Chem. Soc. | volume = 125 | issue = 8 | pages = 2319–2327 | doi = 10.1021/ja021202t | pmid=12590562 | pmc=1343448}}</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
{{Alcohols}} |
|
|
|
|
|
{{DEFAULTSORT:Nitrobenzyl alcohol, 3-}} |
|
|
] |
|
|
] |