| Revision as of 10:29, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 463089347 of page 4-Acetoxy-MiPT for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 00:54, 29 November 2023 edit Repylom (talk | contribs)67 editsm Repylom moved page 4-Acetoxy-MiPT to 4-AcO-MiPT over redirect: Make shorter (WP:CONCISE, WP:PRECISE) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| ImageFile = 4-AcO-MiPT_molecular_structure.png |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ImageSize = |
|
|
|
| verifiedrevid = 477345104 |
| ⚫ |
| IUPACName = ethyl]-1H-indol-4-yl] acetate |
|
|
|
| ImageFile = 4-Acetoxy-MiPT.svg |
| ⚫ |
| OtherNames = |
|
|
⚫ |
| ImageSize = 200px |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ImageFile2 = 4-Acetoxy-MiPT 3D.png |
| ⚫ |
| CASNo = |
|
|
| PubChem = |
|
| ImageSize2 = 200px |
|
⚫ |
| PIN = 3-{2-ethyl}-1''H''-indol-4-yl acetate |
| ⚫ |
| ChemSpiderID = 23976075 |
|
|
⚫ |
| OtherNames = Mipracetin |
| ⚫ |
| SMILES = CC(C)N(C)CCc1cc2c1c(ccc2)OC(=O)C |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| InChI = 1/C16H22N2O2/c1-11(2)18(4)9-8-13-10-17-14-6-5-7-15(16(13)14)20-12(3)19/h5-7,10-11,17H,8-9H2,1-4H3 |
|
|
|
| CASNo_Ref = {{cascite|changed|??}} |
| ⚫ |
| InChIKey = CIDMXLOVFPIHDS-UHFFFAOYAP |
|
|
⚫ |
| CASNo =1024612-25-6 |
| ⚫ |
| StdInChI = 1S/C16H22N2O2/c1-11(2)18(4)9-8-13-10-17-14-6-5-7-15(16(13)14)20-12(3)19/h5-7,10-11,17H,8-9H2,1-4H3 |
|
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
| ⚫ |
| StdInChIKey = CIDMXLOVFPIHDS-UHFFFAOYSA-N |
|
|
|
| UNII = SS93IMV779 |
|
|
| PubChem = 46783587 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 23976075 |
|
⚫ |
| SMILES = CC(N(CCC1=CNC2=C1C(OC(C)=O)=CC=C2)C)C |
|
⚫ |
| InChI = 1/C16H22N2O2/c1-11(2)18(4)9-8-13-10-17-14-6-5-7-15(16(13)14)20-12(3)19/h5-7,10-11,17H,8-9H2,1-4H3 |
|
⚫ |
| InChIKey = CIDMXLOVFPIHDS-UHFFFAOYAP |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI = 1S/C16H22N2O2/c1-11(2)18(4)9-8-13-10-17-14-6-5-7-15(16(13)14)20-12(3)19/h5-7,10-11,17H,8-9H2,1-4H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = CIDMXLOVFPIHDS-UHFFFAOYSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=16 | H=22 | N=2 | O=2 |
|
| Formula = C<sub>16</sub>H<sub>22</sub>N<sub>2</sub>O<sub>2</sub> |
|
|
| MolarMass = 274.358 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''4-AcO-MiPT''' ('''4-acetoxy-''N''-methyl-''N''-isopropyltryptamine''' or '''mipracetin''') is a ] ]. It is closely related to ] and ]. |
|
|
|
|
|
There is very little information on the human ] or ] of 4-AcO-MiPT, although analytical methods have been developed for its detection.<ref>{{cite journal|last1=TAKAHASHI|first1=M|last2=NAGASHIMA|first2=M|last3=SUZUKI|first3=J|last4=SETO|first4=T|last5=YASUDA|first5=I|last6=YOSHIDA|first6=T|title=Creation and application of psychoactive designer drugs data library using liquid chromatography with photodiode array spectrophotometry detector and gas chromatography–mass spectrometry|journal=Talanta|date=15 February 2009|volume=77|issue=4|pages=1245–1272|doi=10.1016/j.talanta.2008.07.062|pmid=19084633}}</ref><ref>{{cite journal|last1=Noorizadeh|first1=Hadi|last2=Farmany|first2=Abbas|last3=Noorizadeh|first3=Mehrab|title=Application of GA–KPLS and L–M ANN calculations for the prediction of the capacity factor of hazardous psychoactive designer drugs|journal=Medicinal Chemistry Research|date=20 September 2011|volume=21|issue=9|pages=2680–2688|doi=10.1007/s00044-011-9794-y|s2cid=16413083}}</ref> |
|
|
|
|
|
==Drug prohibition laws== |
|
|
|
|
|
===Sweden=== |
|
|
] health ministry ] classified 4-AcO-MiPT as "health hazard" under the act ] (translated ''Act on the Prohibition of Certain Goods Dangerous to Health'') as of Nov 1, 2005, in their regulation '''SFS 2005:733''' listed as '''4-acetoxi-N,N-metylisopropyltryptamin (4-AcO-MIPT)''', making it illegal to sell or possess.<ref>{{cite web |title=Förordning om ändring i förordningen (1999:58) om förbud mot vissa hälsofarliga varor |url=http://www.notisum.se/rnp/sls/sfs/20050733.pdf |archive-url=https://web.archive.org/web/20210626164247/http://www.notisum.se/rnp/sls/sfs/20050733.pdf |archive-date=26 June 2021 |language=Swedish |date=6 October 2005}}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
* |
|
|
* of ], a book about Tryptamines |
|
|
|
|
|
{{Hallucinogens}} |
|
|
{{Tryptamines}} |
|
|
|
|
|
{{DEFAULTSORT:Acetoxy-MiPT, 4-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{hallucinogen-stub}} |