| Revision as of 18:06, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443351425 of page 4-Aminoacridine for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 19:16, 15 November 2022 edit Balnibarbarian (talk | contribs)453 editsNo edit summaryTags: Newcomer task Newcomer task: references |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443350146 |
|
| verifiedrevid = 477220877 |
|
|ImageFile=4-aminoacridine.png |
|
| ImageFile=4-aminoacridine.png |
|
|ImageSize= |
|
| ImageSize= |
|
|IUPACName=acridin-4-amine |
|
|
|
| PIN=Acridin-4-amine |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 21243528 |
|
| ChemSpiderID = 21243528 |
|
| InChI = 1/C13H10N2/c14-11-6-3-5-10-8-9-4-1-2-7-12(9)15-13(10)11/h1-8H,14H2 |
|
| InChI = 1/C13H10N2/c14-11-6-3-5-10-8-9-4-1-2-7-12(9)15-13(10)11/h1-8H,14H2 |
| Line 18: |
Line 18: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = QWAGALBSTFENEE-UHFFFAOYSA-N |
|
| StdInChIKey = QWAGALBSTFENEE-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 578-07-4 --> |
|
|
|
| CASNo=578-07-4 |
|
| PubChem=11353 |
|
| PubChem=11353 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 16S346L1OM |
|
| UNII = 16S346L1OM |
|
| SMILES=C1=CC=C2C(=C1)C=C3C=CC=C(C3=N2)N |
|
| SMILES=C1=CC=C2C(=C1)C=C3C=CC=C(C3=N2)N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>13</sub>H<sub>10</sub>N<sub>2</sub> |
|
| Formula=C<sub>13</sub>H<sub>10</sub>N<sub>2</sub> |
|
| MolarMass=194.23 g/mol |
|
| MolarMass=194.23 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''4-Aminoacridine''' is an ].<ref>{{Cite web |last=PubChem |title=4-Aminoacridine |url=https://pubchem.ncbi.nlm.nih.gov/compound/11353 |access-date=2022-11-15 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> |
|
|
|
|
|
== See also== |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
{{DEFAULTSORT:Aminoacridine, 4-}} |
|
|
{{heterocyclic-stub}} |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |