| Revision as of 14:53, 28 November 2010 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:Wi← Previous edit |
Latest revision as of 07:13, 14 April 2022 edit undoFfffrr (talk | contribs)Extended confirmed users99,507 edits Importing Wikidata short description: "Chemical compound" (Shortdesc helper) |
| (11 intermediate revisions by 10 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 399326699 |
|
| verifiedrevid = 399328223 |
|
| IUPAC_name = ''N'',''N''-Dimethyl-2-ethanamine |
|
| IUPAC_name = ''N'',''N''-Dimethyl-2-ethanamine |
|
| image = Methyldiphenhydramine.png |
|
| image = Methyldiphenhydramine.png |
|
| imagename = ''p''-Methyldiphenhydramine |
|
| drug_name =''p''-Methyldiphenhydramine |
|
|
<!-- Clinical data --> |
|
|
| tradename = |
|
|
<!-- Identifiers --> |
|
⚫ |
| CAS_number = 19804-27-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = P9633413CU |
|
⚫ |
| PubChem = 19935 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 18776 |
|
| ChemSpiderID = 18776 |
|
|
<!-- Chemical data --> |
|
| InChI = 1/C18H23NO/c1-15-9-11-17(12-10-15)18(20-14-13-19(2)3)16-7-5-4-6-8-16/h4-12,18H,13-14H2,1-3H3 |
|
|
⚫ |
| C=18 | H=23 | N=1 | O=1 |
|
| InChIKey = PJUYQWIDNIAHIZ-UHFFFAOYAV |
|
|
⚫ |
| smiles = O(CCN(C)C)C(c1ccccc1)c2ccc(cc2)C |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C18H23NO/c1-15-9-11-17(12-10-15)18(20-14-13-19(2)3)16-7-5-4-6-8-16/h4-12,18H,13-14H2,1-3H3 |
|
| StdInChI = 1S/C18H23NO/c1-15-9-11-17(12-10-15)18(20-14-13-19(2)3)16-7-5-4-6-8-16/h4-12,18H,13-14H2,1-3H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PJUYQWIDNIAHIZ-UHFFFAOYSA-N |
|
| StdInChIKey = PJUYQWIDNIAHIZ-UHFFFAOYSA-N |
| ⚫ |
| CAS_number = 19804-27-4 |
|
|
| ATC_prefix = |
|
|
| ATC_suffix = |
|
| ⚫ |
| PubChem = 19935 |
|
|
| EINECS = 243-329-7 |
|
| ⚫ |
| C = 18 | H = 23 | N = 1 | O = 1 |
|
|
| molecular_weight = 269.38 g/mol |
|
| ⚫ |
| smiles = O(CCN(C)C)C(c1ccccc1)c2ccc(cc2)C |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
| pregnancy_category= |
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
| Line 42: |
Line 35: |
|
{{DEFAULTSORT:Methyldiphenhydramine, 4-}} |
|
{{DEFAULTSORT:Methyldiphenhydramine, 4-}} |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
] |
|
|
|
|
|
|
|
{{respiratory-system-drug-stub}} |
|
{{Amine-stub}} |
|
{{Amine-stub}} |
|
{{pharmacology-stub}} |
|