| Revision as of 21:55, 28 June 2011 editRjwilmsi (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers932,125 editsm Fix bad issue numbers, using AWB (7758)← Previous edit |
Latest revision as of 12:49, 14 January 2024 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,058 edits Alter: title, journal, template type. Added chapter. |
| (20 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 408089574 |
|
| verifiedrevid = 436747408 |
|
| ImageFile = Guanylyl imidodiphosphate.png |
|
| ImageFile = 5'-Guanylyl imidodiphosphate.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
|
| IUPACName = Guanosine 5′-(tetrahydrogen 4-imidotriphosphate) |
|
| IUPACName = <nowiki>methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]amino]phosphonic acid |
|
| SystematicName = ''O''<sup>5</sup>-<nowiki/>{methyl} tetrahydrogen 2-imidotriphosphate |
|
| OtherNames = GppNHp; GppNP; GMP-Pnp; GDP-NP; Guanylyl imidodiphosphate; 5-Guanylylimidodiphosphate; 5'-Guanylyliminodiphosphonate |
|
| OtherNames = GppNHp; GppNP; GMP-Pnp; GDP-NP<br/>Guanylyl imidodiphosphate<br/>5-Guanylylimidodiphosphate<br/>5′-Guanylyliminodiphosphonate |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 34273-04-6 |
|
| CASNo = 34273-04-6 |
|
|
| CASNo1_Ref = {{cascite|changed|??}} |
| ⚫ |
| CASOther = <br>148892-91-5 (trisodium salt)<ref> at ]</ref> |
|
|
|
| CASNo1 = 148892-91-5 |
|
⚫ |
| CASNo1_Comment = (trisodium salt)<ref> at ]</ref> |
|
| PubChem = 36735 |
|
| PubChem = 36735 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 78408 |
|
| SMILES = C1=NC2=C(N13(((O3)COP(=O)(O)OP(=O)(NP(=O)(O)O)O)O)O)NC(=NC2=O)N |
|
| SMILES = C1=NC2=C(N13(((O3)COP(=O)(O)OP(=O)(NP(=O)(O)O)O)O)O)NC(=NC2=O)N |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
}} |
|
|
|
| ChemSpiderID = 33738 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C10H17N6O13P3/c11-10-13-7-4(8(19)14-10)12-2-16(7)9-6(18)5(17)3(28-9)1-27-32(25,26)29-31(23,24)15-30(20,21)22/h2-3,5-6,9,17-18H,1H2,(H,25,26)(H3,11,13,14,19)(H4,15,20,21,22,23,24)/t3-,5-,6-,9-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = UQABYHGXWYXDTK-UUOKFMHZSA-N |
|
|
|
|
⚫ |
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| C=10|H=17|N=6|O=13|P=3 |
|
| C=10|H=17|N=6|O=13|P=3 |
| Line 17: |
Line 31: |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = |
|
|
}} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition = }} |
|
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''5'-Guanylyl imidodiphosphate''' is a ] ]. It is an analog of ] in which one of the oxygen atoms is replaced with an ], producing a ] ]. Guanylyl imidodiphosphate binds tightly to ]s in the presence of Mg<sup>2+</sup>.<ref name="PubChem"> at ]</ref> Guanylyl imidodiphosphate is a potent stimulator of adenylate cyclase.<ref name="PubChem"/> It is often used in studies of protein synthesis.<ref>{{cite journal | author = Miller, J.D., and Walter, P. | title = A GTPase cycle in initiation of protein translocation across the endoplasmic reticulum membrane | journal = Ciba Found. Symp. | volume = 176 | pages = 147–163 | year = 1993 | pmid = 8299417 }}</ref><ref>{{cite journal | doi = 10.1126/science.252.5009.1171 | author = Connolly, T., et al. | title = Requirement of GTP hydrolysis for dissociation of the signal recognition particle from its receptor | journal = Science | volume = 252 | issue = 5009 | pages = 1171–1173 | year = 1991 | pmid=1851576 }}</ref> |
|
'''5'-Guanylyl imidodiphosphate''' ('''GDPNP''') is a ] ]. It is an analog of ] in which one of the oxygen atoms is replaced with an ], producing a ] ]. Guanylyl imidodiphosphate binds tightly to ]s in the presence of Mg<sup>2+</sup>.<ref name="PubChem"> at ]</ref> Guanylyl imidodiphosphate is a potent stimulator of ].<ref name="PubChem"/> It is often used in studies of protein synthesis.<ref>{{cite book | author = Miller, J.D. | author2 = Walter, P. | chapter = A GTPase Cycle in Initiation of Protein Translocation Across the Endoplasmic Reticulum Membrane | name-list-style = amp | title = Ciba Foundation Symposium 176 - the GTPase Superfamily | journal = Ciba Foundation Symposium | series = Novartis Foundation Symposia | volume = 176 | pages = 147–163 | year = 1993 | doi = 10.1002/9780470514450.ch10 | pmid = 8299417 | isbn = 9780470514450 }}</ref><ref>{{cite journal | doi = 10.1126/science.252.5009.1171 | author = Connolly, T. | title = Requirement of GTP hydrolysis for dissociation of the signal recognition particle from its receptor | journal = Science | volume = 252 | issue = 5009 | pages = 1171–1173 | year = 1991 | pmid=1851576 | bibcode = 1991Sci...252.1171C | s2cid = 42899156 |display-authors=etal}}</ref> |
|
|
|
|
|
==References== |
|
==References== |