| Revision as of 15:51, 7 March 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL. |
Latest revision as of 11:20, 9 November 2024 edit Graeme Bartlett (talk | contribs)Administrators249,442 edits added Category:Diethylamino compounds using HotCat |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
| ⚫ |
{{drugbox | verifiedrevid = 400840595 |
|
|
|
{{Drugbox |
|
| |
|
|
|
| Watchedfields = changed |
| ⚫ |
| image = PROLAD.svg |
|
|
⚫ |
| verifiedrevid = 417615822 |
| ⚫ |
| width = 150 |
|
|
| IUPAC_name = (8β)- ''N,N''- diethyl- 6-propyl- 9,10- didehydroergoline- 8- carboxamide |
|
| IUPAC_name = (6a''R'',9''R'')-''N'',''N''-Diethyl-7-propan-2-yl-6,6a,8,9-tetrahydro-4''H''-indoloquinoline-9-carboxamide |
|
⚫ |
| image = IP-LAD.png |
| ⚫ |
| C=22 | H=29 | N=3 | O=1 |
|
|
⚫ |
| width = 170 |
| ⚫ |
| molecular_weight = 351.50 g/mol |
|
|
|
|
|
| synonyms = <small>PRO-LAD,<br/>6-propyl- 6-nor- Lysergic acid diethylamide,<br/> (6a''R'',9''R'')- ''N,N''- diethyl- 7-propyl- 4,6,6a,7,8,9- hexahydroindolo- quinoline- 9- carboxamide</small> |
|
|
|
<!--Clinical data--> |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| tradename = |
| ⚫ |
| ChemSpiderID = 21106361 |
|
|
⚫ |
| legal_AU = |
| ⚫ |
| InChI = 1/C22H29N3O/c1-4-10-25-14-16(22(26)24(5-2)6-3)11-18-17-8-7-9-19-21(17)15(13-23-19)12-20(18)25/h7-9,11,13,16,20,23H,4-6,10,12,14H2,1-3H3/t16-,20-/m1/s1 |
|
|
⚫ |
| legal_CA = |
|
| InChIKey = HZKYLVLOBYNKKM-OXQOHEQNBI |
|
|
|
| legal_DE = NpSG |
| ⚫ |
| smiles = CCN(CC)C(=O)2/C=C1/c3cccc4ncc(C1N(C2)CCC)c34 |
|
|
| ChEMBL = 22258 |
|
| legal_UK = Class A |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C22H29N3O/c1-4-10-25-14-16(22(26)24(5-2)6-3)11-18-17-8-7-9-19-21(17)15(13-23-19)12-20(18)25/h7-9,11,13,16,20,23H,4-6,10,12,14H2,1-3H3/t16-,20-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| ⚫ |
| StdInChIKey = HZKYLVLOBYNKKM-OXQOHEQNSA-N |
|
| ⚫ |
| CAS_number = 65527-63-1 |
|
| ⚫ |
| PubChem = 44457803 |
|
|
| metabolism = hepatic |
|
|
| excretion = renal |
|
| ⚫ |
| legal_AU = |
|
| ⚫ |
| legal_CA = |
|
|
| legal_UK = |
|
|
| legal_US = |
|
| legal_US = |
|
⚫ |
| routes_of_administration = ] |
|
| legal_status = Controlled in the ] via the ] but only if it is intended for human consumption. |
|
| ⚫ |
| routes_of_administration = ]}} |
|
|
|
|
|
|
|
<!--Identifiers--> |
| ⚫ |
'''PRO-LAD''' is an analogue of ]. It is described by ] in the book ]. PRO-LAD is a hallucinogenic drug similar to LSD, and is around as potent as LSD itself with an active dose reported at between 100 and 200 micrograms.<ref name="pmid4032428">{{cite journal |author=Hoffman AJ, Nichols DE |title=Synthesis and LSD-like discriminative stimulus properties in a series of N(6)-alkyl norlysergic acid N,N-diethylamide derivatives |journal=Journal of Medicinal Chemistry |volume=28 |issue=9 |pages=1252–5 |year=1985 |month=September |pmid=4032428 |doi= |url=}}</ref> |
|
|
⚫ |
| CAS_number = |
|
|
| UNII = |
|
⚫ |
| PubChem = 44458092 |
|
⚫ |
| ChemSpiderID = 23120596 |
|
|
| ChEMBL = 22893 |
|
|
|
|
|
|
<!--Chemical data--> |
|
PRO-LAD has been sold by some ] suppliers but might be considered illegal in some countries due to its structural similarity to LSD. |
|
|
⚫ |
| C=22 | H=29 | N=3 | O=1 |
|
⚫ |
| molecular_weight = |
|
⚫ |
| smiles = CCN(CC)C(=O)1CN(2CC3=CNC4=CC=CC(=C34)C2=C1)C(C)C |
|
⚫ |
| StdInChI = 1S/C22H29N3O/c1-5-24(6-2)22(26)16-10-18-17-8-7-9-19-21(17)15(12-23-19)11-20(18)25(13-16)14(3)4/h7-10,12,14,16,20,23H,5-6,11,13H2,1-4H3/t16-,20-/m1/s1 |
|
⚫ |
| StdInChIKey = GLNOSFGSNDKLOC-OXQOHEQNSA-N |
|
|
}} |
|
|
|
|
|
⚫ |
'''6-Isopropyl-6-nor-lysergic acid diethylamide''' ('''IP-LAD''') is an ] of ] (LSD) developed by the team of ]. In studies on mice, it was found to be approximately 40% the potency of LSD, compared to the 60% increase in potency seen with ], 2-fold potency increase of ], and roughly equivalent potency of ].<ref>{{cite journal | vauthors = Hoffman AJ, Nichols DE | title = Synthesis and LSD-like discriminative stimulus properties in a series of N(6)-alkyl norlysergic acid N,N-diethylamide derivatives | journal = Journal of Medicinal Chemistry | volume = 28 | issue = 9 | pages = 1252–1255 | date = September 1985 | pmid = 4032428 | doi = 10.1021/jm00147a022 }}</ref> |
| ⚫ |
==References== |
|
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
{{Hallucinogens}} |
|
==External links== |
|
|
|
{{Serotonin receptor modulators}} |
|
* |
|
|
|
{{Ergolines}} |
|
* |
|
|
|
|
|
{{TiHKAL}} |
|
|
{{Hallucinogenic lysergamides}} |
|
|
|
|
|
|
|
{{DEFAULTSORT:Isopropyl-6-nor-lysergic acid diethylamide, 6-}} |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{hallucinogen-stub}} |
|
{{hallucinogen-stub}} |
|
|
|
|
] |
|