| Revision as of 18:39, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455001791 of page 6-Phosphogluconic_acid for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 07:01, 11 May 2024 edit Spacemarine10 (talk | contribs)Extended confirmed users854 editsNo edit summary |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443664395 |
|
| verifiedrevid = 477226209 |
|
| ImageFile = 6-phosphogluconate.svg |
|
| ImageFile = 6-phosphogluconate.svg |
|
| ImageSize = |
|
| ImageSize = 230 |
|
|
| ImageAlt = Skeletal formula of 6-phosphogluconic acid |
|
| IUPACName = |
|
|
|
| ImageFile1 = 6-Phosphogluconic-acid-anion-3D-spacefill.png |
|
|
| ImageSize1 = 220 |
|
|
| ImageAlt1 = Space-filling model of the 6-phosphogluconic acid anion |
|
|
| IUPACName = 6-''O''-Phosphono-<small>D</small>-gluconic acid |
|
|
| SystematicName = (2''R'',3''S'',4''R'',5''R'')-2,3,4,5-Tetrahydroxy-6-(phosphonooxy)hexanoic acid |
|
| OtherNames = 6-Phosphogluconate |
|
| OtherNames = 6-Phosphogluconate |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| InChI = 1/C6H13O10P/c7-2(1-16-17(13,14)15)3(8)4(9)5(10)6(11)12/h2-5,7-10H,1H2,(H,11,12)(H2,13,14,15)/t2-,3-,4+,5-/m1/s1 |
|
| InChI = 1/C6H13O10P/c7-2(1-16-17(13,14)15)3(8)4(9)5(10)6(11)12/h2-5,7-10H,1H2,(H,11,12)(H2,13,14,15)/t2-,3-,4+,5-/m1/s1 |
|
| InChIKey = BIRSGZKFKXLSJQ-SQOUGZDYBT |
|
| InChIKey = BIRSGZKFKXLSJQ-SQOUGZDYBT |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 13: |
Line 18: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = BIRSGZKFKXLSJQ-SQOUGZDYSA-N |
|
| StdInChIKey = BIRSGZKFKXLSJQ-SQOUGZDYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 921-62-0 --> |
|
|
| PubChem = 422 |
|
| CASNo = 921-62-0 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = W31WK7B8U0 |
|
|
| PubChem = 422 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 48928 |
|
| ChEBI = 48928 |
|
| SMILES = O=P(O)(O)OC(O)(O)(O)(O)C(=O)O |
|
| SMILES = O=P(O)(O)OC(O)(O)(O)(O)C(=O)O |
|
| MeSHName = 6-phosphogluconate |
|
| MeSHName = 6-phosphogluconate |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 82615 |
|
| ChemSpiderID = 82615 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>6</sub>H<sub>13</sub>O<sub>10</sub>P |
|
| Formula = C<sub>6</sub>H<sub>13</sub>O<sub>10</sub>P |
|
| MolarMass = 276.135 g/mol |
|
| MolarMass = 276.135 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| Solubility = |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| AutoignitionPt = |
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''6-Phosphogluconic acid''' (with conjugate base '''6-phosphogluconate''') is a ] ] which appears in the ] and the ]. |
|
|
|
|
|
During the oxidative phase of the pentose phosphate pathway, it is formed from ] by ], and in turn, it is converted to ] by ], in an oxidative ] which also produces ]. |
|
|
|
|
|
In those microorganisms which host the Entner-Doudoroff pathway, 6-phosphogluconic acid may also be acted upon by 6-] to produce 2-keto-3-deoxy-6-phosphogluconate. |
|
|
|
|
|
{{Pentose phosphate pathway intermediates}} |
|
|
|
|
|
{{DEFAULTSORT:Phosphogluconic acid, 6-}} |
|
|
] |
|
|
|
|
|
{{biochem-stub}} |