| Revision as of 18:39, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443358004 of page 7,8-Dihydroneopterin_triphosphate for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 18:21, 2 March 2024 edit Mazewaxie (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers113,591 editsm WP:GENFIXESTag: AWB |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443356640 |
|
| verifiedrevid = 477226319 |
|
| ImageFile = 7,8-Dihydroneopterin triphosphate.png |
|
| ImageFile = 7,8-Dihydroneopterin triphosphate.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
|
| PIN = (2''R'',3''S'')-3-(2-Amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)-2,3-dihydroxypropyl tetrahydrogen triphosphate |
|
| IUPACName = |
|
|
| OtherNames = DHNTP |
|
| OtherNames = DHNTP |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 108735 |
|
| ChemSpiderID = 108735 |
| Line 16: |
Line 16: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = DGGUVLXVLHAAGT-XINAWCOVSA-N |
|
| StdInChIKey = DGGUVLXVLHAAGT-XINAWCOVSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 17088-65-2 --> |
|
|
| PubChem = |
|
| CASNo = 17088-65-2 |
|
|
| PubChem = 121885 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 18372 |
|
| ChEBI = 18372 |
|
|
| KEGG = C04895 |
|
| SMILES = O=C1C2=C(NCC(((COP(OP(OP(O)(O)=O)(O)=O)(O)=O)O)O)=N2)NC(N)=N1}} |
|
| SMILES = O=C1C2=C(NCC(((COP(OP(OP(O)(O)=O)(O)=O)(O)=O)O)O)=N2)NC(N)=N1}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=9 | H=16 | N=5 | O=13 | P=3 |
|
| C=9 | H=16 | N=5 | O=13 | P=3 |
|
| Appearance = |
|
| Appearance = |
| Line 28: |
Line 30: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''7,8-Dihydroneopterin triphosphate''' ('''DHNTP''') is an intermediate in ] ]. It is transformed by ] into 6-pyruvoyl-tetrahydropterin.<ref>{{cite web|url=http://ghr.nlm.nih.gov/gene/PTS|title=PTS gene|author=Genetics Home Reference|website=Genetics Home Reference|access-date=3 May 2018}}</ref> It is also used in the Queuosine/Archeosine Pathway.{{citation needed|date=May 2023}} |
|
|
|
|
|
== Synonyms == |
|
|
*Dihydroneopterin Triphosphate<ref>{{cite web|url=http://www.chemdrug.com/databases/10_1_pbosvwvgpobtpfdn.html|title=dihydroneopterin triphosphate ,CHEBI:18372,7,8-dihydroneopterin 3'-化学物质数据库|website=www.chemdrug.com|access-date=3 May 2018}}</ref> |
|
|
*7,8-dihydroneopterin 3'-triphosphate |
|
|
*6-(L-erythro-1,2-Dihydroxypropyl 3-triphosphate)-7,8-dihydropterin |
|
|
*6--7,8-dihydropterin |
|
|
*6-(L-erythro-1,2-dihydroxy-3-triphosphooxypropyl)-7,8-dihydropterin |
|
|
*2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine triphosphate |
|
|
*2-Amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridinetriphosphate |
|
|
*(2R,3S)-3-(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)-2,3-dihydroxypropyl tetrahydrogen triphosphate |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Dihydroneopterin triphosphate, 7, 8-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |