(Difference between pages)

Page 1

Page 1Revision 1

Page 2

Page 2Revision 2

Content deleted Content addedVisualWikitext

Revision as of 18:40, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456563010 of page 7-ACA for the Chem/Drugbox validation project (updated: 'ChEMBL', 'ChEBI', 'KEGG').		Latest revision as of 15:18, 30 August 2024 edit MangeshDK (talk | contribs)4 editsm Added information source to newly added information
Line 1:		Line 1:
	{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{Chembox		{{Chembox
	| Verifiedfields = changed		| Verifiedfields = changed
	| Watchedfields = changed		| Watchedfields = changed
	| verifiedrevid = 456507014		| verifiedrevid = 477226392
	| Name = 7-Aminocephalosporanic acid		| Name = 7-Aminocephalosporanic acid
	| ImageFile = 7-aminocephalosporanic acid.svg		| ImageFile = 7-ACA.svg
	| ImageFile_Ref = {{chemboximage|correct|??}}		| ImageFile_Ref = {{chemboximage|correct|??}}
	| ImageSize = 244		| ImageSize = 244
	| ImageName = Partially condensed, stereo, skeletal formula of 7-aminocephalosporanic acid ((6R,7R)-7-amino,-oct-2-ene)		| ImageName = Partially condensed, stereo, skeletal formula of 7-aminocephalosporanic acid
			| ImageFile2 = 7-ACA-3D-balls.png
⚫	| IUPACName = 3-(Acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclooct-2-ene-2-carboxylic acid{{Citation needed|date = June 2011}}
			| IUPACName = 3--7β-amino-3,4-didehydrocepham-4-carboxylic acid
		⚫	| SystematicName = (6''R'',7''R'')-3--7-amino-8-oxo-5-thia-1-azabicyclooct-2-ene-2-carboxylic acid
	| OtherNames = 7-Aminocephalosporinic acid		| OtherNames = 7-Aminocephalosporinic acid
	| Section1 = {{Chembox Identifiers		|Section1={{Chembox Identifiers
	| Abbreviations = 7-ACA		| Abbreviations = 7-ACA
	| CASNo = 957-68-6		| CASNo = 957-68-6
	| CASNo_Ref = {{cascite|correct|CAS}}		| CASNo_Ref = {{cascite|correct|CAS}}
			| UNII_Ref = {{fdacite|correct|FDA}}
	| PubChem = 483168
			| UNII = 9XI67897RG
	| PubChem_Ref = {{Pubchemcite|correct|pubchem}}
	| ChemSpiderID = 390087		| PubChem = 483168
			| ChemSpiderID = 390087
	| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}		| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
	| EINECS = 213-485-0		| EINECS = 213-485-0
	| KEGG = <!-- blanked - oldvalue: C07756 -->
			| KEGG = C07756
	| KEGG_Ref = {{keggcite|changed|kegg}}		| KEGG_Ref = {{keggcite|correct|kegg}}
	| MeSHName = 7-Aminocephalosporanic+acid		| MeSHName = 7-Aminocephalosporanic+acid
	| ChEBI_Ref = {{ebicite|changed|EBI}}		| ChEBI_Ref = {{ebicite|correct|EBI}}
	| ChEBI = 58501		| ChEBI = 2255
	| ChEMBL = <!-- blanked - oldvalue: 1161449 -->
			| ChEMBL = 1161449
	| ChEMBL_Ref = {{ebicite|changed|EBI}}		| ChEMBL_Ref = {{ebicite|correct|EBI}}
	| Beilstein = 622637, 8919572		| Beilstein = 622637, 8919572
	| 3DMet = B02139		| 3DMet = B02205
	| SMILES = O=C2N1/C(=C(\CS12N)COC(=O)C)C(=O)O		| SMILES = O=C2N1/C(=C(\CS12N)COC(=O)C)C(=O)O
	| StdInChI = 1S/C10H12N2O5S/c1-4(13)17-2-5-3-18-9-6(11)8(14)12(9)7(5)10(15)16/h6,9H,2-3,11H2,1H3,(H,15,16)/t6-,9-/m1/s1		| StdInChI = 1S/C10H12N2O5S/c1-4(13)17-2-5-3-18-9-6(11)8(14)12(9)7(5)10(15)16/h6,9H,2-3,11H2,1H3,(H,15,16)/t6-,9-/m1/s1
	| StdInChI_Ref = {{stdinchicite|correct|chemspider}}		| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
	| StdInChIKey = HSHGZXNAXBPPDL-HZGVNTEJSA-N		| StdInChIKey = HSHGZXNAXBPPDL-HZGVNTEJSA-N
	| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}		| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
	}}		}}
	| Section2 = {{Chembox Properties		|Section2={{Chembox Properties
	| C=10|H=12|N=2|S=1|O=5		| C=10 | H=12 | N=2 | S=1 | O=5
		⚫	| MeltingPtC = 300
	| ExactMass = 272.046692194 g mol<sup>-1</sup>
		⚫	| MeltingPt_ref = <ref name=chemblink></ref>
⚫	| MeltingPtC = 300
		⚫	| LogP = -1.87
⚫	| Melting_notes = <ref name=chemblink></ref>
	| LogP = -1.87		| pKa = 2.59
	| pKa = 2.59		| pKb = 11.41
⚫	| pKb = 11.41
	}}		}}
	| Section3 = {{Chembox Hazards		|Section3={{Chembox Hazards
	| GHSPictograms = {{GHS health hazard}}		| GHSPictograms = {{GHS health hazard}}
	| GHSSignalWord = Danger		| GHSSignalWord = Danger
	| HPhrases = {{H-phrases|317|334}}		| HPhrases = {{H-phrases|317|334}}
	| PPhrases = {{P-phrases|261|280|342+311}}		| PPhrases = {{P-phrases|261|280|342+311}}
	| EUClass = {{Hazchem Xn}}
	| RPhrases = {{R42/43}}<ref name=chemblink/>
	| SPhrases = {{S22}} {{S36/37}}<ref name=chemblink/>
	}}		}}
	}}		}}
			'''7-ACA''' ('''7-aminocephalosporanic acid''') is the core chemical structure (a ]) for the synthesis of ] ]s and intermediates. It can be obtained by ] ] of ].<ref>{{cite journal | journal = World Journal of Microbiology & Biotechnology | volume = 26 | issue = 1 | pages = 145–152 | year = 2010 | doi = 10.1007/s11274-009-0153-9 | title = Single-pot conversion of cephalosporin C to 7-aminocephalosporanic acid in the absence of hydrogen peroxide | last1 = Tan | first1 = Qiang | last2 = Zhang | first2 = Yewang | last3 = Song | first3 = Qingxun | last4 = Wei | first4 = Dongzhi| s2cid = 84749385 }}</ref><ref>{{cite journal | journal = Enzyme and Microbial Technology | volume = 39 | issue = 5 | pages = 1166–1172 | year = 2006 | doi = 10.1016/j.enzmictec.2006.02.028 | title = Single-pot conversion of cephalosporin C to 7-aminocephalosporanic acid using cell-bound and support-bound enzymes | last1 = Tan | first1 = Qiang | last2 = Song | first2 = Qingxun | last3 = Wei | first3 = Dongzhi}}</ref>
			The production of '''7-ACA (7-aminocephalosporanic acid''') is predominantly segmented into two methods which is ] and Chemical ]. These processes are essential for the synthesis of various ] antibiotics.<ref>{{cite web |title=7-Aminocephalosporanic Acid (7-ACA) Market |url=https://marketsglob.com/report/7-aminocephalosporanic-acid-7-aca-market/9298/ |website=Markets Glob Market Research |access-date=30 August 2024}}</ref>
			==See also==
			* ]
			== References ==
			{{reflist}}
			{{Organic-compound-stub}}
			]
			]
			]