| Revision as of 18:40, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 404018252 of page 7-Dehydrositosterol for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 22:35, 27 April 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits correct semisystematic name |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 399342192 |
|
| verifiedrevid = 477226560 |
|
| ImageFile = 7-dehydrositosterol.png |
|
| ImageFile = 7-dehydrositosterol.png |
|
| ImageSize = |
|
| ImageSize = 220 |
|
|
| ImageFile1 = 7-Dehydrositosterol molecule ball.png |
| ⚫ |
| IUPACName = (3β)-Stigmasta-5,7-dien-3-ol |
|
|
|
| ImageSize1 = 250 |
|
|
| ImageAlt1 = Ball-and-stick model of 7-dehydroepisterol |
|
⚫ |
| IUPACName = Stigmasta-5,7-dien-3β-ol |
|
|
| SystematicName = (1''R'',3a''R'',7''S'',9a''R'',9b''S'',11a''R'')-1--9a,11a-dimethyl-2,3,3a,6,7,8,9,9a,9b,10,11,11a-dodecahydro-1''H''-cyclopentaphenanthren-7-ol |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4446728 |
|
| ChemSpiderID = 4446728 |
|
| InChI = 1/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10-11,19-21,23,25-27,30H,7-9,12-18H2,1-6H3/t20-,21-,23+,25-,26+,27+,28+,29-/m1/s1 |
|
|
| InChIKey = ARVGMISWLZPBCH-XHVHEOSNBI |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10-11,19-21,23,25-27,30H,7-9,12-18H2,1-6H3/t20-,21-,23+,25-,26+,27+,28+,29-/m1/s1 |
|
| StdInChI = 1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10-11,19-21,23,25-27,30H,7-9,12-18H2,1-6H3/t20-,21-,23+,25-,26+,27+,28+,29-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ARVGMISWLZPBCH-XHVHEOSNSA-N |
|
| StdInChIKey = ARVGMISWLZPBCH-XHVHEOSNSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 521-04-0 --> |
|
|
| PubChem = 101740 |
|
| CASNo = 521-04-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = O4C/C3=C/C=C1\(CC2(1CC2(C)CC(CC)C(C)C)C)3(C)CC4 |
|
|
|
| UNII = A6478ODO9X |
| ⚫ |
}} |
|
|
|
| PubChem = 101740 |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
⚫ |
| SMILES = O4C/C3=C/C=C1\(CC2(1CC2(C)CC(CC)C(C)C)C)3(C)CC4 |
| ⚫ |
| Formula = C<sub>29</sub>H<sub>48</sub>O |
|
|
⚫ |
}} |
|
| MolarMass = 412.691 |
|
|
⚫ |
|Section2={{Chembox Properties |
|
| Appearance = |
|
|
⚫ |
| Formula = C<sub>29</sub>H<sub>48</sub>O |
| ⚫ |
| Density = |
|
|
| MeltingPt = |
|
| MolarMass = 412.691 |
|
| BoilingPt = |
|
| Appearance = |
|
⚫ |
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| Solubility = |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| AutoignitionPt = |
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''7-Dehydrositosterol''' is a ] which serves as a precursor for ] (]). |
|
|
|
|
|
==External links== |
|
|
* {{MeshName|7-dehydrositosterol}} |
|
|
|
|
|
{{DEFAULTSORT:Dehydrositosterol, 7-}} |
|
|
] |
|
|
] |
|
|
|
|
|
{{biochemistry-stub}} |