| Revision as of 10:40, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464810689 of page 7-Methylguanosine for the Chem/Drugbox validation project (updated: 'ChEBI', 'CASNo'). |
Latest revision as of 22:47, 27 April 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 477346139 |
|
| ImageFile = 7-Methylguanosine.svg |
|
| ImageFile = 7-Methylguanosine.svg |
|
| ImageSize = 180px |
|
| ImageSize = 180px |
|
| IUPACName = 7-Methylguanosine |
|
| ImageFile1 = 7-Methylguanosine ball-and-stick.png |
|
|
| ImageSize1 = 180px |
|
|
| IUPACName = 7-Methylguanosin-7-ium |
|
|
| SystematicName = 2-Amino-9--7-methyl-6-oxo-6,9-dihydro-1''H''-purin-7-ium |
|
| OtherNames = N7-Methylguanosine; 2-Amino-1,6-dihydro-7-methyl-6-oxo-9-β-<small>D</small>-ribofuranosylpurinium |
|
| OtherNames = N7-Methylguanosine; 2-Amino-1,6-dihydro-7-methyl-6-oxo-9-β-<small>D</small>-ribofuranosylpurinium |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| Abbreviations = m7G; m<sup>7</sup>G |
|
| Abbreviations = m7G; m<sup>7</sup>G |
|
| CASNo = <!-- blanked - oldvalue: 20244-86-4 --> |
|
| CASNo = 20244-86-4 |
|
| CASNo_Ref = {{cascite|correct|}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| ChEBI = 20794 |
|
|
|
| UNII = 5290OM2I6G |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEBI = 20794 |
|
| PubChem = 445404 |
|
| PubChem = 445404 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 393054 |
|
| ChemSpiderID = 393054 |
|
| SMILES = O=C3/N=C(/N)Nc1c3n(c12O((O)2O)CO)C |
|
| SMILES = O=C3/N=C(/N)Nc1c3n(c12O((O)2O)CO)C |
|
| InChI = 1/C11H15N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,20)/p+1/t4-,6-,7-,10-/m1/s1 |
|
| InChI = 1/C11H15N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,20)/p+1/t4-,6-,7-,10-/m1/s1 |
|
| InChIKey = OGHAROSJZRTIOK-UJMNIJGGBX |
|
| InChIKey = OGHAROSJZRTIOK-UJMNIJGGBX |
| ⚫ |
| StdInChI = 1S/C11H15N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,20)/p+1/t4-,6-,7-,10-/m1/s1 |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| StdInChIKey = OGHAROSJZRTIOK-KQYNXXCUSA-O |
|
|
⚫ |
| StdInChI = 1S/C11H15N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,20)/p+1/t4-,6-,7-,10-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = OGHAROSJZRTIOK-KQYNXXCUSA-O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=11|H=16|N=5|O=5 |
|
| C=11 | H=16 | N=5 | O=5 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''7-Methylguanosine''' ('''m<sup>7</sup>G''') is a modified ] ]. It is a ] version of ] and when found in human urine, it may be a ] of some types of cancer. In the ]s, 7-methylguanosine have been used to study and examine the reaction evolving methylguanosine. It also plays a role in ] as a blocking group at its ].<ref>{{cite journal | pmid = 1739950 | year = 1992 | last1 = Reynaud | first1 = C | last2 = Bruno | first2 = C | last3 = Boullanger | first3 = P | last4 = Grange | first4 = J | last5 = Barbesti | first5 = S | last6 = Niveleau | first6 = A | title = Monitoring of urinary excretion of modified nucleosides in cancer patients using a set of six monoclonal antibodies | volume = 61 | issue = 3 | pages = 255–62 | journal = Cancer Letters | doi=10.1016/0304-3835(92)90296-8}}</ref> |
|
|
|
|
|
==See also== |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
* , Human Metabolome Database, University of Alberta |
|
|
|
|
|
{{DEFAULTSORT:Methylguanosine, 7-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |