Revision as of 15:13, 6 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEBI').← Previous edit |
Latest revision as of 22:18, 18 August 2023 edit undoOAbot (talk | contribs)Bots439,234 editsm Open access bot: doi updated in citation with #oabot. |
(28 intermediate revisions by 21 users not shown) |
Line 1: |
Line 1: |
|
{{orphan|date=December 2008}} |
|
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 413286090 |
|
| verifiedrevid = 443656014 |
|
|ImageFile=Phenylperi acid.png |
|
| ImageFile=Phenylperi acid.png |
|
|ImageSize=200px |
|
| ImageSize=200px |
|
|IUPACName=8-(phenylamino)-1-naphthalenesulfonic acid |
|
| PIN = 8-Anilinonaphthalene-1-sulfonic acid |
|
|OtherNames=Phenylperi acid |
|
| OtherNames = 8-(Phenylamino)naphthalene-1-sulfonic acid |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C11326 |
|
| KEGG = C11326 |
|
| InChI = 1/C16H13NO3S/c18-21(19,20)15-11-5-7-12-6-4-10-14(16(12)15)17-13-8-2-1-3-9-13/h1-11,17H,(H,18,19,20) |
|
| InChI = 1/C16H13NO3S/c18-21(19,20)15-11-5-7-12-6-4-10-14(16(12)15)17-13-8-2-1-3-9-13/h1-11,17H,(H,18,19,20) |
Line 19: |
Line 18: |
|
| StdInChIKey = FWEOQOXTVHGIFQ-UHFFFAOYSA-N |
|
| StdInChIKey = FWEOQOXTVHGIFQ-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=82-76-8 |
|
| CASNo=82-76-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| PubChem=1369 |
|
|
|
| UNII = 630I4V6051 |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| PubChem=1369 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 1328 |
|
| ChemSpiderID = 1328 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 39708 |
|
| ChEBI = 39708 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB04474 |
|
| SMILES = O=S(=O)(O)c2c1c(cccc1ccc2)Nc3ccccc3 |
|
| SMILES = O=S(=O)(O)c2c1c(cccc1ccc2)Nc3ccccc3 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C = 16 | H = 13 | N = 1 | O = 3 | S = 1 |
|
| C=16 | H=13 | N=1 | O=3 | S=1 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''8-Anilinonaphthalene-1-sulfonate''' ('''ANS''') is used as a fluorescent molecular probe.<ref>{{cite journal | doi = 10.1046/j.1432-1327.1999.00290.x | title = Fluorescence measurements detect changes in scallop myosin regulatory domain | year = 1999 | author = Andras Malnasi-Csizmadia; György Hegyi; Ferenc Tölgyesi; Andrew G. Szent-Györgyi; and László Nyitray | journal = European Journal of Biochemistry | volume = 261 | pages = 452 | pmid = 10215856 | issue = 2 }}</ref> Its permeability to ] membranes makes it particularly useful.<ref>{{cite journal |author=Gains N, Dawson AP |title=8-Anilinonaphthalene-1-sulphonate interaction with whole and disrupted mitochondria: a re-evaluation of the use of double-reciprocal plots in the derivation of binding parameters for fluorescent probes binding to mitochondrial membranes |journal=Biochem. J. |volume=148 |issue=1 |pages=157–60 |year=1975 |month=April |pmid=1156395 |pmc=1165518 |doi= |url=}}</ref> |
|
'''8-Anilinonaphthalene-1-sulfonic acid''' ('''ANS'''), also called 1-anilino-8-naphthalenesulfonate, is an ] containing both a ] and an ] group. This compound is used as a ] ].<ref>{{cite journal | doi = 10.1046/j.1432-1327.1999.00290.x | title = Fluorescence measurements detect changes in scallop myosin regulatory domain | date = 1999 | author = Andras Malnasi-Csizmadia | author2 = György Hegyi | author3 = Ferenc Tölgyesi | author4 = Andrew G. Szent-Györgyi | author5 = László Nyitray | name-list-style = amp | journal = European Journal of Biochemistry | volume = 261 | pages = 452–8 | pmid = 10215856 | issue = 2 | doi-access = }}</ref> For example, ANS can be used to study conformational changes induced by ] binding in ], as ANS's fluorescent properties will change as it binds to ] regions on the protein surface. Comparison of the fluorescence in the presence and absence of a particular ligand can thus give information about how the binding of the ligand changes the surface of the protein. Its permeability to ] membranes makes it particularly useful.<ref>{{cite journal |author=Gains N |author2=Dawson AP |title=8-Anilinonaphthalene-1-sulphonate interaction with whole and disrupted mitochondria: a re-evaluation of the use of double-reciprocal plots in the derivation of binding parameters for fluorescent probes binding to mitochondrial membranes |journal=Biochem. J. |volume=148 |issue=1 |pages=157–60 |date=April 1975 |doi=10.1042/bj1480157 |pmid=1156395 |pmc=1165518 }}</ref> |
|
|
|
|
|
== References == |
|
== References == |
Line 47: |
Line 51: |
|
|
|
|
|
{{DEFAULTSORT:Anilinonaphthalene-1-sulfonate, 8-}} |
|
{{DEFAULTSORT:Anilinonaphthalene-1-sulfonate, 8-}} |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|