| Revision as of 12:51, 11 February 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pharmacology|errors← Previous edit |
Latest revision as of 10:41, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Phenols; added Category:Hydroxyarenes using HotCat |
| (19 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
| ⚫ |
{{Drugbox| verifiedrevid = 413288615 |
|
|
|
{{Drugbox |
|
| |
|
|
⚫ |
| verifiedrevid = 477236127 |
|
|IUPAC_name = (6aR,10aR)-3-(1-hexylcyclopropyl)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzochromen-1-ol |
|
| IUPAC_name = (6aR,10aR)-3-(1-hexylcyclopropyl)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzochromen-1-ol |
|
| image = AMG-41.svg |
|
| image = AMG-41.svg |
|
| width= 240 |
|
| width = 240 |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 499237-35-3 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 3062P60MH9 |
|
⚫ |
| PubChem = 10361702 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 8537151 |
|
| ChemSpiderID = 8537151 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 19847 |
|
| ChEMBL = 19847 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=25 | H=36 | O=2 |
|
⚫ |
| smiles = C=3CC2C(C)(C)Oc(cc(cc1O)C4(CC4)CCCCCC)c1C2CC=3C |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C25H36O2/c1-5-6-7-8-11-25(12-13-25)18-15-21(26)23-19-14-17(2)9-10-20(19)24(3,4)27-22(23)16-18/h9,15-16,19-20,26H,5-8,10-14H2,1-4H3/t19-,20-/m1/s1 |
|
| StdInChI = 1S/C25H36O2/c1-5-6-7-8-11-25(12-13-25)18-15-21(26)23-19-14-17(2)9-10-20(19)24(3,4)27-22(23)16-18/h9,15-16,19-20,26H,5-8,10-14H2,1-4H3/t19-,20-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UVQIBKXDOZWHFU-WOJBJXKFSA-N |
|
| StdInChIKey = UVQIBKXDOZWHFU-WOJBJXKFSA-N |
|
| smiles1 = Oc2cc(cc1OC(3C/C=C(\C3c12)C)(C)C)C4(CCCCCC)CC4 |
|
| ⚫ |
| CAS_number= |
|
|
| ATC_prefix= |
|
|
| ATC_suffix= |
|
| ⚫ |
| PubChem= 10361702 |
|
|
| DrugBank= |
|
| ⚫ |
| C=25 | H=36 | O=2 |
|
|
| molecular_weight = 368.551 g/mol |
|
| ⚫ |
| smiles = C=3CC2C(C)(C)Oc(cc(cc1O)C4(CC4)CCCCCC)c1C2CC=3C |
|
|
| bioavailability= |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life= |
|
| ⚫ |
| excretion = |
|
|
| pregnancy_category = |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration= |
|
|
}} |
|
}} |
|
|
|
|
|
'''AMG-41''' is an ] drug which is a ] ]. It is a derivative of Δ8] substituted with a ] group on the 3-position side chain. AMG-41 is a potent agonist at both ] and ], with a ] of 0.4nM at CB<sub>1</sub> vs 0.9nM at CB<sub>2</sub>.<ref>Papahatjis DP, Nikas SP, Andreou T, Makriyannis A. Novel 1',1'-chain substituted Delta(8)-tetrahydrocannabinols. ''Bioorganic and Medicinal Chemistry Letters''. 2002 Dec 16;12(24):3583-6. PMID 12443781</ref><ref>Papahatjis DP, Nikas SP, Kourouli T, Chari R, Xu W, Pertwee RG, Makriyannis A. Pharmacophoric requirements for the cannabinoid side chain. Probing the cannabinoid receptor subsite at C1'. ''Journal of Medicinal Chemistry''. 2003 Jul 17;46(15):3221-9. PMID 12852753</ref><ref>Papahatjis DP, Nahmias VR, Nikas SP, Andreou T, Alapafuja SO, Tsotinis A, Guo J, Fan P, Makriyannis A. C1'-cycloalkyl side chain pharmacophore in tetrahydrocannabinols. ''Journal of Medicinal Chemistry''. 2007 Aug 23;50(17):4048-60. PMID 17672444</ref> |
|
'''AMG-41''' (part of the ]) is an ] drug which is a ] ]. It is a derivative of Δ<sup>8</sup>-] substituted with a ] on the C1'-position of the C3-alkyl side chain. AMG-41 is a potent agonist at both ] and ], with a ] of 0.44 nM at CB<sub>1</sub> vs 0.86 nM at CB<sub>2</sub>.<ref>{{cite journal | vauthors = Papahatjis DP, Nikas SP, Andreou T, Makriyannis A | title = Novel 1',1'-chain substituted Delta(8)-tetrahydrocannabinols | journal = Bioorganic & Medicinal Chemistry Letters | volume = 12 | issue = 24 | pages = 3583–6 | date = December 2002 | pmid = 12443781 | doi = 10.1016/s0960-894x(02)00785-0 }}</ref><ref>{{cite journal | vauthors = Papahatjis DP, Nikas SP, Kourouli T, Chari R, Xu W, Pertwee RG, Makriyannis A | title = Pharmacophoric requirements for the cannabinoid side chain. Probing the cannabinoid receptor subsite at C1' | journal = Journal of Medicinal Chemistry | volume = 46 | issue = 15 | pages = 3221–9 | date = July 2003 | pmid = 12852753 | doi = 10.1021/jm020558c }}</ref><ref>{{cite journal | vauthors = Papahatjis DP, Nahmias VR, Nikas SP, Andreou T, Alapafuja SO, Tsotinis A, Guo J, Fan P, Makriyannis A | display-authors = 6 | title = C1'-cycloalkyl side chain pharmacophore in tetrahydrocannabinols | journal = Journal of Medicinal Chemistry | volume = 50 | issue = 17 | pages = 4048–60 | date = August 2007 | pmid = 17672444 | doi = 10.1021/jm070121a }}</ref> |
|
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
== References == |
|
|
{{reflist}} |
|
<references/> |
|
|
|
|
|
|
{{cannabinoids}} |
|
{{cannabinoids}} |
|
|
|
| ⚫ |
{{cannabinoid-stub}} |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
⚫ |
{{cannabinoid-stub}} |