| Revision as of 19:36, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 401784753 of page AMN082 for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 05:10, 19 February 2023 edit Beland (talk | contribs)Autopatrolled, Administrators236,312 editsm MOS:UNITS - convert special characters found by Misplaced Pages:Typo Team/moss (via WP:JWB) |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 401783492 |
|
| verifiedrevid = 477236151 |
|
| ImageFile = AMN082_structure.png |
|
|
| ImageSize = |
|
| ImageFile = AMN082.svg |
|
|
| ImageSize = 200px |
|
| IUPACName = N,N'-dibenzhydrylethane-1,2-diamine dihydrochloride |
|
|
|
| IUPACName = ''N'',''{{prime|N}}''-Dibenzhydrylethane-1,2-diamine |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| index2_label = (dihydrochloride) |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 9873115 |
|
| ChemSpiderID = 1459618 |
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| StdInChI = 1S/C28H28N2.2ClH/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)29-21-22-30-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;;/h1-20,27-30H,21-22H2;2*1H |
|
|
|
| ChemSpiderID2 = 9873115 |
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| InChI_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| StdInChIKey = YRQCDCNQANSUPB-UHFFFAOYSA-N |
|
|
|
| InChI = 1S/C28H28N2/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)29-21-22-30-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,27-30H,21-22H2 |
| ⚫ |
| SMILES1 = Cl.Cl.N(CCNC(c1ccccc1)c2ccccc2)C(c3ccccc3)c4ccccc4 |
|
|
⚫ |
| InChI2_Ref = {{stdinchicite|correct|chemspider}} |
|
| CASNo = <!-- blanked - oldvalue: 97075-46-2 --> |
|
|
⚫ |
| InChI2 = 1S/C28H28N2.2ClH/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)29-21-22-30-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;;/h1-20,27-30H,21-22H2;2*1H |
| ⚫ |
| PubChem=11698390 |
|
|
|
| InChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| SMILES=C(NCCNC(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4.Cl.Cl |
|
|
|
| InChIKey = DTZDSNQYNPNCPK-UHFFFAOYSA-N |
|
|
| InChIKey2_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| InChIKey2 = YRQCDCNQANSUPB-UHFFFAOYSA-N |
|
|
| SMILES = C=1C=CC(=CC1)C(NCCNC(C=2C=CC=CC2)C=3C=CC=CC3)C=4C=CC=CC4 |
|
⚫ |
| SMILES2 = Cl.Cl.N(CCNC(c1ccccc1)c2ccccc2)C(c3ccccc3)c4ccccc4 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo=83027-13-8 |
|
|
| CASNo2_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo2=97075-46-2 |
|
⚫ |
| PubChem=11698390 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C = 28 | H = 28 | N = 2 |
|
| Formula=C<sub>28</sub>H<sub>30</sub>Cl<sub>2</sub>N<sub>2</sub> |
|
|
|
| Appearance= |
|
| MolarMass=465.4572 |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''AMN082''' ('''''N'',''{{prime|N}}''-dibenzhydrylethane-1,2-diamine''') is a selective ] (mGluR7) ] ].<ref name="pmid18155073">{{cite journal | vauthors = Li X, Gardner EL, Xi ZX | title = The metabotropic glutamate receptor 7 (mGluR7) allosteric agonist AMN082 modulates nucleus accumbens GABA and glutamate, but not dopamine, in rats | journal = Neuropharmacology | volume = 54 | issue = 3 | pages = 542–51 |date=March 2008 | pmid = 18155073 | pmc = 2410088 | doi = 10.1016/j.neuropharm.2007.11.005 }}</ref><ref name="pmid17622518">{{cite journal | vauthors = Palucha A, Klak K, Branski P, van der Putten H, Flor PJ, Pilc A | title = Activation of the mGlu7 receptor elicits antidepressant-like effects in mice | journal = Psychopharmacology | volume = 194 | issue = 4 | pages = 555–62 |date=November 2007 | pmid = 17622518 | doi = 10.1007/s00213-007-0856-2 | s2cid = 22011436 }}</ref> It mimics the effect of ]. AMN082 is the first selective mGluR7 ] and has expanded the potential array of research opportunities on the effects of mGluR7 in the central nervous system. |
|
|
|
|
|
==Significance== |
|
|
The two main types of ] are ] receptors and ] receptors. Ionotropic receptors (iGluRs) are fast-acting ]s and include ]s, ]s, and ]s. Metabotropic receptors are ]s that mediate slower, longer-lasting effects through second messenger systems and are responsible for other neuronal functions that are not typically controlled by iGluRs. mGluRs are split into 3 separate groups (Group I, Group II, Group III) based on pharmacological profile, sequence homology, and preferred signal transduction pathway. mGlur7 is a member of Group III, the least studied of the groups. AMN082 is pharmacological tool used to expand research on Group III mGluRs. |
|
|
|
|
|
==References== |
|
|
{{Reflist|2}} |
|
|
|
|
|
{{Metabotropic glutamate receptor modulators}} |
|
|
|
|
|
] |
|
|
] |